Home/Past Papers/Sindh / DUHS/Sindh Mdcat Mock Paper 1
Sindh Mdcat Mock Paper 1 — Solved Past Paper with Answers
All 179 MCQs from Sindh Mdcat Mock Paper 1, solved with the correct answer highlighted and a full explanation for every question. This is a free MDCAT Sindh / DUHS past paper — no signup, no ads. Practise it interactively in timed mode, drill more with free MDCAT MCQs, or browse all Sindh / DUHS papers.
Attempt this paper interactively →Q1. Complete the sentence by choosing the most appropriate option:There _ many students waiting to hear the results of the test.
- A. Has
- B. Have
- C. Was
- D. Are✓
Explanation: Students are plural. So, the helping verb should also be plural, which are “have” and “are”.Have can not be used here because it is used in perfect tense which has the 3rd form of verb while here we have the continuous form of verb i.e. “waiting”. So, the answer is D.
Why the other options are wrong
- A. Students are plural so the helping verb should also be plural, which are "have" and "are". So that eliminates option A and C. As the verb in the sentence is in continuous form so the correct option is D "are".
- B. Option B is incorrect because Have cannot be used here as it is used in the sentence having 3rd form of verb i.e. Perfect tense.
- C. Students are plural so the helping verb should also be plural, which are "have" and "are". So that eliminates option A and C. Moreover, "was" is used with singular nouns. As the verb in the sentence is in continuous form so the correct option is D "are".
Q2. Choose the word most similar in meaning to the capitalized one.UNAMBIGUOUS:
- A. Exact
- B. Clear✓
- C. Intresting
- D. Sufficient.
Explanation: Ambiguity refers to something being not clear and easily understood. Since the word here is Unambiguous, clear will is the word closest in meaning to it.
Q3. Complete the sentences by choosing the most appropriate option, from the given lettered choices below:He would like _ have a job in the same office as his brother.
- A. Too
- B. To✓
- C. Of to
- D. Get
Explanation: The correct preposition to use over here will be "to" because all others don't make sense here grammatically.Too is used to imply collectiveness, which is not the context here. Of to and get don't make any sense when plugged in.
Why the other options are wrong
- A. “Too” is an adverb of degree that can mean “excessively,” “also,” or “very.” It is used before an adjective or adverb or before “much”, “many”, “few” etc. It is used when the speaker wants to show so much of a particular quality that something is not possible (Example: I was too excited to sleep.) or when the speaker wants to express that something is more than necessary or acceptable (Example: You’re driving too fast.). It is also used after mentioning an additional person, thing, or fact to show that they are also included in what you are saying (Example: Sana’s got a lovely voice and she’s a good dancer too.).
- C. “Of” and “to” are two separate prepositions that can’t be used as a prepositional phrase because it only possible to use two prepositions together if the second one is creating a noun phrase. Hence, “of to” does not make sense grammatically.
- D. The verb “get” is an irregular verb. Its three parts are get, got, gotten. It is used as get + object or get + indirect object + direct object when the speaker wants to express the meaning of “fetch” or “receive” or “obtain” (Example: Can you get me a glass of water?). It is also used as a get + adjective to describe a change of state or situation (Example: Let’s hope she gets better soon.).
Q4. Choose the word opposite in meaning to the word in capital letters.DEMONSTRATE:
- A. Show
- B. Display
- C. Conceal✓
- D. Expose
Explanation: Demonstrate means to clearly show the existence or truth of (something) by giving proof or evidence. Conceal means to not allow to be seen; hide, so totally opposite, hence option C is correct.
Why the other options are wrong
- A. "Show" is somewhat related to "demonstrate" in terms of presenting or making something visible.
- B. "Display" is somewhat related to "demonstrate" in terms of presenting or making something visible.
- D. "Expose" means to reveal, uncover, or make something known or visible. While it shares the idea of revealing with "demonstrate," it does not capture the act of showing or explaining something in a deliberate and intentional manner.
Q5. Identify the word or phrase that needs to be changed for the sentence to be correct:Children depend on their parents for food and clothing.
- A. Depend
- B. Their
- C. For
- D. And
- E. No error✓
Explanation: The sentence 'Children depend on their parents for food and clothing' is correctly constructed with no grammatical errors. Each component, including the verb phrase 'depend on,' the possessive pronoun 'their,' the preposition 'for,' and the conjunction 'and,' is used appropriately. Therefore, Option E: No error is the correct choice. Options A-D are incorrect because each word they highlight is used correctly in the sentence.
Why the other options are wrong
- A. The verb “depend” is correctly used with the preposition “on” to form the phrasal verb “depend on,” which indicates reliance. There is no grammatical issue with this usage in the sentence.
- B. The pronoun “their” accurately reflects possession for “children” in the sentence. It is used correctly as a possessive pronoun.
- C. The preposition “for” is used correctly to indicate the purpose or reason, explaining what the children rely on their parents for. It is grammatically accurate in this context.
- D. The conjunction “and” connects the two items, food and clothing, efficiently and correctly. It shows that both items are equally important in the context.
Q6. Choose the correct spelling:
- A. Defnite
- B. Defanit
- C. Dafanite
- D. Definite✓
Explanation: "Definite" is the correct spelling which means “to be on point”.
Why the other options are wrong
- A. It is not a valid spelling.
- B. It is also not a valid spelling.
- C. This spelling is not valid.
Q7. Choose the correct sentence:
- A. I wish I have been a millionaire.
- B. I wish I am being a millionaire.
- C. I wish I were a millionaire.✓
- D. I wish I was a millionaire.
Explanation: The correct sentence is:I wish I were a millionaire.The sentence is used by the speaker to express an unfulfilled desire (to be a millionaire). This means that the person is referring to an event in the past that they wanted to be trueHence, Option C is correct option.
Why the other options are wrong
- A. After wish, you cannot use present perfect (have been). Wishes about the present require past tense, and wishes about the past require past perfect.
- B. After “I wish,” we must use a past tense (were) to show an unreal or impossible situation — not am being, which is present continuous. Am being describes a temporary action, but being a millionaire is not an action you “are being” — it is a state, so continuous tense cannot be used
- D. After “wish,” English requires the subjunctive mood, which uses “were” (not was) to show an unreal or imaginary situation.
