Home/Past Papers/Sindh / DUHS/Sindh Mcat Nts 2008
Sindh Mcat Nts 2008 — Solved Past Paper with Answers
All 99 MCQs from Sindh Mcat Nts 2008, solved with the correct answer highlighted and a full explanation for every question. This is a free MDCAT Sindh / DUHS past paper — no signup, no ads. Practise it interactively in timed mode, drill more with free MDCAT MCQs, or browse all Sindh / DUHS papers.
Attempt this paper interactively →Q1. Destitute (Give Synonym)
- A. Disable
- B. Isolated
- C. Poor✓
- D. Mangled
Explanation: Destitute means without money,food and other things necessary for life
Why the other options are wrong
- A. 'Disable' means to make someone unable to do something, which is not related to financial status or lack of necessities.
- B. 'Isolated' refers to being separated from others, not necessarily lacking in financial resources or essentials for living.
- D. 'Mangled' means severely damaged or disfigured, which is unrelated to the concept of lacking basic life necessities.
Q2. Orthodox (Give Antonym)
- A. Emangles
- B. Unconventional✓
- C. Conventional
- D. Traditional
Explanation: Orthodox means beliefs and behaviors that are generally accepted or approved (of a normal or usual type).
Why the other options are wrong
- A. 'Emangles' is not a recognized English word and does not relate to 'orthodox'.
- C. 'Conventional' means adhering to accepted standards, making it synonymous with 'orthodox', not an antonym.
- D. 'Traditional' refers to long-established customs, closely aligning with 'orthodox', thus not serving as an antonym.
Q3. Economical (Antonym)
- A. Maddest
- B. Efficient
- C. Extravagant✓
- D. Expensive
Explanation: Economical means providing good service or value in proportion to the amount of money (for small amounts of money i.e.cheaply), resources or time.
Why the other options are wrong
- A. Maddest refers to being mentally ill or insane, which is unrelated to the concept of resource management or spending.
- B. Efficient means using resources without waste, which is actually similar to being economical, not the opposite.
- D. Expensive means costing a lot of money, which doesn't directly oppose being economical, as economical refers to the use of resources, not the cost of an item.
Q4. Limitations( synonym)
- A. Shortcomings
- B. Restrictions✓
- C. Inability
- D. Vicinity
Explanation: Limitations means something which holds you back or limits you.
Why the other options are wrong
- A. Shortcomings refer to imperfections or faults, which are not the same as limitations that specifically denote constraints.
- C. Inability is the state of being unable to do something, which is related to personal capacity, not external limits.
- D. Vicinity refers to the surrounding area of a place and is unrelated to the concept of limitations or constraints.
Q5. Expedient (synonym)
- A. Scapegoat
- B. Heterogeneous
- C. Suitable✓
- D. Apathetic
Explanation: Expedient means an action that is useful or convenient for a particular purpose, though not necessarily moral or fair.
Why the other options are wrong
- A. Scapegoat refers to a person who is unfairly blamed for problems or negative outcomes, which does not reflect the practical or useful nature of 'expedient.'
- B. Heterogeneous means consisting of diverse elements or ingredients, which is unrelated to the idea of something being practical or advantageous.
- D. Apathetic means lacking interest or enthusiasm, which is unrelated to the practical or beneficial aspects denoted by 'expedient.'
Q6. Voracious:
- A. Reject
- B. Excitable
- C. Honest
- D. Greedy✓
Explanation: Voracious :wanting or devouring great quantities of food. The synonym for voracious is greedy
Why the other options are wrong
- A. a) Reject:Option (a) is not directly related to the meaning of "voracious." "Reject" means to dismiss or refuse something, and it does not capture the idea of having an intense appetite or desire.
- B. b) Excitable:Option (b) is not directly related to the meaning of "voracious." "Excitable" describes someone who is easily excited or prone to strong emotional reactions, which is not necessarily connected to an intense appetite or hunger.
- C. c) Honest:Option (c) is not directly related to the meaning of "voracious." "Honest" describes someone who tells the truth and behaves with integrity, but it does not convey the concept of having an insatiable appetite or desire.
Q7. Hamper (antonym)
- A. Ogle
- B. Clarify
- C. Assist✓
- D. Uncover
Explanation: Hamper has two meanings. One meaning is a large basket used for carrying food,wine etc. The other meaning is to prevent somebody’s free movement or activity,to restrict or hinder something or somebody. Here the second meaning is being used.
Why the other options are wrong
- A. Ogle means to look or at stare at somebody especially a woman in a way that suggest sexual interest.
- B. Clarify means to make things clear.
- D. Uncover means to remove the cover and expose the thing.
Q8. What is the synonym of the following word:Monotonous:
- A. Limited
- B. Conclusive
- C. Extremist
- D. Repetitive✓
Explanation: The correct synonym for 'monotonous' is 'repetitive,' as both terms convey the idea of something that is dull, tedious, and lacking variety due to its repetitive nature. The other options are incorrect because they describe concepts unrelated to repetition: 'Limited' pertains to constraints, 'Conclusive' refers to decisiveness, and 'Extremist' relates to radicalism.
Why the other options are wrong
- A. Although 'limited' implies a restriction or constraint, it does not encapsulate the repetitive or tedious nature of 'monotonous.'
- B. 'Conclusive' indicates a decisive or final nature, which does not align with the idea of repetition or monotony inherent in 'monotonous.'
- C. 'Extremist' is unrelated to 'monotonous,' as it describes radical views or actions, rather than repetitiveness or lack of variety.
Q9. Intensive (antonym)
- A. Casual✓
- B. Aggressive
- C. Progressive
- D. Attentive
Explanation: Intensive means extremely thorough or concentrating all one’s efforts on a specific area.
Why the other options are wrong
- B. Aggressive means ready or likely to attack or quarrel.
- C. Progressive means advancing in social conditions and efficiency.
- D. Attentive means paying close attention to something.
Q10. Precise (synonym)
- A. Concise
- B. Comprehensive
- C. Exaggerate
- D. Accurate✓
Explanation: Precise means stated clearly and accurately.
Why the other options are wrong
- A. Concise means brief but comprehensive; giving a lot of information in a few words
- B. Comprehensive means very-detailed.
- C. Exaggerate means to represent something as larger, better or worse than it really is.
Q11. In which of the following phylla, glass like silica is found?
- A. Mollusca
- B. Arthropoda
- C. Diatoms✓
- D. Starfish
Explanation: Diatoms are plant like protists (algae).The cell wall of each diatom consists of two shells that overlap where they fit together much like a petri dish.silica is deposited in the shell and this glass like material is laid down in intricate
Why the other options are wrong
- A. They are mostly found in marine and freshwater. They exhibit organ system level of organization.Their body has a cavity.The body is divided into head, visceral mass, muscular foot and mantle.The head comprises tentacles and compound eyes.The body is covered by a calcareous shell.
- B. Arthropoda (animals with jointed legs ) is the phylum with the greatest number of animals they have segmented body,appendages and cuticle where as they lack glass like silica <insects > ref :ptb page 183
- D. Starfishes belong to the phylum echinodermata<spiny skinned animals>. They have a body covered by delicate epidermis .The mesodermal cells develop a firm calcareous exoskeleton which may bear spines .They lack glass like silica.ref ptb page 190.
Q12. They store food.
- A. Plastids✓
- B. Mitochondria
- C. Ribosomes
- D. Nucleus
Explanation: Plastids are classified into chloroplasts, leucoplasts and chromoplasts. LEUCOPLASTS act as storage organs.they are colourless and may be tubular triangular or some other shape ref ptb page 61.
Why the other options are wrong
- B. Mitochondria is the poor house of the cell it acts the site of may chemical processes and its membranes help in the production of ATP ref .ptb page 59
- C. Ribosomes are sites of protein synthesis.they are either dispersed in cytoplasm or attached to ER. They are made up of two subunits joined by the action of Mg2+ ions ref.ptb page54
- D. Nucleus is the control centre of the cell it has DNA in a highly coiled form<chromosomes>,one or more nucleolus and a nuclear membrane with nuclear pores ref ptb page 62
Q13. Which of the following is replacd by thymine.
- A. Uracil✓
- B. Cytosine
- C. Guanine
- D. Adenine
Explanation: Cytosine guanine and adenine is present in both DNA and RNA .Cytosine is always equal to guanine and adenine is always equal to thymine {in DNA} and uracil {in RNA}
Why the other options are wrong
- B. Cytosine is present in both DNA and RNA and is not replaced by thymine.
- C. Guanine is a nucleobase that is found in both DNA and RNA and pairs with cytosine.
- D. Adenine is present in both DNA and RNA and pairs with thymine in DNA and uracil in RNA.
Q14. Which of the following is not an enzyme.
- A. Polymerase
- B. Hydrosere✓
- C. Isomerase
- D. Enzymate
Explanation: An enzyme is a biological catalyst.theyusly increase the efficiency of biological reaction
Why the other options are wrong
- A. Polymerase is an enzyme that catalyzes the synthesis of long chains of polymers, such as DNA and RNA. DNA polymerase and RNA polymerase help assemble DNA and RNA molecules, respectively.
- C. Isomerases are enzymes that facilitate the rearrangement of atoms within a molecule, converting one isomer into another. They play a crucial role in metabolic pathways.
- D. Enzymate is not a single enzyme but a commercial product comprising a blend of enzymes, nutrients, and surfactants. It is used for various applications but does not function as an individual enzyme.
Q15. Which of the following is the most effective way of respiration in frog.
- A. Pulmonary
- B. Bucco-pharyngeal
- C. Both buccal and pharyngeal
- D. Cutaneous✓
Explanation: In an aquatic environment, cutaneous respiration is the most effective method of respiration for a frog. However, in a terrestrial setting, pulmonary respiration becomes more prominent. Both types work in combination, but cutaneous respiration is generally considered the most effective overall.
Why the other options are wrong
- A. Pulmonary respiration involves breathing through lungs. In frogs, lungs are simple sacs used primarily in terrestrial environments, but they are not the most efficient method overall.
- B. Bucco-pharyngeal respiration is limited to the buccal cavity and is not the main method of respiration for frogs. It supports but does not replace other forms of respiration.
- C. This option describes bucco-pharyngeal respiration, which is not the primary method for effective respiration in frogs.
Q16. Plants convert solar energy to chemical energy present in the bonds of chemical substances namely:
- A. NADPH
- B. Nucleotide
- C. ATP✓
- D. RNA
Explanation: ATP is formed as a result of light reactions of photosynthesis . ATP provides chemical energy as a result of the breakage of the phosphate bond . Plants use the solar energy and convert it to chemical energy with the help of chloroplast through the process of photosynthesis.The chemical energy produced is stored in the bonds of chemical substances namely ATP. Ref ptb page 214.
Why the other options are wrong
- A. NADPH is a product of the light reactions of photosynthesis and acts as a reducing agent, providing high-energy electrons necessary for the Calvin cycle. However, it is not the primary molecule in which energy is stored in the form of bonds.
- B. Nucleotides are the building blocks of nucleic acids (DNA and RNA) and are not directly involved in storing energy derived from photosynthesis.
- D. RNA (ribonucleic acid) is involved in protein synthesis and gene expression and does not serve as a primary energy storage molecule.
Q17. The harmones which controls the contraction of uterus at the same time of birth is
- A. Prolactin
- B. Oxytocin✓
- C. Gonadotropin
- D. Antidiuretic hormone
Explanation: Oxytocin is produced by hypothalamus.Oxytocin’s release is stimulated by distension of cervix,decrease in progesterone level in blood,and neural stimuli during paturation and suckling.Primary action is on smooth muscles, particularly in the uterus during childbirth,and also causes milk ejection from mammary glands ref;ptb page74.
Why the other options are wrong
- A. Prolactin ,also called lactotropin, is a hormone made by pituitary gland and is responsible for the enlargement of breasts and milk ejection.Prolactin levels are relatively higher for pregnant women. Ref ptb page 73.
- C. Gonadotropins are FSH,LH andProlactin it is secreted by the anterior lobe of pituitary .FSH AND LH share a common hypothalamic releasing factor .Prolactin is continuously produced by the pituitary and is inhibited by the prolactin inhibiting factor ref;ptb page 73
- D. Antidiuretic hormone or vasopressin is secreted by decrease in blood pressure osmotic pressure or blood volume which is detected by the osmoreceptors in hypothalamus. ADH acts on the distal parts of nephron .lack of ADH causes diabetes insipidus ref ;ptb page 74.
Q18. Substaneous fat accumulation is necessary for
- A. Seal
- B. Shark✓
- C. Elephant
- D. Kengaroo
Explanation: Sharks belong to class chondrichthyes. They are of great economic importance.With the exception of whales, sharks are the largest vertebrates. A layer of subcutaneous fat lies between the dermis and the underlying fascia. It helps to insulate the body from cold, cushions deep tissues from blunt trauma, and serves as a reserve source of energy for the body.
Why the other options are wrong
- A. Seals also called pinnipeds belong to phylum chordata subphylum vertebrae they are fin footed semi aquatic mostly marine animals .they belongs to subclass mammalia. They don't have subcutaneous fat accumulation to protect them from cold temperatures.
- C. Kangaroos and elephants are terrestrial mammals . Most mammals have a body covering of hair instead of scales.they are warm blooded.they have keratinized skin . they don't have a subcutaneous fat accumulation.
- D. Kangaroos and elephants are terrestrial mammals . Most mammals have a body covering of hair instead of scales.they are warm blooded.they have keratinized skin . they don't have a subcutaneous fat accumulation.
Q19. Hirudin anti clotting factor is found in
- A. Leech✓
- B. Earthworm
- C. Wuchereria
- D. Nereis
Explanation: Leeches produce an enzyme in their saliva called hirudin. Hirudin is a powerful anticoagulant. They produce this to prevent their host from forming a clot so that they can feast on blood more easily. When you apply a leech, the hirudin acts locally at the bite site to allow continued bleeding for 2-3 hours after the leech is removed. While attached, the leech actively removes some of the built up blood which eases the pressure within the tissue. After the leech is removed, the built up venous blood will continue to drain from the site where the leech was attached, which is therapeutic for the tissue. The effects of the hirudin may last up to a few hours. You can tell that it's no longer active when the blood stops draining. It is at that time that you should apply another leech, unless directed by the physicians to do otherwiseAnticoagulant Hirudin is extracted from leech which is used for medicinal purposes. It can remove the clots and is hence used extensively post surgeries.
Why the other options are wrong
- B. Earthworms are not blood-feeding organisms and do not produce hirudin. They are soil-dwelling creatures that play a role in soil aeration and nutrient recycling.
- C. Wuchereria is a genus of parasitic worms causing lymphatic filariasis, but it does not produce hirudin or any anticoagulant.
- D. Nereis is a type of marine polychaete worm, which does not produce hirudin or exhibit blood-feeding behavior.
Q20. Animals and plant characters are found in
- A. Euglena✓
- B. Paramecium
- C. Bacteria
- D. Viruses
Explanation: Euglenoids have been classified in the plant and animals kingdom . Based on the molecular data, euglenoids are closely related to zooflagellates. They are plant-like in their pigments. However, some photosynthetic euglenoids lose their pigments in dark and obtain their nutrients heterotrophically by ingesting organic matter. Other species of euglenoids are always colourless and heterotrophic. Ref ; ptb page 106.
Why the other options are wrong
- B. Paramecium are unicellular ciliated protozoa characterized by their cilia. They are primarily animal-like in their behavior and nutrition and do not exhibit plant-like characteristics.
- C. Bacteria are prokaryotic organisms and do not have characteristics of plants, such as chlorophyll for photosynthesis, nor do they possess any animal-like features.
- D. Viruses are non-cellular entities with a protein coat and nucleic acid but lack any plant or animal characteristics. They cannot perform photosynthesis or ingest food.
Q21. The pathogenic bacteria transfer a DNA to another bacteria by
- A. Transduction
- B. Transformation
- C. Conjugation✓
- D. Fragmentation
Explanation: Conjugation is the direct transfer of DNA between two bacterial cells that are temporarily joined, often involving specialized structures like sex pili, and does not involve viruses.
Why the other options are wrong
- A. Transfer of DNA from one bacterium to another by a bacteriophage
- B. Transformation involves bacteria taking up naked DNA from their environment, not involving any viral intermediaries. It is a distinct process of horizontal gene transfer.
- D. Fragmentation is a form of asexual reproduction where an organism splits into fragments, with each fragment developing into a mature organism. It does not involve the transfer of DNA between bacteria.
Q22. When a prosthetic group joins with enzyme it is called:
- A. Cofactor
- B. Coenzyme
- C. Holoenzyme✓
- D. Apoenzyme
Explanation: A holoenzyme is formed by the combination of polypeptide chain and cofactor it is biochemically active ref page 37 ptb
Why the other options are wrong
- A. Cofactors are non-protein chemical compounds or metallic ions that assist enzymes in catalysis. While they are essential for enzyme activity, they do not form the complete active enzyme complex by themselves.
- B. Coenzymes are organic molecules that loosely bind to enzymes to aid in catalysis. They are often derived from vitamins and act as carriers of electrons or functional groups, but they do not constitute the entire active enzyme complex when combined with an enzyme.
- D. An apoenzyme is the protein portion of an enzyme that is inactive on its own. It requires a cofactor to become a functional enzyme, but it does not include the cofactor or form an active enzyme complex by itself.
Q23. What does not take place in meiosis
- A. Chromosomes multiplied✓
- B. Separation of chromosomes
- C. Production of hormones
- D. Production of enzymes
Explanation: Meiosis is a type of cell division in sexually reproducing organisms that reduces the number of chromosomes in gametes (the sex cells, or egg and sperm). In humans,Meiosis is a type of cell division that reduces the number of chromosomes in the parent cell by half and produces four gamete cells. This process is required to produce egg and sperm cells for sexual reproduction., body (or somatic) cells are diploid, containing two sets of chromosomes (one from each parent). REF PAGE 156 PTB
Why the other options are wrong
- B. Separation of chromosomes is a fundamental aspect of meiosis. In meiosis I, homologous chromosomes separate, and in meiosis II, sister chromatids separate, resulting in four cells with half the original chromosome number.
- C. While hormones like FSH and LH play roles in stimulating meiosis-related processes, the actual production of hormones is not a direct function of meiosis itself.
- D. Enzymes may be involved in the process of meiosis, such as those that assist in chromosome separation, but the production of enzymes is not a primary outcome of meiosis.
Q24. When phenotypically tall plants are crossed with pure dwarf plants what cross is
- A. Test Cross✓
- B. Monohybrid Cross
- C. Dihybrid Cross
- D. Multiple Cross
Explanation: MENDEL derived the test cross which is used to test the genotype of an individual showing a dominant phenotype .It is mating an individual showing dominant phenotype crossed with an individual showing a recessive phenotype . the cross finds whether the organism is homozygous or heterozygous dominant ref ptb page 167
Why the other options are wrong
- B. A monohybrid cross involves individuals that are heterozygous for a single trait. It is typically used to study the inheritance of one specific gene.
- C. A dihybrid cross examines the inheritance of two different traits simultaneously, involving individuals that are heterozygous for two genes.
- D. A multiple cross involves more than two phenotypes or genes. It is not typically used to determine the genotype of a single dominant phenotype.
Q25. In chick embryo the space between two layers is
- A. Coelom✓
- B. Blastocoel
- C. Primitive streak
- D. Gastrocoel
Explanation: The cavity formed between the somatic and splanchnic mesoderm is called coelom..REF PTB PAGE 112
Why the other options are wrong
- B. The blastocoel is a fluid-filled cavity within the blastula, formed during early embryonic development, and is not related to the coelom's formation between mesodermal layers.
- C. The primitive streak is a structure that forms on the surface of an early avian embryo and is involved in the formation of germ layers, not a cavity between layers.
- D. The gastrocoel, also known as the archenteron, is the cavity that will eventually become the gut, and is not the cavity formed between the mesodermal layers.
Q26. In which of the following regions organic materials and shells are found
- A. Littoral
- B. Abyssal✓
- C. Euphotic
- D. Bathyal
Explanation: The seafloor and water column from 3,000 to 6,500 metres (9,842 to 21,325 feet) depth is known as the abyssal zone, or the abyss. Sunlight doesn't penetrate to these depths, so the waters here are extremely dark, and the animals that live here often use bioluminescence to communicate. Organic matter, organic material, or natural organic matter refers to the large source of carbon-based compounds found within natural and engineered,terrestrial, and aquatic environments. It is matter composed of organic compounds that have come from the faeces and remains of organisms such as plants and animals.
Why the other options are wrong
- A. The littoral zone is near the shore and often has a mix of sand, silt, and organic material. However, it is not known for the abundance of decomposing organic matter and shells found in deeper ocean zones.
- C. The euphotic zone is the sunlit upper layer of the ocean where photosynthesis occurs, but it is not where organic materials and shells typically accumulate in large amounts.