Q8. Fill in with the appropriate Article: _apple _ day keeps _doctor away.
- A. the/a/a
- B. an/a/an
- C. an/the/the
- D. a/a/the
- E. an/a/the✓
Explanation: Articles an/a/the are the correct articles to be used here so option E is correct answer.
Why the other options are wrong
- A. This option suggests using the definite article "the" before "apple," the indefinite article "a" before "day," and the indefinite article "a" before "doctor." It would result in "The apple a day keeps a doctor away." This option is grammatically correct and conveys the idea that any apple can have the mentioned effect on a person's health.
- B. This option suggests using the indefinite article "an" before "apple," the indefinite article "a" before "day," and the indefinite article "an" before "doctor." It would result in "An apple a day keeps an doctor away." The incorrect usage of "an" before "doctor" should be corrected to "a" since "doctor" begins with a consonant sound.
- C. This option suggests using the indefinite article "an" before "apple," the definite article "the" before "day," and the definite article "the" before "doctor." It would result in "An apple the day keeps the doctor away." The use of the definite articles "the" before "day" and "doctor" is not appropriate here. The sentence does not refer to specific or previously mentioned days or doctors.
- D. This option suggests using the indefinite article "a" before "apple," the indefinite article "a" before "day," and the definite article "the" before "doctor." It would result in "A apple a day keeps the doctor away." The incorrect usage of "A" before "apple" should be corrected to "An" since "apple" begins with a vowel sound.
Q9. Fill in with a suitable Verb: The teacher_ completed this chapter.
- A. Have
- B. Is
- C. Are
- D. Has✓
- E. They
Explanation: The correct use of verb is: The teacher_has_ completed this chapter. Has is use because teacher is a singular person. So option D is the correct option.
Why the other options are wrong
- A. This option suggests using the verb "have" in the present tense. However, in the sentence, "The teacher" is the subject, and the verb needs to agree with it. "Have" is not the correct form for the singular subject "teacher" in this sentence.
- B. This option suggests using the verb "is" in the present tense. It agrees with the singular subject "teacher" and correctly indicates that the action of completing the chapter is happening in the present.
- C. This option suggests using the verb "are" in the present tense. However, "are" is the plural form of the verb, and it does not agree with the singular subject "teacher." Therefore, this option is not suitable in this context.
- E. This option suggests using the pronoun "they" instead of a verb. While "they" is a subject pronoun, it does not serve as a verb to complete the sentence.
Q10. Lipids store double amount of energy as compared to carbohydrates because of:
- A. High proportion of oxygen
- B. Low proportion of carbon
- C. Lower proportion of C-H bonds
- D. High proportion of C-H bonds✓
Explanation: Option D is correct. Lipids store more energy than carbohydrates primarily because they have a higher proportion of carbon-hydrogen (C-H) bonds. These bonds are strong and release a large amount of energy when broken, which accounts for the higher energy content of lipids. In contrast, carbohydrates have more oxygen-hydrogen bonds, which release less energy. Option A is incorrect because lipids have a lower proportion of oxygen, not higher. Option B is incorrect because lipids have a high proportion of carbon. Option C is incorrect as lipids have more C-H bonds, not fewer.
Why the other options are wrong
- A. Lipids do not have a high proportion of oxygen compared to carbohydrates. In fact, they have a lower proportion of oxygen, which is not the reason they store more energy. The high energy content of lipids is due to the abundance of carbon-hydrogen bonds.
- B. This is incorrect. Lipids actually have a high proportion of carbon, which contributes to their energy density. The energy content of lipids is due to the high number of carbon-hydrogen bonds, not a low proportion of carbon.
- C. This is incorrect. Lipids have a higher proportion of carbon-hydrogen (C-H) bonds compared to carbohydrates, which is why they store more energy. The abundance of C-H bonds in lipids allows them to release more energy upon breakdown.
Q11. Bones of the skull are joined by:
- A. Fibrous joints✓
- B. Sliding joints
- C. Pivot joints
- D. Hinge joints
- E. Gliding joints
Explanation: Fibrous joints are characterized by being immovable and are primarily found in the skull, where they are known as sutures. These joints provide stability and protection for the brain by holding the skull bones firmly together. Other joint types, such as sliding, pivot, hinge, and gliding joints, allow varying degrees of movement and are not suitable for the protective function required by the skull.
Why the other options are wrong
- B. Sliding joints, also known as plane joints, allow bones to glide over each other and provide flexibility. They are not typically found in the skull but in areas like the wrist and ankle.
- C. Pivot joints allow for rotational movement around a single axis and are found in the neck and forearm. The skull does not contain pivot joints.
- D. Hinge joints allow for movement in one plane, similar to the motion of a door. These are found in areas like the elbow and knee, but not in the skull.
- E. Gliding joints involve bones sliding over one another. These are found in the hands and feet, not in the skull.
Q12. Lysosomes function in:
- A. Protein synthesis
- B. Processing of cellular materials
- C. Intracellular digestion✓
- D. Lipid synthesis
- E. Carbohydrate synthesis
Explanation: Lysosomes are specialized organelles within the cell that contain hydrolytic enzymes capable of breaking down macromolecules like proteins, nucleic acids, lipids, and carbohydrates. Their primary function is intracellular digestion, where they degrade and recycle cellular waste, damaged organelles, and material ingested by the cell. Unlike ribosomes, lysosomes do not synthesize proteins, and they are not involved in lipid or carbohydrate synthesis, which occur in other organelles. Options such as 'protein synthesis', 'lipid synthesis', and 'carbohydrate synthesis' refer to processes that take place outside of lysosomes, highlighting their specialized role in cellular maintenance through digestion.
Why the other options are wrong
- A. Protein synthesis occurs in the ribosomes, not in lysosomes. Ribosomes translate genetic information into proteins, a process separate from the digestive function of lysosomes.
- B. While lysosomes process materials by breaking them down, their primary function is to degrade and recycle cellular waste, rather than processing it in a constructive manner.
- D. Lipid synthesis occurs in the endoplasmic reticulum and Golgi apparatus, not in lysosomes which are dedicated to digestion and recycling.