- D. The bathyal zone extends from the edge of the continental shelf to around 2,000 meters deep. While it does contain some organic material, it's not as significant as in the abyssal zone.
Q27. Which parasite can survive in artificial media?
- A. Endoparasites
- B. Ectoparasites
- C. Obligate parasites
- D. Facultative parasites✓
Explanation: - Facultative: This term refers to organisms, including parasites, that can adapt and survive in different environments, including artificial media. A facultative parasite is one that can live both as a parasite on a host organism and also independently in the environment. This ability to thrive in various conditions, including artificial laboratory media, makes facultative parasites versatile and adaptable.- Obligate: Obligate parasites are those that can only survive as parasites within a host organism. They are dependent on the host for their survival and cannot live independently outside of a host.- Ectoparasite: Ectoparasites are parasites that live on the surface of the host's body. While some ectoparasites might be able to survive on artificial media for a short period, they are primarily adapted to live on the host's body.- Endoparasite: Endoparasites are parasites that live inside the host's body. Similar to ectoparasites, some endoparasites might be able to survive on artificial media temporarily, but they are primarily adapted to thrive within the host's body.
Why the other options are wrong
- A. Endoparasites live inside the host's body and typically require the host environment for survival. They are not usually capable of thriving independently in artificial media.
- B. Ectoparasites live on the surface of the host. While they may survive briefly on artificial media, they are not adapted to thrive independently outside of a host environment.
- C. Obligate parasites rely entirely on a host for their life cycle completion and cannot survive in artificial media as they require the host's biological machinery.
Q28. In light antenna complex, is not found
- A. Haemoglobin✓
- B. Chlorophyll b
- C. Chlorophyll a
- D. Carotenoids
Explanation: The antennae complex contains many molecules of chlorophyll a, chlorophyll b and carotenoids most of them channelling the energy to the reaction centre.∙All of these pigments are generally embedded in the thylakoid membrane of the chloroplast present in the plant cells. Ref ptb page 215 antenna complex is an array of protein and chlorophyll molecules embedded in the thylakoid membrane of plants and cyanobacteria, which transfer light energy to one chlorophyll a molecule at the reaction centre. Haemoglobin (Hb) is a protein found in the red blood cells that carries oxygen in your body and gives blood its red colour. Haemoglobin levels vary from person to person. Men usually have higher levels than women.
Why the other options are wrong
- B. Chlorophyll b is an accessory pigment in the light antenna complex, aiding in capturing light energy for photosynthesis.
- C. Chlorophyll a is the primary pigment in the light antenna complex and plays a crucial role in the photosynthetic process.
- D. Carotenoids are accessory pigments in the light antenna complex that help absorb light energy and protect the plant from photodamage.
Q29. If the concentration of CO2 and H+IONS increase in the body the rate of breathing will
- A. Increase✓
- B. Decrease
- C. Remain constant
- D. Voluntary
Explanation: If the level of CO2 increases the oxygen tension decreases and the capacity of haemoglobin to hold oxygen becomes less and hence the co2 tension favours the greater liberation of O2 from the blood to the tissue. If the H+ ions increase ,pH decreases and hydrogen ions combine with the protein part of the haemoglobin and decrease the oxygen binding ability of haemoglobin. So the increase in CO2 and H+ ions increase in the body the rate of breathing will increase
Why the other options are wrong
- B. Decreasing the breathing rate would lead to higher CO2 levels, worsening the acidosis, which is not an appropriate response.
- C. Breathing rate does not remain constant when CO2 and H+ ions increase; the body needs to adjust to maintain homeostasis.
- D. Breathing is primarily an involuntary process controlled by the autonomic nervous system, especially in response to changes in CO2 and pH levels.
Q30. Lacterials require which muscles to flow
- A. Unstriated and involuntary✓
- B. Striated and voluntary
- C. Striated and involuntary
- D. Unstriated and voluntary
Explanation: As lacteals are made up of smooth muscles do they are non - striated and involuntary.
Why the other options are wrong
- B. These muscles are skeletal muscles that are under conscious control and are not involved in the movement of substances like lacteals.
- C. These muscles are cardiac muscles found in the heart, which do not relate to the function of lacteals.
- D. There is no such type of muscle. Voluntary muscles are typically striated.
Q31. The theory of inheritance of acquired characters was a prposed by
- A. De Vries
- B. Darwin
- C. Lamarck✓
- D. Weismann
Explanation: Lamarck is best known for his Theory of Inheritance of Acquired Characteristics, first presented in 1801 (Darwin's first book dealing with natural selection was published in 1859): If an organism changes during life in order to adapt to its environment, those changes are passed on to its offspring.ref ptb page223.
Why the other options are wrong
- A. Hugo de Vries was a Dutch botanist who proposed the mutation theory, which focused on sudden changes or mutations as a mechanism for evolution, not acquired characteristics.
- B. Charles Darwin is famous for the theory of evolution by natural selection, which emphasizes the gradual accumulation of changes over generations, not the inheritance of acquired traits.
- D. August Weismann proposed the theory of the continuity of the germ-plasm, which argued against the inheritance of acquired traits by distinguishing between germ cells and somatic cells.
Q32. Which is associated with the long term memory
- A. Hippocampus✓
- B. Hypothalamus
- C. Brain stem
- D. Pons
Explanation: Hippocampus is a complex brain structure embedded deep into the temporal lobe.HIPPOCAMPUS plays a very important role in the formation of long term memory and is required for learning. Ref ptb page 69
Why the other options are wrong
- B. The hypothalamus is primarily involved in regulating bodily functions such as temperature, hunger, and hormone production, rather than memory processing.
- C. The brain stem is responsible for basic life functions, such as breathing and heart rate, and acts as a pathway for information between the body and the brain, not a center for memory processing.
- D. The pons assists with the regulation of breathing and sleep cycles. It is not directly involved in the formation or storage of long-term memories.
Q33. Pituitary gland is controlled by which of the following
- A. Adrenal cortex
- B. ACTH
- C. Hypothalamus✓
- D. Cytoxan
Explanation: It is a part of the forebrain.It is here that many of the sensory stimuli of the nervous system are converted into hormonal responses.it is believed that oxytocin and ADH are produced by hypothalamus and released by the pituitary. The hypothalamus secretions control the secretion of the pituitary gland. ref ptb page 72.
Why the other options are wrong
- A. The adrenal cortex is part of the adrenal glands and is primarily responsible for producing corticosteroids, such as cortisol and aldosterone. It does not control the pituitary gland.
- B. ACTH (Adrenocorticotropic hormone) is a hormone produced by the pituitary gland. It stimulates the adrenal cortex but is not responsible for controlling the pituitary gland itself.
- D. Cytoxan is the trade name for cyclophosphamide, a chemotherapy drug, which is unrelated to the control of the pituitary gland.
Q34. Bacteria takes DNA in the presence of
- A. NaOH
- B. HCl
- C. Calcium chloride✓
- D. NaCl
Explanation: Bacteria can take up foreign DNA in a process called transformation. Transformation is a key step in DNA cloning. It occurs after restriction of digestion and ligation and transfers newly made plasmids to bacteria. After transformation, bacteria are selected on antibiotic plates. Transformation takes place in the presence of CALCIUM CARBONATE. Ref ptb page 133
Why the other options are wrong
- A. NaOH is a strong base used in DNA extraction processes, but it is not used for facilitating DNA uptake in bacteria.
- B. HCl is a strong acid that can denature proteins and DNA; it is not involved in bacterial transformation.
- D. NaCl maintains osmotic balance in solutions but does not assist in DNA uptake by bacteria.
Q35. Centromeres at the end of chromosomes
- A. Acrocentric
- B. Metacentric
- C. Submetacentric
- D. None of the above✓
Explanation: Explantion is given below:
Why the other options are wrong
- A. Acrocentric chromosomes have centromeres close to one end, creating a long arm and a very short arm.
- B. Metacentric chromosomes have centromeres positioned near the middle, resulting in arms of equal length.
- C. Submetacentric chromosomes have centromeres slightly off center, creating one arm longer than the other.
Q36. In plant cell, cell wall and cell plates is the product of
- A. Golgi apparatus✓
- B. Mitochondria
- C. Endoplasmic Reticulum (ER)
- D. Plastids
Explanation: At cytokinesis, in place of the contractile ring a membrane structure,phragmoplast is formed from minute vesicles produced in the Golgi apparatus present in the cytoplasm.the vesicles originate during the metaphase line up in the centre of the dividing cell where they fuse to form the phragmoplast at the end of telophase.the membrane of vesicles forms the plasma membrane of the daughter cells. The vehicles also contain materials for future cell wall ref ptb page 154.
Why the other options are wrong
- B. Mitochondria are known as the powerhouses of the cell, responsible for ATP production through cellular respiration, and do not contribute to cell plate formation.
- C. The ER is involved in protein and lipid synthesis, detoxification, and transport within the cell, but it does not play a direct role in the formation of the cell plate in plant cells.
- D. Plastids, such as chloroplasts, are involved in photosynthesis and storage of food in plant cells, but they do not participate in the formation of the cell plate or cell wall.
Q37. Tissue fluid do not contain
- A. Wbcs
- B. Glucose
- C. Amino acids
- D. Fibrinogen✓
Explanation: The pressure within the capillaries causes a continuous leakage of the fluid from the blood into the spaces that surround the capillaries and tissues.the fluid known as the interstitial fluid Consists primarily of water ,in which dissolved nutrients.hormones,gases,wastes, glucose ,WBCs and small proteins are present .Tissue fluid is important for the exchange of substances between the blood and the cells.fibrinogen is a large protein and cannot squeeze through the holes of the capillary wall. Ref ptb page 318.
Why the other options are wrong
- A. White blood cells (WBCs) can be found in tissue fluid as they play a role in immune response and can move through capillary walls.
- B. Glucose is a small molecule that easily diffuses through capillary walls and is present in tissue fluid, providing energy to cells.
- C. Amino acids, like glucose, are small enough to pass through capillary walls and are found in tissue fluid, aiding in cell nutrition and repair.
Q38. In which of the following cycle of plasmodium which of the following is not affected
- A. Sporozoite
- B. Merozoite
- C. Cryptozoite✓
- D. Trophozoite
Explanation: During a blood meal, a malaria-infected female Anopheles mosquito inoculates sporozoites into the human host . Sporozoites infect liver cells and mature into schizonts , which rupture and release merozoites . (Of note, in P. vivax and P. ovale a dormant stage [hypnozoites] can persist in the liver (if untreated) and cause relapses by invading the bloodstream weeks, or even years later.) After this initial replication in the liver (exo-erythrocytic schizogony ), the parasites undergo asexual multiplication in the erythrocytes (erythrocytic schizogony ). Merozoites infect red blood cells . The ring stage trophozoites mature into schizonts, which rupture releasing merozoites . Some parasites differentiate into sexual erythrocytic stages (gametocytes) . Blood stage parasites are responsible for the clinical manifestations of the disease. The gametocytes, male (microgametocytes) and female (macrogametocytes), are ingested by an Anopheles mosquito during a blood meal . The parasites’ multiplication in the mosquito is known as the sporogonic cycle . While in the mosquito’s stomach, the microgametes penetrate the macrogametes generating zygotes . The zygotes in turn become motile and elongated (ookinetes) which invade the midgut wall of the mosquito where they develop into oocysts . The oocysts grow, rupture, and release sporozoites, which make their way to the mosquito’s salivary glands. Inoculation of the sporozoites into a new human host perpetuates the malaria life cycle.
Why the other options are wrong
- A. Sporozoites are the form of Plasmodium that are transmitted from mosquito to human and initiate the infection cycle in the liver.
- B. Merozoites are the stage that emerge from the liver and infect red blood cells, playing a crucial role in the disease's symptomatic phase.
- D. Trophozoites are the active feeding stage of Plasmodium within the red blood cells, crucial for the parasite's reproduction.
Q39. Which enzyme is used to cut dna into smaller pieces
- A. DNA polymerase
- B. Vector
- C. Restriction enzymes✓
- D. DNA ligase
Explanation: these are natural enzymes , which a bacteria uses against the attack of viruses A restriction enzyme is a protein isolated from bacteria that cleaves DNA sequences at sequence-specific sites, producing DNA fragments with a known sequence at each end. The use of restriction enzymes is critical to certain laboratory methods, including recombinant DNA technology and genetic engineering REF PTB PAGE 203
Why the other options are wrong
- A. There are three DNA polymerases namely I ,II AND III .DNA polymerase is a specific class of enzyme found in all living organisms. Its main purpose is to replicate DNA and to help in the repair and maintenance of DNA. The enzyme is critical to the transmission of genetic information from generation to generation. Ref page 135 ptb
- B. A vector, as related to molecular biology, is a DNA molecule (often plasmid or virus) that is used as a vehicle to carry a particular DNA segment into a host cell as part of a cloning or recombinant DNA technique ref .page 204
- D. DNA ligases play an essential role in maintaining genomic integrity by joining breaks in the phosphodiester backbone of DNA that occur during replication and recombination, and as a consequence of DNA damage and its repair
Q40. Number of chromosomes in human are
- A. 46✓
- B. 48
- C. 44
- D. 56
Explanation: A human cell has 23 pairs of chromosomes hence 46 chromosomes in total
Why the other options are wrong
- B. 48 chromosomes are found in certain other species, but not in humans.
- C. 44 chromosomes would imply missing pairs, as humans have 23 pairs, totaling 46.
- D. This is not a number associated with human chromosomal count.
Q41. Grignard reagent on reaction with methanol gives
- A. Primary alcohol
- B. Secondary alcohol
- C. Ethane✓
- D. Tertiary alcohol
Explanation: Grignard reagents are organometallic species with formula R-Mg-X. The reaction of Grignard reagents with alcohols is a type of acid – base reaction. The reaction involves the acidic nature of the O – H bond of the alcohols, as the O – H bond has removal of hydrogen.
Why the other options are wrong
- A. GRIGNARD REAGENT reacts with formaldehyde to form primary alcohol
- B. GRIGNARD REAGENT reacts with aldehyde to form secondary alcohol
- D. GRIGNARD REAGENT reacts with ketone to form tertiary alcohol.
Q42. A compound X oxidises in the presence of KMNO4 of concentrated H2SO4 to form a compound Y, which one's reaction with X gives a sweet/pleasant smell?
- A. Aldehyde
- B. Ester✓
- C. Ether
- D. Acetone
Explanation: Most ALDEHYDES have a very strong scent with a slightly greasy waxy character with a thin almost metallic twist. Other aldehydes can also give off a citrus-like, mandarin-like fragrance or a rose-like accord.
Why the other options are wrong
- A. AS esters are sweet in smell hence the product Y is ester WHEREAS X is an aldehyde
- C. Ether is sweet smelling and mildly pungent; while it can be used for inhalational induction, an ether induction is very slow and risks laryngospasm.
- D. Most ketones have fruity smell, similar to nail polish remover.
Q43. The total pressure of the gas is equal to the sum of the partial pressure of all the individual gasses due to the foloowing
- A. The total pressure results from the collision of gas molecules with the walls of the container.✓
- B. The total pressure arises from the effective collision of all individual gas molecules with each other.
- C. The total pressure comes from the collision of gas molecules with the bottom of the container.
- D. None of these options describe the reason for the total pressure.
Explanation: The partial pressure of a gas in a mixture of gases is the pressure that it would exert on the walls of the container, if it were present all alone in that same volume under the same temperature.According to Dalton's law the total pressure exerted by a mixture of non-reacting gases is equal to the sum of their individual partial pressures.’ Let the gases are designated as 1,2,3, and their partial pressures are p1 , p2 , p3 .The total pressure (P) of the mixture of gases is given by Pt = p1 + p2 + p3 REF PTB PAGE 22.
Why the other options are wrong
- B. This is incorrect. While collisions occur between molecules, they do not directly contribute to the pressure on the container walls.
- C. This is incorrect. Pressure is exerted uniformly on all walls of the container, not just the bottom.
- D. This is incorrect as option A correctly describes the principle behind the total pressure.
Q44. Metallic character of AL3+ is greater than boron
- A. Due to less electron population
- B. The number of neibouring atoms in lactic increase
- C. Both of the above✓
- D. None of the above
Explanation: The maximum capacity of electron accommodation of boron in its outermost shell is 8 electrons and that of aluminium is 18 electrons. It means the electron population of aluminium is less than boron. Due to less electron population, the number of neighbouring atoms in the latest increases. That is why metallic character of aluminium is greater than boron.
Why the other options are wrong
- A. The maximum capacity of electron accommodation of boron in its outermost shell is 8 electrons and that of aluminium is 18 electrons. It means the electron population of aluminium is less than boron. Due to less electron population, the number of neighbouring atoms in the latest increases. That is why metallic character of aluminium is greater than boron.
- B. The maximum capacity of electron accommodation of boron in its outermost shell is 8 electrons and that of aluminium is 18 electrons. It means the electron population of aluminium is less than boron. Due to less electron population, the number of neighbouring atoms in the latest increases. That is why metallic character of aluminium is greater than boron.
- D. The maximum capacity of electron accommodation of boron in its outermost shell is 8 electrons and that of aluminium is 18 electrons. It means the electron population of aluminium is less than boron. Due to less electron population, the number of neighbouring atoms in the latest increases. That is why metallic character of aluminium is greater than boron.
Q45. NaNO3 +heat->NaNO2+O2
- A. Kp > Kc✓
- B. Kp < Kc
- C. Kc = Kp
- D. Kp = Ksp
Explanation: Due to the difference in moles kp is not equal to Kc they are related by the following relation and the moles of product are greater than reactant hence Kp>Kc
Why the other options are wrong
- B. This would be true if the number of moles of gas decreased, but here the number of moles of gas increases.
- C. Kc equals Kp only if there is no change in the number of moles of gas, which is not the case here.
- D. Ksp is the solubility product constant and is not related to this gaseous equilibrium problem.
Q46. Following are not metal of group 2A
- A. Mg Be Sr Ra
- B. Be Ra Rb Ba✓
- C. Mg Be Ca Sr
- D. None
Explanation: HENCE group 2A INCLUDES BE Mg Ca Sr Ba Ra whereas Rb belongs to GROUP 1A SO B IS CORRECT
Why the other options are wrong
- A. All elements listed (Mg, Be, Sr, Ra) are part of Group 2A (alkaline earth metals).
- C. All elements listed (Mg, Be, Ca, Sr) are part of Group 2A (alkaline earth metals).
- D. This option is incorrect because there is a valid choice that includes an element not in Group 2A.
Q47. When the reaction is in equilibrium
- A. The concentration of products is equal to the concentration of reactants
- B. The rate of the forward reaction is equal to the rate of the backward reaction✓
- C. The concentration of products is not equal to the concentration of reactants
- D. All of the above
Explanation: The concentration of reactanrs and products at equilibrium depends on value of KC
Why the other options are wrong
- A. This is not necessarily true at equilibrium. The concentrations can be different depending on the equilibrium constant (Kc).
- C. This can be true, but it does not define equilibrium. Equilibrium is defined by the rates of the reactions being equal.
- D. Only the statement about the rates being equal is correct for equilibrium, so this option is incorrect.
Q48. Hydrogen has ground state energy of
- A. 1.5 eV
- B. 13.6 eV✓
- C. -0.8 eV
- D. 23.3 eV
Explanation: The ground state of a quantum-mechanical system is its stationary state of lowest energy; the energy of the ground state is known as the zero-point energy of the system. An excited state is any state with energy greater than the ground state.ground state energy of hydrogen atom is E=−13.67eV<fact>The Kinetic energy is 13.67 ev and potential energy is 27.2 ev
Why the other options are wrong
- A. This value is too low to represent the ground state energy of a hydrogen atom.
- C. This value is incorrect and represents neither the ground state nor any known energy level of a hydrogen atom.
- D. This value is too high and does not correspond to the ground state energy level of a hydrogen atom.
Q49. Hydrogen is not absorbed by
- A. Co✓
- B. Ni
- C. Pt
- D. Pd
Explanation: Hydrogen absorption is electronically an incorporation of electrons and protons into the electronic structure of the host lattice. The protons lower the energy of a part of the d-electrons and they lead to new states about 4 eV below the Fermi energy EF.
Why the other options are wrong
- B. Nickel (Ni) can absorb hydrogen under specific conditions, such as high temperature and pressure, making it a possible absorber under certain circumstances.
- C. Platinum (Pt) is known for its ability to absorb hydrogen in its interstitial voids without any chemical reaction, similar to other noble metals.
- D. Palladium (Pd) is well-known for its high capacity to absorb hydrogen, storing it in its lattice structure without any chemical change.