- E. Carbohydrate synthesis is carried out by specific enzymes in the cytoplasm, while lysosomes focus on breaking down and recycling cellular waste.
Q13. Which of the following factors affect enzyme activity?
- A. Temperature
- B. pH
- C. Concentration of substrate
- D. Radiation
- E. All of these✓
Explanation: All of these factors can influence enzyme activity:Temperature: Enzymes generally work faster with rising temperatures until they reach an optimum point. Beyond this, high temperatures can cause denaturation.pH: Each enzyme has an optimal pH range. Deviations from this range can alter the enzyme's shape and reduce its efficiency.Concentration of substrate: Increasing substrate concentration can boost reaction rates up to a point of saturation.Radiation: While not typically considered an immediate factor, radiation can cause oxidative damage to enzymes, impeding their function.Thus, all these factors are relevant, making Option E the correct choice. Options A, B, C, and D describe individual factors, but only 'All of these' encompasses the full scope of influences on enzyme activity.
Why the other options are wrong
- A. Temperature affects enzyme activity as higher temperatures generally increase reaction rates, but extreme heat may denature enzymes, reducing their activity.
- B. pH levels can alter an enzyme's shape and functionality. Each enzyme has an optimal pH range where it performs best.
- C. Enzyme activity can increase with substrate concentration, but only until the enzymes become saturated and the reaction rate plateaus.
- D. Radiation can damage enzymes through oxidative stress, affecting their ability to function properly, especially at higher doses.
Q14. Some enzymes require the presence of a non protein molecule to behave catalytically. An enzyme devoid of this molecule is called a(n):
- A. Holoenzyme
- B. Apoenzyme✓
- C. Coenzyme
- D. Zymoenzyme
Explanation: Enzyme with a non-proteinous part is called Holoenzyme; without that non-proteinous part, it is called Apoenzyme.
Why the other options are wrong
- A. Holoenzyme is an enzyme with an cofactor and prosthetic group attached this is fully active enzyme.
- C. Coenzyme is an non-protein part of an enzyme which is lovely bonded to an enzyme and may and may not be required for proper functioning of an enzyme.
- D. This is not correct as there not a thing as such as zymoenzyme.
Q15. The gland known as the" gland of emergency" is the
- A. Pituitary
- B. Adrenal gland✓
- C. Thyroid
- D. Parathyroid
- E. Pancreas
Explanation: The adrenal glands are often referred to as the "glands of emergency" because they play a crucial role in the body's stress response. These glands produce hormones such as adrenaline and cortisol, which prepare the body to respond to stressful situations by increasing heart rate, raising blood pressure, and mobilizing energy resources.
Why the other options are wrong
- A. While the pituitary gland controls many important bodily functions by producing a variety of hormones, it is not typically referred to as the gland of emergency.
- C. The thyroid gland plays a significant role in regulating metabolism, but it is not commonly known as the gland of emergency.
- D. The parathyroid glands regulate calcium levels in the body but are not called the gland of emergency.
- E. The pancreas produces insulin and other hormones involved in blood sugar regulation and digestion, but it is not known as the gland of emergency.
Q16. All of the following are sexually transmitted diseases except:
- A. Syphilis
- B. Gonorrhea
- C. Alzheimer's disease✓
- D. Genital herpes
- E. AIDS
Explanation: Alzheimer's disease is not a sexually transmitted disease. It is a progressive neurodegenerative disorder unrelated to sexual activity, primarily influenced by genetic and age-related factors. In contrast, syphilis, gonorrhea, genital herpes, and HIV/AIDS are all conditions that are transmitted through sexual contact. Identifying Alzheimer's disease as the exception is key to answering this question correctly.
Why the other options are wrong
- A. Syphilis is a sexually transmitted infection (STI) caused by the bacterium Treponema pallidum. It spreads through sexual contact and can lead to serious health issues if left untreated.
- B. Gonorrhea is a common STI caused by the bacterium Neisseria gonorrhoeae. It is typically transmitted through sexual activities such as vaginal, anal, or oral sex.
- D. Genital herpes is a viral infection caused by the herpes simplex virus (HSV), usually HSV type 2. It is a sexually transmitted infection that can be spread through intimate contact.
- E. AIDS (Acquired Immunodeficiency Syndrome) results from infection with HIV, which is primarily transmitted through unprotected sexual contact, sharing needles, or from mother to child. While AIDS itself is not an STI, it is the result of an STI (HIV).
Q17. Water acts as universal solvent because of:
- A. Heat of vaporization
- B. High polarity✓
- C. Hydrogen bonding
- D. Cohesion and Adhesion
Explanation: Heat of vaporization: The heat of vaporization is the amount of heat energy required to convert a liquid into a gas at a constant temperature and pressure. While water does have a relatively high heat of vaporization, it is not the primary reason why water acts as a universal solvent. High polarity: The correct option is high polarity. Water is a polar molecule, meaning it has a partial positive charge on one end (the hydrogen atoms) and a partial negative charge on the other end (the oxygen atom). This polarity arises due to the unequal sharing of electrons in the water molecule. The oxygen atom is more electronegative than the hydrogen atoms, pulling the electrons closer to itself and creating a dipole moment.Because of its polarity, water molecules are attracted to other polar or charged molecules, including ions and other polar substances. When a solute (substance to be dissolved) is added to water, the water molecules surround and solvate the solute, effectively breaking its interactions and allowing it to disperse evenly throughout the water. This ability to dissolve a wide variety of polar and charged substances is the reason why water is often referred to as the "universal solvent." Hydrogen bonding: Hydrogen bonding is a specific type of intermolecular bonding that occurs between hydrogen atoms bonded to electronegative atoms (such as oxygen, nitrogen, or fluorine) and lone pairs on nearby electronegative atoms. Water molecules form hydrogen bonds with each other due to the polarity of the water molecule. While hydrogen bonding does contribute to water's unique properties, including its high heat of vaporization and high surface tension, it is not the primary reason why water acts as a universal solvent. Cohesion and adhesion: Cohesion refers to the attraction between water molecules, causing them to stick together, while adhesion refers to the attraction between water molecules and other substances. These properties are responsible for phenomena like surface tension and capillary action. While cohesion and adhesion play essential roles in various biological processes, they are not the primary reasons why water acts as a universal solvent.In conclusion, option b) High polarity is the correct option. Water's high polarity allows it to act as a universal solvent, enabling it to dissolve a wide range of polar and charged substances, making it an essential medium for various biological and chemical processes.