Q50. Bond energy ID need to know
- A. Nature of compound✓
- B. Nature of ionic compound
- C. Nature of bonding
- D. Nature of reaction
Explanation: Bond energy serves a very important purpose in describing the structure and characteristics of a molecule. It can be used to determine which Lewis Dot Structure is most suitable when there are multiple Lewis Dot Structures.Bond energy is the measure of bond strength in a chemical bond. It is the energy or heat required to break one mole of molecules into their individual atoms.Bond energy is based on an average of bond dissociation values for species in the gas phase, typically at a temperature of 298 Kelvin. It may be found by measuring or calculating the enthalpy change of breaking a molecule into its component atoms and ions and dividing the value by the number of bonds
Why the other options are wrong
- B. The nature of an ionic compound is primarily determined by the transfer of electrons and the resulting electrostatic forces, rather than bond energy, which is more relevant to covalent bonds.
- C. While bond energy can provide some information about the nature of bonding, it does not specifically determine the type of bond (ionic, covalent, etc.) without considering other factors like electronegativity differences.
- D. The nature of a reaction is influenced by the chemical identity of reactants and conditions such as temperature and pressure, rather than bond energy, which specifically pertains to the energy within molecular bonds.
Q51. 1 ounce pressure of a gas at sip contains
- A. 224000 cubic meter
- B. 22.4 cubic meter
- C. 22.4000 cubic meter
- D. 0.00224 cubic meter✓
Explanation: 1 OUNCE PRESSURE OF A GAS AT STP COVERS 0.00224 cubic meter. volume the remaining options do not show correct numerals . The volume of a gas can be determined by the following formula PV = nRT
Why the other options are wrong
- A. This volume is far too large for the conditions specified (STP), indicating a misunderstanding of the scale.
- B. This volume is the molar volume of a gas at STP in liters, not cubic meters.
- C. This is an incorrect conversion of the molar volume from liters to cubic meters.
Q52. Swollen eyes , tongue and mouth is caused by
- A. Vitamin B1 (Thiamine)
- B. Vitamin B2 (Riboflavin)✓
- C. Vitamin B12 (Cobalamin)
- D. Vitamin B6 (Pyridoxine)
Explanation: The signs and symptoms of riboflavin deficiency (also known as ariboflavinosis) include skin disorders, hyperemia (excess blood) and edema of the mouth and throat, angular stomatitis (lesions at the corners of the mouth), cheilosis (swollen, cracked lips), hair loss, reproductive problems, sore throat, itchy and red.
Why the other options are wrong
- A. Thiamine deficiency, known as beriberi, primarily affects the nervous and cardiovascular systems. Symptoms include fatigue, irritability, and nerve damage, but not specifically swelling of the eyes, tongue, and mouth.
- C. A deficiency in Vitamin B12 often results in anemia and neurological symptoms such as tingling in the hands and feet, glossitis, and mouth ulcers, but not specifically edema in the eyes, tongue, and mouth.
- D. Vitamin B6 deficiency can cause microcytic anemia and skin conditions like dermatitis and glossitis, but it is not commonly associated with swelling of the eyes, tongue, and mouth.
Q53. 66 Nylon is a polymer of
- A. Vinyl Chloride
- B. Aldehyde
- C. Adipic acid and hexamethylenediamine✓
- D. Both A and B
Explanation: Vinyl chloride polymerizes to form poly vinyl chloride Aldehydes have a low ceiling temperature (Tc) which is either at or noticeably below ambient temperature which means that these compounds do not polymerize at or above room temperature.These resins are formed by the condensation of polyamines with aliphatic dicarboxylic acids.One of the most famous condensation polymers discovered is Nylon. The word Nylon has been accepted as a generic name for synthetic polyamides. Nylon 6, 6 is the most important polyamide. It is obtained by heating adipic acid (hexanedioic acid) with hexamethylenediamine. Nylon 6,6 derives its name from its starting materials adipic acid and hexamethylenediamine,both of which have six carbon atoms. Nylon is mainly used as a textile fibre. It has a combination of high strength, elasticity, toughness and abrasion resistance REF PTB.
Why the other options are wrong
- A. Vinyl chloride polymerizes to form polyvinyl chloride, not Nylon 6,6.
- B. Aldehydes generally do not form polymers like Nylon 6,6 due to their low polymerization temperature.
- D. Neither vinyl chloride nor aldehydes are used to make Nylon 6,6.
Q54. The traid contains CL 35.5 and iodine 121 gives the atomic mass of bromine
- A. 80
- B. 81✓
- C. 72
- D. 90
Explanation: Dobereiner's triads- It states that the atomic mass of the middle element in doberiener's triad is exactly or nearly the arithmetic mean of the atomic masses of other two elements.
Why the other options are wrong
- A. 80 is close to the arithmetic mean of Chlorine (35.5) and Iodine (121) but not exactly correct.
- C. 72 is too low and does not represent the arithmetic mean of Chlorine and Iodine.
- D. 90 is too high and does not represent the arithmetic mean of Chlorine and Iodine.
Q55. Anode mud, in blistening of copper is
- A. Impure left✓
- B. Pure Cu
- C. Electrolyte
- D. Blistening copper
Explanation: Impure copper is refined by the electrolytic method in the electrolytic cell. Impure copper acts as anode and a pure copper plate acts as cathode.Copper sulphate solution in water is used as an electrolyte. Oxidation reaction takes place at the anode. Copper atoms from the impure copper lose electrons to the anode and dissolve in solution as copper ions: Reduction reaction takes place at the cathode. The copper ions present in the solution are attracted to the cathode.Pure copper is deposited on the cathode. Where they gain electrons from the cathode and become neutral and deposit on the cathode. In the process, impure copper is eaten away and purified copper atoms deposit on the cathode . the impurities settle down as anode mud
Why the other options are wrong
- B. Pure copper is deposited on the cathode, not the anode. This is not related to anode mud.
- C. The electrolyte is the copper sulfate solution used in the process, not the anode mud.
- D. Blistening copper is not a standard term in the context of electrolysis; it might be a misinterpretation. It does not relate to anode mud.
Q56. Reforming is the process to convert
- A. Smaller compounds into larger ones
- B. Straight-chain hydrocarbons into branched-chain hydrocarbons✓
- C. Less volatile compounds into more volatile ones
- D. Branched-chain hydrocarbons into cyclic compounds
Explanation: The gasoline fraction present in petroleum is generally not of good quality. When it burns in an automobile engine, combustion can be initiated before the spark plug fires. This produces a sharp metallic sound called knocking which greatly reduces the efficiency of an engine. The quality of a fuel is indicated by its octane number. As the octane number increases, the engine is less likely to produce knocking. Straight- chain hydrocarbons have low octane numbers and make poor fuels. Experiments have shown that isooctane or 2,2,4- trimethyl pentane burns very smoothly in an engine and has been arbitrarily given an octane number of 100. The octane number of gasoline is improved by a process called reforming. It involves the conversion of straight chain hydrocarbons into branched chains by heating in the absence of oxygen and in the presence of a catalyst. REF PTB CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2—>CH3-C(CH3)2-CH2-CH(CH3)-CH3 THE REACTION TAKES PLACE IN THE PRESENCE OF A CATALYST
Why the other options are wrong
- A. This refers to polymerization, not reforming. Reforming involves structural changes, not size changes.
- C. While reforming can affect volatility, the primary goal is to increase octane rating by changing the structure, not volatility.
- D. This describes a different chemical process. Reforming focuses on enhancing fuel quality by creating branched structures, not necessarily cyclic ones.
Q57. In destructive distilation of coal oil the following are obtained except
- A. Coal liquor
- B. Coal tar
- C. Colle✓
- D. Coal gas
Explanation: The main products formed after the destructive distillation of coal include coke, ammoniacal liquor (or ammonium hydroxide) coal gas and coal tar. Coal tar < Ammonia < Coal gas <coke
Why the other options are wrong
- A. Coal liquor, also known as ammoniacal liquor, is a by-product of coal distillation that contains ammonia.
- B. Coal tar is a thick, black liquid by-product of destructive distillation of coal.
- D. Coal gas is a gaseous by-product of coal distillation, used as a fuel and in chemical synthesis.
Q58. Azimuthal quantum number show
- A. Orientation in space
- B. Sizes of orbital
- C. Shape of orbital✓
- D. None
Explanation: Explanation is given below:
Why the other options are wrong
- A. The magnetic quantum number, not the azimuthal quantum number, determines the orientation of the orbital in space.
- B. The principal quantum number determines the size and energy level of an orbital, not the azimuthal quantum number.
- D. The azimuthal quantum number does have a specific purpose, which is to determine the shape of electron orbitals.
Q59. In ethane. Which of the following is correct
- A. Only carbon is hybridized
- B. No hybridization occurs in ethane
- C. Carbon atoms are sp3 hybridized in ethane✓
- D. Carbon atoms in ethane are sp2 hybridized
Explanation: Atomic orbitals differing slightly in energy intermix to form new orbitals, which are called hybrid atomic orbitals. They differ from the parent atomic orbitals in shape and possess specific geometry. The atomic orbital hybridization gives a satisfactory explanation for the valency of the elements. In some cases, the electrons belonging to the ground state are promoted to the excited state as a result of which there is an increase in the number of unpaired electrons. The electronic distribution of carbon atom should be kept in mind to understand intermixing of orbitals in C2H6, 1 s orbital and three p-orbitals (px, py, pz) take part in hybridization. There is a formation of four sp3 hybridised orbitals. During the hybridization of ethane four identical bonds are formed in a perfect
Why the other options are wrong
- A. This statement is incorrect because hydrogen atoms also participate in bonding, but they do not undergo hybridization.
- B. This is incorrect as hybridization is crucial for the formation of stable bonds in ethane.
- D. This is incorrect as sp2 hybridization is characteristic of alkenes, not alkanes like ethane.
Q60. In SN2 reaction, The rate is depending on
- A. Nu
- B. Substrate
- C. Eu
- D. Both A and B✓
Explanation: Nucleophilic substitution reactions on alkyl halides involve two main processes, the breakage of C — X bond and the formation of C — Nu bond. The mechanism of the nucleophilic substitution reactions depends upon the timing of these two processes. If the two processes occur simultaneously the mechanism is called SN2 . If the bond breaks first followed by the formation of a new bond, the mechanism is called SN1. Kinetic studies of the reactions involving SN2 mechanism have shown that the rates of such reactions depend upon the concentrations of alkyl halide as well as the attacking nucleophile. Mathematically, the rate can be expressed as: Rate = k [Alkyl halide]1 [Nucleophile]1
Why the other options are wrong
- A. The nucleophile is indeed involved in the SN2 reaction, but the rate also depends on another component.