Why the other options are wrong
- A. The heat of vaporization is the amount of heat energy required to convert a liquid into a gas at a constant temperature and pressure. While water does have a relatively high heat of vaporization, it is not the primary reason why water acts as a universal solvent.
- C. Hydrogen bonding is a specific type of intermolecular bonding that occurs between hydrogen atoms bonded to electronegative atoms (such as oxygen, nitrogen, or fluorine) and lone pairs of nearby electronegative atoms. Water molecules form hydrogen bonds with each other due to the polarity of the water molecule. While hydrogen bonding does contribute to water's unique properties, including its high heat of vaporization and high surface tension, it is not the primary reason why water acts as a universal solvent.
- D. Cohesion refers to the attraction between water molecules, causing them to stick together, while adhesion refers to the attraction between water molecules and other substances. These properties are responsible for phenomena like surface tension and capillary action. While cohesion and adhesion play essential roles in various biological processes, they are not the primary reasons why water acts as a universal solvent.
Q18. The complete, mature, and infectious virus particle is known as:
- A. Capsomere
- B. Genome
- C. Virion✓
- D. Capsid
Explanation: The correct answer is c. Virion. A virion is the complete, mature, and infectious virus particle, consisting of the viral genome (DNA or RNA) enclosed within a protective protein coat called the capsid. Unlike the genome or capsid alone, which are only parts of a virus, the virion represents the fully assembled unit capable of infecting host cells.
Why the other options are wrong
- A. A capsomere is only one protein unit of the capsid, while a virion is the whole infectious virus particle. So calling the entire virus a capsomere would be incorrect.
- B. The genome of a virus refers to its genetic material, either DNA or RNA. It carries the instructions for the virus to replicate and produce new virus particles. While the genome is a crucial part of a virus, it does not represent the complete, mature, and infectious virus particle.
- D. The capsid is the protein coat that surrounds the genetic material of a virus. While important for protecting the genome, the capsid alone does not constitute the entire infectious virus particle.
Q19. Which one of the following characteristics is common both in humans and adult frogs?
- A. Four chambered heart
- B. Internal fertilization
- C. Nucleated RBCs
- D. Ureotelic mode of excretion✓
Explanation: Excretion of urea is known as ureotelism and the animals which excrete urea are called ureotelic. Ureotelic animals include Ascaris, earthworm (both are ammonotelic and ureotelic), cartilaginous fishes like sharks and sting rays, semiaquatic amphibians such as frogs and toads, aquatic or semiaquatic reptiles like turtles, terrapins and alligators, and man and all other mammals. Urea is less toxic and less soluble in water than ammonia. Hence, it can stay for some time in the body. Amphibian tadpole (e.g., tadpole of frog) excrete ammonia but after metamorphosis frog excretes urea.
Why the other options are wrong
- A. Frogs do not have a four chambered heart; humans have a four chambered heart.
- B. Internal fertilization is absent in frogs, whereas it is present in human beings.
- C. RBCs of humans are anucleated while RBCs of frogs are nucleated.
Q20. Five steps of the lytic cycle of a T4 stage are given below: The T4 phage uses its tails to stick to specific receptor The cell’s metabolic machinery, directed by phage DNA, produces phage proteins and nucleotides from the cell's degraded DNA. The phage then directs the production of an enzyme that digests the cell. The empty capsid of the phage is left as a ghost outside the cell The sheath of the tail contracts, thrusting a hollow core through the wall and membrane of the cell.Which of the following is the correct sequence of the cycle?
- A. 3-5-4-2-1
- B. 2-4-5-1-3
- C. 5-1-4-2-3
- D. 1-5-4-2-3✓
- E. 4-5-1-3-2
Explanation: The correct sequence of the lytic cycle for a T4 phage is attachment, penetration, uncoating, biosynthesis, and maturation. Option D, 1-5-4-2-3, accurately represents this order:Attachment (1): The T4 phage uses its tails to stick to specific receptors on the host cell.Penetration (5): The sheath of the tail contracts, thrusting a hollow core through the wall and membrane of the cell.Uncoating (4): The empty capsid of the phage is left as a ghost outside the cell.Biosynthesis (2): The cell's metabolic machinery, directed by phage DNA, produces phage proteins and nucleotides from the cell's degraded DNA.Maturation (3): The phage then directs the production of an enzyme that digests the cell.The other options do not follow this logical sequence and therefore represent incorrect orders of the lytic cycle stages.
Why the other options are wrong
- A. This order starts with the cell's digestion, which is not the initial stage of the lytic cycle. It does not follow the correct sequence of the cycle stages.
- B. This sequence incorrectly begins with biosynthesis, which occurs later in the cycle. It doesn’t correspond to the proper lytic cycle order.
- C. This sequence incorrectly begins with penetration, which should follow attachment. The stages are out of order.
- E. This sequence starts with uncoating, which is not the initial stage of the lytic cycle. The steps are not in the correct order.
Q21. Testes are structures that produce:
- A. Spores
- B. Sperms✓
- C. Seeds
- D. Ova
Explanation: The testes (or testicles) are critical to the male reproductive system, primarily producing sperm and the hormone testosterone. This makes them essential for both reproduction and secondary sexual characteristics in males. Spores are not relevant to animal reproduction and are associated with fungi and plants. Seeds are a plant reproductive structure, resulting from the fertilization of ovules, while ova are female reproductive cells produced by the ovaries, not the testes.
Why the other options are wrong
- A. Spores are reproductive units in organisms like fungi, bacteria, and some plants, but not in animals.
- C. Seeds are produced by plants through the process of fertilization involving pollen and ovules, not by animals.
- D. Ova are female gametes produced by the ovaries, which are the female counterparts to the testes.
Q22. Which of the following is NOT a difference that would allow one to distinguish between a prokaryotic and a eukaryotic cell? Presence or absence of the nucleus Presence or absence of the cell wall Membrane bound versus no membrane bound organelles
- A. I only
- B. II only✓
- C. III only
- D. I and II only
- E. I, II and III
Explanation: Eukaryotic cells have nucleus and membrane-bound organelles, which is not the property of prokaryotes.The cell wall is not a distinguishing feature between prokaryotes or eukaryotes.
Why the other options are wrong
- A. Eukaryotic cells have nucleus while prokaryotic cells do not have nucleus.
- C. Eukaryotic cells have membrane bounded organelles while prokaryotic cells do not have membrane bounded organelles except vacoule.
- D. Presence or absence of nucleus is distinct feature to differentiate between eukaryotic and prokaryotic cell.
- E. Cell wall is not a distinct feature to distinguish between eukaryotic and prokaryotic cells.
Q23. Read the passage below to answer the question:Haemophilia is a disorder in which blood fails to clot. Saad, a male haemophiliac, marries Sara, a normal woman and together they have four children, two boys (Ahmed and Ali) and two girls (Alia and Ayesha). None of the children display the symptoms of Haemophilia. Ahmed, Ali, Ayesha, and Ali all marry normal individuals and have children. None of Ahmed's or Ali’s children, male or female, display symptoms of haemophilia, but the sons of Alia and Ayesha display symptoms of haemophilia while the daughters of Alia and Ayesha do not.Which of the following best explains the reason that Ahmed, Ali, Ayesha and Alia do not display symptoms of haemophilia, even though their father, Saad, is a haemophiliac.
- A. Haemophilia is an X-linked disorder, and Saad can only pass on his Y chromosome
- B. Haemophilia is an X-linked disorder, and even though Alia and Ayesha receive a hemophiliac X-chromosome from Saad, Sara gave them a normal X-chromosome.✓
- C. Haemophilia is a Y -linked disorder, and therefore cannot be displayed in females
- D. Haemophilia is a Y-linked disorder ,and Ahmed and Ali must have received an X Chromosome from Saad
- E. Haemophilia is an X-linked disorder, and even though Ahmed and All received a Hemophilia X-chromosome from Saad, Sara gave them a normal X- chromosome.
Explanation: Haemophilia is an X-linked recessive disorder. Males (XY) only need one affected X chromosome to express the disorder, but females (XX) need two affected X chromosomes. Since Sara is normal, she provides a normal X chromosome to Alia and Ayesha, making them carriers but not affected.
Why the other options are wrong
- A. While it is true that Saad passes his Y chromosome to his sons (Ahmed and Ali), this does not explain why Alia and Ayesha do not show symptoms.
- C. Haemophilia is not Y-linked; it is X-linked. Y-linked disorders are only passed from father to son, but here, the daughters are carriers, proving it is X-linked.
- D. Haemophilia is not Y-linked. Also, males inherit their X chromosome from their mother, not their father.
- E. Males (XY) inherit their X chromosome from their mother, not their father. Ahmed and Ali received their Y chromosome from Saad and a normal X from Sara, so this explanation is incorrect.
Q24. The Law of Dominance Is illustrated in the garden pea by:
- A. Homozygous tall x heterozygous tall
- B. Heterozygous tall x heterozygous tall
- C. Homozygous tall x homozygous tall
- D. Pure short x pure short
- E. Homozygous tall x pure short✓
Explanation: The Law of Dominance states that in a heterozygous individual, the dominant allele will determine the phenotype while the recessive allele is masked. In this case, the cross between a homozygous tall plant (TT) and a pure short plant (tt) clearly illustrates this law, as all offspring (Tt) will be tall, demonstrating that the dominant allele 'T' expresses itself over the recessive 't'.The other options do not adequately illustrate the Law of Dominance: the first option shows both parents expressing the tall phenotype, while the second option leads to a mix of phenotypes. The third option results in only tall offspring, but both parents are homozygous dominant, failing to demonstrate dominance. The fourth option produces only short offspring, which lacks any dominant allele.
Why the other options are wrong
- A. This cross (TT x Tt) will produce offspring that are all tall, but it does not clearly illustrate the dominance of one allele over another since both parents exhibit the tall phenotype.
- B. This cross (Tt x Tt) will produce a mix of tall and short offspring (TT, Tt, and tt), demonstrating the segregation of alleles but not the direct influence of the dominant allele in a clear way.
- C. This cross (TT x TT) will produce only tall offspring, but it does not showcase the concept of dominance since both parents are homozygous dominant.
- D. This cross (tt x tt) will produce only short offspring, which does not illustrate dominance because there are no dominant alleles present to express.
Q25. A man with blood group A marries a woman with blood group B. Which Blood group is their child most likely to have?
- A. A and B
- B. B and AB
- C. A and AB
- D. A, B, AB or O✓
Explanation: Blood group inheritance is determined by allele combinations from the parents. A person with blood group 'A' can have genotype IAIA or IAi. A person with blood group 'B' can have genotype IBIB or IBi. If both parents are heterozygous (IAi and IBi), their child could inherit a combination of these alleles, resulting in blood groups A, B, AB, or O. Options A, B, and C do not include all possible blood groups the child could inherit, making them incorrect.
Why the other options are wrong
- A. Option A is incorrect because it does not account for all possible combinations of alleles from the parents.
- B. Option B is incorrect as it overlooks the possibility of the child inheriting an O blood group.
- C. Option C is incorrect because it excludes the possibility of the child having a B or O blood group.
Q26. The muscles attached to the bones are
- A. Voluntary and smooth
- B. Involuntary and smooth
- C. Voluntary and striated✓
- D. Involuntary and striated
- E. Smooth and striated
Explanation: Voluntary muscles are under conscious control, allowing us to move our bodies intentionally. Striated muscles have a striped appearance under a microscope due to the organization of their contractile proteins, giving them the name "striated." These muscles are also known as skeletal muscles and are responsible for body movements.
Why the other options are wrong
- A. Muscles attached to bones are voluntary but not smooth.
- B. Muscles attached to bones are neither smooth nor involuntary.
- D. Muscles attached to bones are striated but not involuntary.
- E. Muscles attached to bones are striated but not smooth.
Q27. Which of the following causes an increase in sodium reabsorption in the distal convoluted tubule?