- B. The substrate plays a crucial role in the SN2 reaction, but the reaction rate is not solely dependent on it.
- C. 'Eu' is not relevant to the SN2 reaction mechanism or its rate determination.
Q61. Unsaturated compounds are formed by the following:
- A. Elimination reaction✓
- B. Substitution reaction
- C. Nucleophilic substitution
- D. Electrophilic reaction
Explanation: Unsaturated compounds are chemical compounds which contain one or more carbon-carbon multiple bonds i.e. double or triple bonds such as those found in alkenes and alkynes respectively. Since double and triple bonds contain pi-bond, unsaturated compounds can also be defined as compounds having carbon-carbon pi-bonds.
Why the other options are wrong
- B. In substitution reactions, one atom or a group of atoms is replaced by another atom or group. This process does not involve the formation of pi-bonds, hence does not lead to the creation of unsaturated compounds. It is typically used for functional group transformations, such as the halogenation of alkanes.
- C. Nucleophilic substitution is a specific type of substitution reaction where a nucleophile replaces a leaving group. This reaction does not form unsaturated compounds, as it does not involve the creation of carbon-carbon pi-bonds. For example, the transformation of alkyl halides to alcohols falls under this category.
- D. Electrophilic reactions can involve addition or substitution processes. Neither of these typically results in the formation of unsaturated compounds. For example, electrophilic aromatic substitution in benzene or halogenation of alkenes involves the addition or exchange of groups rather than forming pi-bonds.
Q62. Glucose and fructose are linked by:
- A. 2,4-glycosidic linkage
- B. 1,4-glycosidic linkage
- C. 1,2-glycosidic linkage✓
- D. 1,1-glycosidic linkage
Explanation: Alpha-glucose and beta-fructose are linked by alpha-1,2-glycosidic linkage in sucrose. The sucrose is formed by the condensation of glucose and fructose. In this reaction. The –OH group at C-1 of glucose interacts with the –OH group at C-2 of fructose, liberating a water molecule forming alpha-1,2-glycosidic linkage.
Why the other options are wrong
- A. This is incorrect. A 2,4-glycosidic linkage is not typical for disaccharides like sucrose, which are formed from glucose and fructose.
- B. This linkage is common in other disaccharides, such as maltose, but not in sucrose.
- D. This linkage is uncommon in naturally occurring disaccharides like sucrose. Sucrose forms a 1,2-glycosidic linkage instead.
Q63. Compound having different crystalline forms this statement is related to:
- A. Allotropy
- B. Isomerism
- C. Polymorphism✓
- D. Isomorphism
Explanation: The phenomenon where a compound exists in more than one crystalline form is called polymorphism.Example: NaCl is found in cubic and octahedral forms. HgI2 is found in orthorhombic and tetragonal forms
Why the other options are wrong
- A. Allotropy refers to the existence of an element in different forms, not compounds. For example, carbon can be found as both graphite and diamond, each with distinct structures.
- B. Isomerism involves compounds with the same molecular formula but different chemical structures. An example is butane and 2-methylpropane, which are structural isomers.
- D. Isomorphism occurs when different compounds share the same crystalline structure due to similar atomic ratios, such as Ag2SO4 and Na2SO4, which are both hexagonal.
Q64. Products of exothermic reaction are
- A. Unstable
- B. Varies between stable and unstable
- C. Stable✓
- D. None of the above
Explanation: For an exothermic reaction, the products have less potential energy than the reactants and so they are more stable than the reactants because the lower the potential energy of a molecule, the more stable it is. On the other hand, for an endothermic reaction the products have more potential energy than the reactants so they are unstable compared to the reactants.
Why the other options are wrong
- A. This is incorrect. In exothermic reactions, the products are more stable because they have lower potential energy than the reactants.
- B. This is incorrect. Exothermic reactions consistently result in stable products, whereas endothermic reactions result in less stable products.
- D. This is incorrect. Exothermic reactions always produce stable products.
Q65. Rutherford discovered that the nucleus of an atom has charge
- A. No charge
- B. Positive✓
- C. Negative
- D. Very less
Explanation: Since a nucleus is made up of neutrons and protons and neutrons carry no charge and protons have positive charge,so the nucleus of an atom is positive.
Why the other options are wrong
- A. An atom has no charge because it has an equal number of protons and electrons. So this is incorrect
- C. In an atom, electrons carry negative charge. So this is incorrect.
- D. The question is about the type of charge not about the magnitude of charge carried by the nucleus, so this is incorrect.
Q66. The heat absorbed at constant volume is equal to:
- A. External pressure
- B. Energy change✓
- C. Internal pressure
- D. All of the above
Explanation: Explanation: According to the first law of thermodynamics: △E= q-P△V (1)where E is the internal energyq is the heat absorbed by the systemP△V is the work done on the systemIf volume is constant then △V=0 and so the term P△V becomes 0.Now for constant volume system equation 1 can be written as: △E=qvSo the heat absorbed by the system at constant volume changes its internal energy. It does not affect the internal or external pressure.Thus option B change in energy is the correct answer.
Why the other options are wrong
- A. External pressure does not directly affect the heat absorbed at constant volume. The heat absorbed is related to the change in internal energy, not pressure.
- C. Internal pressure is not directly affected by heat absorbed at constant volume, as the volume does not change and therefore pressure remains constant.
- D. This option is incorrect because heat absorbed at constant volume specifically relates to the change in internal energy, not to pressures.
Q67. Equilibrium is established when
- A. The rate of forward reaction = the rate of reverse reaction✓
- B. The rate of forward reaction > the rate of reverse reaction
- C. The rate of forward reaction < the rate of reverse reaction
- D. The rate of forward reaction rate of reverse reaction
Explanation: Equilibrium is the state of a reversible reaction where the rate of forward reaction is equal to the rate of reverse reaction.
Why the other options are wrong
- B. This scenario would result in a shift towards the products, as the forward reaction is faster, preventing equilibrium from being established.
- C. This scenario indicates that the reverse reaction is faster, leading to a shift towards the reactants, thus not achieving equilibrium.
- D. This option is incomplete and does not convey any meaningful relationship between the rates of the reactions, hence it is incorrect.
Q68. Rate of the reaction depends on the following factors except:
- A. Concentration
- B. Temperature
- C. Pressure
- D. Molecularity✓
Explanation: Molecularity of a reaction is the number of molecules of reactants participating in the reaction. It does not affect the rate of reaction.So this is the correct answer.
Why the other options are wrong
- A. An increase in the concentration of reactants generally leads to a higher probability of collisions, thus increasing the rate of reaction. Therefore, concentration does affect the reaction rate.
- B. Raising the temperature increases molecular kinetic energy and collision frequency, typically enhancing the rate of reaction. Hence, temperature is indeed a factor that affects the rate.
- C. In reactions involving gases, increasing pressure (by reducing volume) raises concentration and can accelerate the reaction rate. Thus, pressure is a relevant factor.
Q69. The electronic configuration of a noble gas is:
- A. ns2 np6✓
- B. ns2 np6 nd8
- C. ns2 np8
- D. None of the above
Explanation: Since noble gases have 8 valence electrons, they are present in group VIII. For group VIII-A the electronic configuration is ns2 np6.
Why the other options are wrong
- B. This configuration incorrectly suggests additional electrons in the d orbital, exceeding the typical valence shell capacity of noble gases.
- C. This configuration is not possible as the p orbital can only hold a maximum of 6 electrons.
- D. The correct configuration is provided among the options.
Q70. Cathode rays do not depend upon:
- A. Neither on gas nor on the material of the cathode✓
- B. Neither on H2SO4 nor on the liquid used
- C. All of the above
- D. None of the above
Explanation: Since cathode rays are electrons and electrons are the same for all matter, that’s why the nature of cathode rays does not depend on the gas used in the glass tube or the material of the cathode.
Why the other options are wrong
- B. This is incorrect. Cathode rays are not related to liquids such as sulfuric acid (H2SO4), as they are produced in a gas discharge tube.
- C. This is incorrect. While cathode rays do not depend on the gas or cathode material, they are not related to H2SO4 or any liquids as there is no relation between cathode rays and liquids as it is not used in it setup so we can make its as useless option, making this option invalid.
- D. This is incorrect. There is a correct statement regarding the independence of cathode rays from gas and cathode material, so this option is not valid.
Q71. If T of a string is increased four times what will be the speed of wave:
- A. v/2
- B. v/4
- C. 2v✓
- D. 4v
Explanation: Explanation: The wave speed on string is: v =T/µWhere v is the velocity of the waveT is the tension of the string is the linear density of the string. ( Linear density is mass per unit length).So the wave speed is directly proportional to the square root of tension of the string. v∝TSo if tension quadruples, velocity doubles.
Why the other options are wrong
- A. This option suggests that the velocity is halved, which would imply a decrease in tension, not an increase.
- B. This option implies a significant decrease in velocity, which is incorrect given an increase in tension.
- D. This option suggests that the velocity increases fourfold, which would require the tension to increase sixteenfold.
Q72. Sone is the unit of loudness. What is the relationship of sone with decibels?
- A. 1 sone = 40 dB
- B. 1 sone = 40 dB at 100 Hz
- C. 1 sone = 40 dB at 1000 Hz✓
- D. 1 sone = 40 dB at 10,000 Hz
Explanation: According to Steven’s definition, a loudness of 1 sone is exactly equal to 40 db at 1000 Hz (1kHz).
Why the other options are wrong
- A. This option does not specify the frequency, which is essential for this relationship.
- B. While 100 Hz is a frequency, it is not the standard frequency used when defining 1 sone.
- D. 10,000 Hz is not the correct frequency for defining 1 sone in terms of decibels.
Q73. Three sources each of 1.5 volt are connected in series such that the negative terminal of one battery is connected with the positive terminal of the other battery.what is the net emf:
- A. 3 volt
- B. 4.5 volt✓
- C. 15 volt
- D. 6 volt
Explanation: When voltage sources are connected in the series facing the same direction, their voltages are added algebraically to get net emf. As all the cells are connceted end to end in such away that the lower potential of one battery is connected to the higher potential of other battery,voltage of every battery will be taken positive.So 1.5+1.5+1.5=4.5Hence, B is the correct answer.
Why the other options are wrong
- A. Three 1.5 volt batteries in series would not result in 3 volts. This would be the case if only two batteries were connected.
- C. 15 volts is incorrect because it implies a much higher voltage than the total possible from three 1.5 volt batteries.
- D. 6 volts would be the sum of four 1.5 volt batteries in series, not three.