- A. Increase in Aldosterone levels✓
- B. Increase in Antidiuretic Hormone (ADH) levels
- C. Decrease in aldosterone levels
- D. Decrease in Antidiuretic Hormone (ADH) levels
Explanation: Aldosterone, a hormone produced by the adrenal cortex, plays a crucial role in regulating sodium and potassium balance in the body. It enhances sodium reabsorption in the distal convoluted tubule and collecting duct of the nephron by increasing the number of sodium channels and sodium-potassium pumps. This process helps retain sodium in the body, contributing to increased blood pressure and reduced urine volume. In contrast, antidiuretic hormone (ADH) primarily focuses on water reabsorption, and changes in its levels do not directly affect sodium reabsorption. Therefore, the correct answer is an increase in aldosterone levels, which specifically targets sodium reabsorption.
Why the other options are wrong
- B. Antidiuretic hormone (ADH) primarily affects water reabsorption in the kidneys, leading to more concentrated urine, but it does not directly influence sodium reabsorption.
- C. A decrease in aldosterone would result in less sodium being reabsorbed, increasing sodium excretion in the urine, which is the opposite effect of what is being asked in the question.
- D. A decrease in ADH would lead to increased urine volume and decreased water reabsorption, without directly affecting sodium reabsorption.
Q28. The external solution having more concentration than the cell sap is known:
- A. Hypertonic solution✓
- B. Hypotonic solution
- C. Isotonic solution
- D. None of these
Explanation: The correct answer is a hypertonic solution. In osmoregulation, when a cell is placed in a hypertonic solution, the external environment has a higher concentration of solutes compared to the inside of the cell. This concentration difference causes water to move out of the cell through osmosis, leading to a decrease in cell volume and potential plasmolysis. Conversely, a hypotonic solution would cause water to move into the cell, and an isotonic solution would result in no net water movement. None of these is incorrect because the correct term for a solution with higher solute concentration than the cell sap is indeed a hypertonic solution.
Why the other options are wrong
- B. A hypotonic solution has a lower solute concentration than the cell sap, leading to water moving into the cell, causing it to swell and possibly burst.
- C. An isotonic solution has an equal solute concentration compared to the cell sap, resulting in no net water movement across the cell membrane, maintaining cell size.
- D. This option is incorrect as it does not describe a solution with a higher solute concentration than the cell sap, which is known as a hypertonic solution.
Q29. Nutritional deficiency ( vitamin D ) results in softening of the bones. This disease is called?
- A. Rickets✓
- B. Cleft palates
- C. Microcephaly
- D. Down syndrome
Explanation: Rickets is a condition that primarily affects children and is caused by a deficiency in vitamin D. Vitamin D is essential for calcium and phosphate absorption in the body, which are critical for healthy bone formation. Without adequate vitamin D, bones become soft and weak, leading to symptoms such as bowed legs and stunted growth. The other options are distinct medical conditions that do not involve vitamin D deficiency or bone softening. Cleft palate is a structural birth defect, microcephaly is a condition affecting brain size, and Down syndrome is a genetic disorder.
Why the other options are wrong
- B. Cleft palate is a congenital condition characterized by splits or openings in the roof of the mouth. It is not related to nutritional deficiencies or bone softening.
- C. Microcephaly is a neurological condition where a child's head is significantly smaller than normal due to abnormal brain development. It is unrelated to vitamin deficiencies or bone health.
- D. Down syndrome is a genetic disorder caused by the presence of an extra chromosome 21. It affects intellectual and physical development but is not linked to nutritional deficiencies in vitamins.
Q30. Red-green colour blindness is a sex-linked recessive trait. If a colour-blind man marries a woman with normal vision whose father is colourblind and they have a daughter, what is the probability that she will be colourblind?
- A. 0
- B. 0.25
- C. 0.50✓
- D. 0.75
Explanation: To solve this, consider the genetics involved: The man is color-blind (XcY), and the woman, who has normal vision but a color-blind father, is a carrier (X+Xc). When they have a daughter, the possible combinations of X chromosomes are: X+Xc (carrier, normal vision) and XcXc (color-blind). Thus, there is a 50% chance that their daughter will be color-blind. Options A and D are incorrect as they underestimate and overestimate the probability, respectively. Option B is incorrect because it fails to account for both sources of the recessive allele.
Why the other options are wrong
- A. This option is incorrect because there is a possibility of the daughter inheriting the recessive allele from both parents.
- B. This option is incorrect as it does not account for the probability of inheritance from both parents.
- D. This option is incorrect as it overestimates the probability of the daughter being color-blind.
Q31. The end product of Glycolysis is:
- A. Glucose-6-phosphate
- B. Fructose-6-phosphate
- C. Pyruvate✓
- D. 3-Phosphoglycerate
- E. Phosphoglyceraldehyde
Explanation: The end product of glycolysis is pyruvate. During glycolysis, one molecule of glucose is broken down into two molecules of pyruvate, yielding a net gain of two molecules of ATP and two molecules of NADH. Pyruvate can then enter the mitochondria to be further processed in the citric acid cycle if oxygen is present, or it can undergo fermentation under anaerobic conditions. The incorrect options listed are intermediates in the glycolytic pathway, not final products.
Why the other options are wrong
- A. This is incorrect. Glucose-6-phosphate is an intermediate in glycolysis, but not the end product. The process of glycolysis results in the formation of pyruvate.
- B. This is incorrect. Fructose-6-phosphate is another intermediate in the glycolytic pathway. It is converted into fructose-1,6-bisphosphate during glycolysis.
- D. This is incorrect. 3-Phosphoglycerate is an intermediate formed during the conversion of 1,3-bisphosphoglycerate to 2-phosphoglycerate in glycolysis.
- E. This is incorrect. Phosphoglyceraldehyde, also known as glyceraldehyde-3-phosphate, is an intermediate in glycolysis, not the end product.
Q32. Male honey bees are?
- A. Diploid
- B. Haploid✓
- C. Triploid
- D. None of the above
Explanation: Male honey bees, known as drones, are haploid because they develop from unfertilized eggs, meaning they inherit only one set of chromosomes. This is in contrast to female honey bees, which are diploid, receiving a set of chromosomes from each parent. Therefore, only option B correctly describes male honey bees. Options A, C, and D are incorrect as they do not accurately represent the genetic composition of male honey bees.
Why the other options are wrong
- A. Option A is incorrect. Diploid organisms have two sets of chromosomes, which is characteristic of female honey bees, not males.
- C. Option C is incorrect. Triploid organisms have three sets of chromosomes, which is not typical in honey bees.
- D. Option D is incorrect. One of the listed options correctly describes the genetic makeup of male honey bees.
Q33. The inhibitor which closely resembles the substrate in its molecular structure and inhibits the enzyme activity by binding to the active site of the enzyme is called
- A. Feedback inhibitor
- B. Non-competitive inhibitor
- C. Allosteric modulator
- D. Competitive inhibitor✓
Explanation: In competitive inhibition, the inhibitor (I) closely resembles the real substrate (S) and is regarded as a substrate analog. The inhibitor competes with the substrate and binds at the active site of the enzyme but does not undergo any catalysis. As long as the competitive inhibitor holds the active site, the enzyme is not available for the substrate to bind. A competitive inhibitor diminishes the rate of catalysis by reducing the proportion of enzyme molecules bound to a substrate. At any given inhibitor concentration, competitive inhibition can be relieved by increasing the substrate concentration. So, the correct answer is 'Competitive inhibitor'.
Why the other options are wrong
- A. Competitive inhibition occurs when molecules very similar to the substrate molecules bind to the active site and prevent binding of the actual substrate. Penicillin, for example, is a competitive inhibitor that blocks the active site of an enzyme that many bacteria use to construct their cell walls.
- B. Competitive inhibition occurs when molecules very similar to the substrate molecules bind to the active site and prevent binding of the actual substrate. Penicillin, for example, is a competitive inhibitor that blocks the active site of an enzyme that many bacteria use to construct their cell walls.
- C. Competitive inhibition occurs when molecules very similar to the substrate molecules bind to the active site and prevent binding of the actual substrate. Penicillin, for example, is a competitive inhibitor that blocks the active site of an enzyme that many bacteria use to construct their cell walls.
Q34. Which body function is controlled through a positive feedback mechanism?
- A. Labor contractions✓
- B. Body temperature
- C. Insulin production
- D. Thyroxine release
Explanation: A feedback mechanism is a loop system wherein the system responds to a perturbation. The response may be in the same direction (as in positive feedback) or in the opposite direction (as in negative feedback). An example of positive feedback is uterine contractions during childbirth. The hormone oxytocin, made by the endocrine system, stimulates the contraction of the uterus. This produces the pain sensed by the nervous system. In response, more oxytocin is released, which in turn stimulates the contractions even more. This loop of the 'pain induced from contractions stimulating the release of oxytocin, and oxytocin stimulating more contraction continues with increasing intensity' still the fetus is born. This is a positive feedback loop; hence, Option A is correct.
Why the other options are wrong
- B. Thermoregulation (if body temperature changes, mechanisms are induced to restore normal levels). It is a negative feedback mechanism.
- C. Blood sugar regulation (insulin lowers blood glucose when levels are high; glucagon raises blood glucose when levels are low). It is a negative feedback mechanism.
- D. Thyroxine Regulation. The two scenarios involved with thyroxine regulation are stated below. Low thyroxine levels in the bloodstream stimulate the hypothalamus to release TRH (Thyrotropin-releasing hormone), and this causes the pituitary to release TSH (Thyroid-stimulating hormone) so the thyroid releases more thyroxine, and the blood levels return to normal. 2) Normal thyroxine levels in the bloodstream inhibit TRH release from the hypothalamus, and this inhibits the release of TSH from the pituitary, so less thyroxine is released from the thyroid gland and normal blood levels are maintained. It is a negative feedback mechanism.
Q35. Which one of the following is common to all neurons?
- A. A cell body which contains a nucleus✓
- B. Presence of Nodes of Ranvier
- C. A thick myelin sheath
- D. Presence of Schwann cells
Explanation: The cell body (soma) is the main nutritional and metabolic center of all neurons, containing the nucleus and responsible for biosynthesis of proteins and energy for neuronal function.
Why the other options are wrong
- B. Nodes of Ranvier are gaps in the myelin sheath that are found in myelinated neurons, allowing for faster signal transmission. However, not all neurons are myelinated, and thus, some do not have these nodes, making this option incorrect.
- C. Myelin sheaths insulate axons and enhance the speed of impulse conduction. However, the thickness of the myelin sheath varies among neurons, and some are unmyelinated. Therefore, this characteristic is not universal among all neurons.
- D. Schwann cells are responsible for the formation of the myelin sheath around peripheral nerves. While they play a critical role in myelination, not all neurons are associated with Schwann cells, particularly those in the central nervous system, making this option incorrect.
Q36. The diagram shows some of the muscles and bones of the human arm.
- A. The tricep contracts to bend the elbow and the bicep relaxes.
- B. The bicep contracts to straighten the elbow and the tricep relaxes.
- C. The tricep contracts to straighten the elbow and the bicep relaxes.✓
- D. The bicep contracts to bend the elbow and the tricep relaxes.
- E. Both A and C are correct.
Explanation: The correct answer is that the tricep contracts to straighten the elbow and the bicep relaxes. In the human arm, the tricep and bicep are antagonistic muscles, meaning they work in opposition to each other to create movement. When the tricep contracts, it exerts force on the bones of the arm, causing the elbow to extend or straighten. During this action, the bicep must relax to allow the movement to occur smoothly. Option A is incorrect because the tricep does not bend the elbow; the bicep is responsible for bending the elbow by contracting. Option B is incorrect because the bicep does not straighten the elbow; that is the function of the tricep. Option D describes the action of bending the elbow, which is not the focus of the question about straightening the elbow. Option E is incorrect because it includes Option A, which is not correct.
Why the other options are wrong
- A. This is incorrect. The tricep is responsible for extending the arm at the elbow joint, not bending it.
- B. This is incorrect. The bicep is responsible for flexing the arm at the elbow joint, not straightening it.
- D. This is partially correct but not the focus of the question. It describes the action of bending the elbow, not straightening it.
- E. This is incorrect because Option A is not correct. The tricep does not bend the elbow.