Q74. Electromagnetic waves depend upon:
- A. Permittivity of the medium only
- B. Permeability of the medium only
- C. Both permittivity and permeability of the medium✓
- D. Nature of the medium
Explanation: Explanation: The speed of electromagnetic wave in a medium is given by: V=1/µ∊Where is the permeability of the medium and is the permittivity of the medium. This means the electromagnetic wave depends on the electric and magnetic properties of the medium which are defined by its permittivity and permeability.
Why the other options are wrong
- A. This is incorrect. Although permittivity affects electromagnetic waves, it is not the sole factor.
- B. This is incorrect. Permeability impacts electromagnetic waves, but it is not the only factor involved.
- D. While the nature of the medium can influence wave behavior, the specific factors of permittivity and permeability are what determine the speed of electromagnetic waves.
Q75. If light enters from air to denser medium of “n” refractive index, then wave speed:
- A. Increases “n” times
- B. Decreases “n” times✓
- C. Decreases
- D. Remains same
Explanation: The refractive index is the measure of the bending of a ray of light when passing from one medium into another.It is also a measure of how much light slows down in any medium.Mathematically, it is the ratio of the velocity of light in a vacuum to its velocity in a specified medium i.e. n=c/v v=c/nwhere n is the refractive index c is the speed of light in vacuum or air v is the speed of light in any specified mediumSo from the above equation, it is clearly evident if light enters a medium of “n” refractive index from air, its speed decreases by “n”.
Why the other options are wrong
- A. This is incorrect. When light enters a denser medium, its speed does not increase. In fact, it decreases due to the higher refractive index.
- C. This is partially correct but lacks specificity. The speed of light decreases, but the exact amount is 'n' times slower in a medium with refractive index 'n'.
- D. This is incorrect. The speed of light changes when it enters a medium with a different refractive index.
Q76. Shadow is formed due to the phenomenon of:
- A. Interference
- B. Polarisation
- C. Diffraction
- D. Rectilinear Propagation of Light✓
Explanation: A shadow is an interception of light.The phenomenon of rectilinear light propagation causes shadows to form. When a person, animal, or object obstructs a portion of a light source, a shadow is produced.Shadows form in the opposite direction of whatever is blocking that source.
Why the other options are wrong
- A. Interference refers to the combination of two or more waves to form a resultant wave of greater, lower, or the same amplitude. This does not cause shadow formation.
- B. Polarization involves the restriction of light vibrations to a single plane. It does not lead to the formation of shadows.
- C. Diffraction is the bending of light around obstacles, which can lead to the blurring of shadows but not their formation.
Q77. If A.B=0, then between them is:
- A. 0
- B. 45
- C. 60
- D. 90✓
Explanation: Dot product of two vectors is obtained by multiplying their magnitudes and the cos of angle between them. It is orepresented by a dot(.) between the two vectors. A.B=ABcosNow if A and B are nonzero vectors, their dot product can only be zero if cos is zero. As cos 90=0, hence the angle between them is 90 degrees.BEWARE: cos 0=1
Why the other options are wrong
- A. An angle of 0 degrees means the vectors are parallel and the dot product would not be zero.
- B. An angle of 45 degrees results in a positive dot product, not zero.
- C. An angle of 60 degrees also results in a positive dot product, not zero.
Q78. Energy of hydrogen atom in ground state is:
- A. -13.6eV✓
- B. -0.65eV
- C. -10.2eV
- D. -0.25eV
Explanation: Explanation: Expression for the energy of th nth allowed orbit in the hydrogen atom is: En=- 13.6eVn In ground state, n=1So E=-13.6eV
Why the other options are wrong
- B. This value does not correspond to any specific energy level of a hydrogen atom. It is significantly higher than the energy for the ground state.
- C. This value might seem close, but it does not match any known energy level of the hydrogen atom, especially not the ground state.
- D. This is far off from the energy required for any of the hydrogen atom's energy levels, including the ground state.
Q79. Dot product of force and velocity is:
- A. Rate of energy
- B. Rate of work✓
- C. Rate of power
- D. Rate of change of momentum
Explanation: Dot product of two vectors always gives a scalar. Dot product of force and velocity is power or rate of work.
Why the other options are wrong
- A. This is incorrect. Power is the rate at which work is done or energy is transferred. It's not simply the rate of energy.
- C. This is incorrect. The rate of power would imply a change in power over time, which is not what the dot product of force and velocity represents.
- D. This is incorrect. The rate of change of momentum is equivalent to force, not power.
Q80. If ʎ is decay constant then half life is:
- A. 0.693
- B. 0.693/ʎ✓
- C. ʎ/0.693
- D. 0.963/ʎ
Explanation: The time required for half of the original population of radioactive atoms to decay is called the half-life. The relationship between the half-life, T1/2, and the decay constant is given by T1/2 = 0.693/λ.
Why the other options are wrong
- A. This is a constant, but on its own, it does not represent the half-life. It is part of the formula for calculating half-life.
- C. This option incorrectly inverts the relationship between decay constant and half-life. The decay constant should be in the denominator.
- D. This option uses an incorrect constant. The correct constant for calculating half-life is 0.693, not 0.963.
Q81. When a body moves downward on inclined path in the presence of friction “f”, force on the body is:
- A. W sinØ - f✓
- B. W cosØ - f
- C. W cosØ
- D. F - W sinØ
Explanation: Explanation: The main forces on the body moving down an inclined path are friction and weight.On an inclined plane, the object moves down due the horizontal component of weight(mgsin or Wsin). If there is friction then net force on the object will be WsinØ-f.Fnet= WsinØ- f
Why the other options are wrong
- B. This option is incorrect because the cosØ component of weight acts perpendicular to the incline, not contributing to the downward motion.
- C. This option is incorrect as it considers only the normal force component, which does not affect the motion along the incline.
- D. This option misrepresents the forces, as it implies an external force 'F' that isn't described in the problem. The net force should consider friction acting against gravity.
Q82. According to thermodynamics, at constant volume Q=?
- A. Q=0
- B. Q=△W
- C. Q=△E✓
- D. Q=△E+P△V
Explanation: A process which occurs at constant volume is called an isochoric process.According to the first law of thermodynamics: △E= q-P△ V (1)where E is the internal energy q is the heat absorbed by the system P△V is the work done on the systemIf volume is constant then△ V=0 and so the term P△V becomes 0.Now for constant volume system equation(1)can be written as: △ E=qvSo the heat absorbed by the system at constant volume changes its internal energy.
Why the other options are wrong
- A. This is true for an adiabatic process where no heat is exchanged, but not for a constant volume process.
- B. This applies to an isothermal process where the change in internal energy is zero, not to a constant volume process.
- D. This is the expression for heat exchanged at constant pressure (isobaric process) and includes work done by volume change.
Q83. Velocity of sound is:
- A. Directly proportional to the absolute temperature
- B. Directly proportional to the square root of absolute temperature✓
- C. Directly proportional to the pressure
- D. Directly proportional to the square root of centigrade temperature
Explanation: The velocity of sound in gas is:So velocity of sound depends only on the absolute temperature of the gas, molar mass of gas and gamma( which is specific for every gas).
Why the other options are wrong
- A. This is incorrect. The velocity of sound is proportional to the square root of the absolute temperature, not directly proportional to it.
- C. This is incorrect. The velocity of sound in a gas is independent of pressure as long as the temperature remains constant, because pressure and density change proportionally.
- D. This is incorrect. The velocity of sound is related to the absolute temperature (Kelvin), not the centigrade temperature (Celsius).
Q84. The velocity of alpha particles is:
- A. 0.2 * 10^8 m/s
- B. 0.5 * 10^8 m/s
- C. 0.3 * 10^8 m/s
- D. 0.1 * 10^8 m/s✓
Explanation: Alpha particle shoots out from the nucleus with a high velocity of 0.1 *10^8 m/s.STB Pg-331.
Why the other options are wrong
- A. This speed is higher than the typical velocity of alpha particles emitted from the nucleus.
- B. This speed is significantly higher than what is typically observed for alpha particles.
- C. This speed is also above the usual range for alpha particles emitted from nuclear reactions.
Q85. Question is given below:
- A. 0✓
- B. 1
- C. -1
- D. 1/2
Explanation: The cross product of two parallel vectors is always zero because the sine of the angle between them is zero. In this case, i × i = |i||i| sin(0) = 0. This means that when dealing with parallel vectors, the resulting cross product will always be zero, as seen in Option A. Options B, C, and D are incorrect because they do not consider the fact that parallel vectors have a sine of 0, resulting in a cross product of 0.
Why the other options are wrong
- B. This option is incorrect. The magnitude of the cross product depends on the sine of the angle between the vectors. Since the vectors are parallel, the angle is zero, making the cross product zero.
- C. This option is incorrect. The cross product calculation involves the sine of the angle between the vectors, which is zero for parallel vectors, resulting in a cross product of zero.
- D. This option is incorrect. The cross product of two parallel vectors results in zero because the sine of zero degrees is zero.
Q86. The carrier waves are over modulated to be distorted version of modulating signal when:
- A. m=1
- B. m>1✓
- C. m<1
- D. m=1
Explanation: Amplitude modulation is the modification of the carrier's amplitude in response to the modulating signal.When the modulation is so strong that the carrier wave clips, the signal is said to be excessively modulated (distorts in AM).The modulation index of an amplitude modulated signal is defined as the measure or extent of amplitude variation about an un-modulated carrier. This can be expressed in mathematical terms as below:Modulation Index,m m=M/AWhere: A = the carrier amplitude. M = the modulation amplitude .If this m>1, overmodulation takes place and the carrier signal is distorted. Over-modulation is the result of raising the level of modulation above a modulation index of 1, or more than 100% modulation.
Why the other options are wrong
- A. When m=1 the amplitude of the carrier signal is 100 percent modulated.
- C. When m<1 the carrier is under modulated.
- D. When m=1, the carrier signal is not completely modulated.
Q87. If the axis of rotation passes through the body and the body moves around then the motion is called:
- A. Spin motion✓
- B. Orbital motion
- C. Rectilinear motion
- D. Translatory motion
Explanation: Spin motion is the motion of an object as it rotates around an axis through its center of mass. Example: rotational motion of earth
Why the other options are wrong
- B. Orbital motion involves an object moving in a path around an external point or body, such as the Earth orbiting the Sun.
- C. Rectilinear motion refers to movement along a straight line, such as a car driving along a straight road.
- D. Translatory motion is when the entire body moves in a uniform direction without rotation, such as a sliding box.
Q88. Which instrument is used to detect the path of visible rays:
- A. Geiger counter
- B. Wilson cloud chamber
- C. Solid state detector
- D. None of the above✓
Explanation: None of the above devices is used for detecting the path of visible radiation.
Why the other options are wrong
- A. A Geiger counter is an electronic device used to detect and measure ionizing radiation, such as alpha particles, beta particles, and gamma rays. It does not visualize the path of radiation, only measures its intensity.
- B. A Wilson cloud chamber is a device used to visualize the path of charged particles, such as alpha or beta particles, by creating visible trails in supersaturated vapor. It is primarily used for ionizing radiation, not visible light.
- C. Solid state detectors are used to detect ionizing radiation by converting the energy of the particles into electrical signals. They do not visualize or trace the path of radiation.
Q89. Number of lines originating from q to the surface area of sphere is:
- A. Flux intensity
- B. Flux density✓
- C. Flux linkage
- D. Flux region
Explanation: Number of lines originating from the charge is the electric field. Electric field density is electric flux per unit area held perpendicular to electric field lines. So it is an electric field.
Why the other options are wrong
- A. Flux intensity is not a standard term in physics. It might be confused with the intensity of a field, but it does not directly relate to the concept of lines originating from a charge.
- C. Flux linkage generally refers to a concept in electromagnetism involving coils and magnetic fields, not the electric field lines emanating from a charge.
- D. Flux region is not a recognized term in physics related to electric fields or charges. It does not describe the interaction of field lines with surfaces.
Q90. Relation between linear velocity and angular velocity is
- A. v = rω✓
- B. r = vω
- C. s = r
- D. v = △s/△t
Explanation: Let Δθ be the angular displacement of the body.Let "Δt" be the time taken.Then angular velocity of the body is ω=△s/△t (1)Now let v be the linear velocity of the body,then v=△S/△t (2)where △S is the arc length covered by the body in △t.As we know; △S=r△θSubstituting in (2), we get v=r△θ/△t v=r△θ/△t From (1), we get v=rω
Why the other options are wrong
- B. This is incorrect as it rearranges the correct formula incorrectly. The correct relationship involves multiplying the radius by angular velocity to get linear velocity.
- C. This equation is incorrect as it relates arc length (s) directly to the radius, ignoring the angular displacement. For arc length, the formula is s = rθ.
- D. This is a general formula for linear velocity, but it doesn't directly relate angular velocity and linear velocity. It simply defines velocity as the rate of change of displacement.
Q91. Gauss’s law can be used to find electric field intensity:
- A. Charge enclosed in a sphere
- B. Charge placed between two oppositely charged surfaces
- C. Charge on an infinite sheet of paper
- D. All of the above✓
Explanation: Gauss’s laws states that the net electric flux through any closed surface is 1/o times the total charge enclosed in it. O=Q/∊oIt can be used for calculating the electric field in the case of charge distribution by considering a gaussian surface and applying gauss’s law. It can be used to find the electric field of an infinite sheet of paper, two oppositely charged plates and charge placed inside a sphere.
Why the other options are wrong
- A. Gauss's law can be applied to a sphere to find the electric field due to a symmetrical charge distribution inside or on the surface of the sphere.
- B. This scenario uses Gauss's law to calculate the electric field in situations like parallel plate capacitors where uniform fields are idealized.
- C. An infinite sheet of charge is another scenario where Gauss's law helps determine the electric field, using the concept of an infinite plane.
Q92. Instrument having very high magnification used to see microorganisms clearly
- A. Simple microscope
- B. Compound microscope✓
- C. Telescope
- D. Magnifying glass
Explanation: A microscope is a tool used to see items that are too tiny to be seen by the human eye. The most popular kind of microscopes are light microscopes, often called optical microscopes. Images are magnified by optical microscopes using light and lenses.
Why the other options are wrong
- A. A simple microscope typically has a magnification of up to 10X because it uses a single lens. It is not sufficient for viewing microorganisms in detail.
- C. A telescope is designed for viewing distant astronomical objects and is not suitable for observing microorganisms due to its focus on large distances.
- D. A magnifying glass typically provides 2X to 3X magnification, which is not enough to view microorganisms or cellular structures in detail.
Q93. If radius of earth decrease by half and mass remains unchanged, then the value of “g” is:
- A. 4g✓
- B. 2g
- C. g/4
- D. g/2
Explanation: the formula for gravitational constant “g” is: g=GM/R2 (1)Where G is universal gravitational constant M is mass of the earth R is the radius of the earth.The new value of "g" is now obtained from equation(1) by substituting R'=R2as follows: g'=GM/R2/4 g'=4GM/R2 g'=4gSo new gravitational acceleration g' is four times its initial value.The right response is thus option A, which states that if the earth's radius were cut in half but its mass remained constant, the acceleration caused by gravity would increase by four times.
Why the other options are wrong
- B. This option suggests that the gravitational acceleration would only double, which is incorrect. A halving of the radius leads to a quadrupling of 'g', not a doubling.
- C. This option implies that the gravitational acceleration decreases, which is incorrect. The acceleration actually increases when the radius is decreased while mass remains unchanged.
- D. This option suggests the gravitational acceleration is halved, which is incorrect. Reducing the radius results in an increase, not a decrease, in gravitational acceleration.
Q94. Ratio of emf in a potentiometer is directly proportional to ratio of:
- A. Balancing lengths✓
- B. Balancing widths
- C. Balancing heights
- D. None of the above.
Explanation: A potentiometer is a null type resistance network device for measuring potential differences. Balancing length is the length for which the galvanometer does show deflection because the current passing through it is zero. For potentiometer: ∊1/∊2=i1/i2Where l1 and l2 are lengths at which e.m.f 1 and 2 are balanced respectively. So they are balancing lengths. So for a potentiometer the ratio of emf is equal to the ratio of balancing lengths.
Why the other options are wrong
- B. Width is not a factor in the operation of a potentiometer. The device functions based on length, not width.
- C. Height does not influence the potentiometer's measurements. The concept of 'balancing heights' is not applicable in this context.
- D. This option is incorrect because there is a correct relationship between the ratio of emf and balancing lengths in a potentiometer.
Q95. What is the formula of concave lens without convention of sign:
- A. 1/q - 1/q = 1/f
- B. 1/p + 1/q = 1/f✓
- C. 1/p - 1/p = 1/f
- D. 1/p - 1/q = 1/f
Explanation: A concave lens is a diverging lens. Without sign convention B is the correct answer. But with sign convention D is correct because is forms a virtual image.
Why the other options are wrong
- A. This option is incorrect because it incorrectly subtracts the same variable, which is not applicable in lens formulas.
- C. This option is incorrect as it subtracts the same variable, resulting in zero on the left side, which cannot satisfy a lens formula.
- D. This formula is correct with the sign convention for a concave lens, as it considers the virtual nature of the image formed.
Q96. If the power of a lens in 2 diopter and of the other is -4 diopter what is the focal length of the combination of lens:
- A. 20cm
- B. 50cm✓
- C. 100cm
- D. 500cm
Explanation: The power of combination of lenses is the algebraic sum of the individual powers of the lenses.So P= +2-4= -2 diopterNow focal length is: f=1P f=½= o.5m= 0.5100= 50 cm
Why the other options are wrong
- A. This option results from a miscalculation of the combined power or converting the focal length incorrectly.
- C. This option suggests a misunderstanding of the focal length calculation involving diopters.
- D. This option indicates a significant error in either the addition of powers or the conversion to focal length.
Q97. In a solid state conductor:
- A. Sealed tube is used
- B. Argon is used
- C. P-N junction is used✓
- D. All of the above can be used
Explanation: Solid state detectors are also called semiconductor radiation detector.Radiation detectors that use a semiconductor material such as silicon or germanium as the detecting medium are known as solid-state semiconductor detectors. When these detectors come into contact with ionizing radiation, they generate a pulse of electric current using pairs of charge carriers, electrons and holes.
Why the other options are wrong
- A. Sealed tubes are typically associated with vacuum tube technology, not solid-state conductors.
- B. Argon is an inert gas and is not typically used in solid-state conductors.
- D. Not all listed items are used in solid-state conductors; only the P-N junction is relevant.
Q98. Light having range of 7.610-7cm to 4.010-7 cm lies in the region
- A. Infrared radiation
- B. X-rays
- C. Visible radiation✓
- D. U.V radiation
Explanation: The electromagnetic spectrum categorizes electromagnetic radiation based on wavelength. The range of 7.610-7 cm to 4.010-7 cm corresponds to approximately 760 nm to 400 nm, which is the range for visible light, making option C the correct choice. Options A and D are incorrect because they refer to regions with longer (Infrared) and shorter (UV) wavelengths, respectively, while option B is incorrect as X-rays have much shorter wavelengths than those given in the question.
Why the other options are wrong
- A. Infrared radiation has longer wavelengths than visible light, typically ranging from about 700 nm (7.0 x 10-7 m) to 1 mm. The given range is shorter than that of infrared radiation.
- B. X-rays have much shorter wavelengths, ranging from about 0.01 nm to 10 nm. The provided wavelength range is significantly longer than that of X-rays.
- D. Ultraviolet (UV) radiation has shorter wavelengths than visible light, typically ranging from about 10 nm to 400 nm. The wavelengths in the question exceed this range.
Q99. Which is the type of collision in which both the linear momentum and the kinetic energy of the system remain conserved?
- A. Inelastic Collision
- B. Elastic Collision✓
- C. Both a and b
- D. None of the options
Explanation: In an elastic collision, the linear momentum and the kinetic energy of the system remains conserved.
Why the other options are wrong
- A. In an inelastic collision, only the linear momentum is conserved, and the kinetic energy is not conserved as some of it is transformed into other forms of energy, such as heat or sound.
- C. This option is incorrect because an inelastic collision does not conserve kinetic energy, whereas an elastic collision does.
- D. This option is incorrect because there is a type of collision, specifically the elastic collision, where both linear momentum and kinetic energy are conserved.
More Sindh / DUHS Solved Papers
Biology
Sindh Botany 2018
16 solved MCQs
Biology
Sindh Botany 2019
16 solved MCQs
Biology
Sindh Botany 2021
20 solved MCQs
Biology
Sindh Botany 2022
15 solved MCQs
Biology
Sindh Botany 2024 Model Paper
15 solved MCQs
Chemistry
Sindh Chemistry 2018
16 solved MCQs
Chemistry
Sindh Chemistry 2019
17 solved MCQs
Chemistry
Sindh Chemistry 2021
43 solved MCQs
Chemistry
Sindh Chemistry 2022
33 solved MCQs