Q37. Which of the following is NOT true for a gene?
- A. A gene is a sequence of nucleotides in DNA.
- B. A gene is the basic unit of heredity.
- C. A gene codes for a molecule that has a function.
- D. A gene expresses to form chromosomes.✓
Explanation: The correct answer is D. Genes are segments of DNA that do not express themselves to form chromosomes. Instead, chromosomes are structures that contain many genes. Options A, B, and C are accurate descriptions of what genes are and what they do: they are sequences of nucleotides, the basic units of heredity, and they code for molecules with specific functions.
Why the other options are wrong
- A. This statement is true. A gene is indeed a sequence of nucleotides in DNA, which carries genetic information.
- B. This is a correct statement. Genes are the fundamental units of heredity, responsible for passing on traits from parents to offspring.
- C. This statement is true. Genes often code for proteins or other molecules that perform essential functions in the body.
Q38. The phase in which bicuspid and tricuspid valves open & semilunar valve close which produce 2nd heart sound (dub or dup). This the phase is known as:
- A. Atrial diastole
- B. Ventricular diastole✓
- C. Ventricular systole
- D. Contraction of heart
- E. Systole
Explanation: The phase in which the bicuspid and tricuspid valves open & semilunar valve close produces 2nd heart sound (dub or dup). This phase is known as ventricular diastole. So option B is the correct answer.
Why the other options are wrong
- A. Atrial diastole refers to the phase of the cardiac cycle when the atria are relaxed and filling with blood. It is not directly related to the opening of the bicuspid and tricuspid valves or the closure of the semilunar valve, which is responsible for producing the second heart sound. Therefore, Option A is not the correct answer.
- C. Ventricular systole refers to the phase of the cardiac cycle when the ventricles contract and pump blood out of the heart. During ventricular systole, the bicuspid and tricuspid valves are closed to prevent the backflow of blood into the atria, and the semilunar valves are open, allowing blood to be ejected from the ventricles into the aorta and pulmonary arteries. While ventricular systole is an important phase of the cardiac cycle, it is not the phase responsible for producing the second heart sound. Therefore, Option C is not the correct answer.
- D. "Contraction of heart" is a general term that refers to the overall action of the heart muscles contracting. While the contraction of the heart is involved in both atrial and ventricular systole, it does not specifically describe the phase where the bicuspid and tricuspid valves open and the semilunar valve closes to produce the second heart sound. Therefore, Option D is not the correct answer.
- E. Systole is a general term that refers to the phase of the cardiac cycle when the heart muscle contracts and blood is pumped out. It can be used to describe both atrial and ventricular systole. However, in the context of the given question, Option E does not specifically indicate the phase where the bicuspid and tricuspid valves open and the semilunar valve closes to produce the second heart sound. Therefore, Option E is not the correct answer.
Q39. In which type of cells, cell wall is not present?
- A. Plant cells
- B. Fungal cells
- C. Bacterial cells
- D. Liver cells✓
Explanation: A cell wall is a structural layer surrounding some types of cells, just outside the cell membrane. It can be tough, flexible, and sometimes rigid. It provides the cell with both structural support and protection, and also acts as a filtering mechanism. No cells in the human body have a cell wall, hence liver cells will not have one either. Plant cell walls are primarily made of cellulose, which is the most abundant macromolecule on Earth. The cell wall is a characteristic structure of fungi and is composed mainly of glucans, chitin, and glycoproteins. The bacterial cell wall consists of peptidoglycan, an essential protective barrier for bacterial cells that encapsulates the cytoplasmic membrane.
Why the other options are wrong
- A. Plant cells have a cell wall made of cellulose, which provides rigidity and support.
- B. Fungal cells have a cell wall made of chitin, which gives structure and protection.
- C. Bacterial cells have a cell wall made of peptidoglycan (in most bacteria), providing strength and shape.
Q40. A child with AB blood group who was born to a mother of the genotype IAIA cannot have the father of the genotype:
- A. IA IA✓
- B. IB IB
- C. IB IO
- D. IB IB and IB IO
Explanation: A is the correct option because the genotype of the mother is IA IA. A child with blood group AB will have a genotype IA IB. This genotype of the child is possible in 2 cases either if the genotype of the father is IB IB or IB IO. However a genotype IA IA of the father will not result in the AB blood group of the child. Thus the correct answer is option A.
Why the other options are wrong
- B. If the father is IB IB, he can only pass on IB alleles.The child would get IA from the mother (IA IA) and IB from the father (IB IB).This produces IA IB, which gives the AB blood group
- C. If the father is IB IO, he can contribute either IB or IO.If he passes IB, and the mother passes IA, the child’s genotype becomes IA IB, which corresponds to AB blood group.Hence, this combination is also possible.
- D. Both IB IB and IB IO fathers can contribute a B allele, leading to IA IB in the child (AB blood group).Therefore, both these genotypes are possible for the father.
Q41. Whenever a muscle contracts, a sarcomere can be shortened up to _ % of its total length.
- A. 15
- B. 25
- C. 35✓
- D. 45
Explanation: The correct answer is 35%. During a maximal muscle contraction, the sarcomere shortens by about 35% of its original length. This is because the actin and myosin filaments slide past each other, reducing the length of the sarcomere. Options 15% and 25% underestimate the typical shortening that occurs, while 45% overestimates it, making 35% the most accurate representation of sarcomere shortening during contraction.
Why the other options are wrong
- A. This option is incorrect. A sarcomere can actually shorten more than 15% during muscle contraction.
- B. This option is incorrect. While it is closer to the actual value, a sarcomere can shorten more than 25% during contraction.
- D. This option is incorrect. A sarcomere does not shorten as much as 45% during muscle contraction.
Q42. How many meninges cover the human brain?
- A. 5
- B. 4
- C. 3✓
- D. 2
- E. 1
Explanation: There are three layers of meninges around the brain and spinal cord. The outer layer, the dura mater, is tough, white fibrous connective tissue. The middle layer of meninges is the arachnoid, a thin layer resembling a cobweb with numerous threadlike strands attaching it to the innermost layer.
Why the other options are wrong
- A. This option is incorrect. The brain and spinal cord are covered by three membranes, collectively known as Meninges: the outer hard membrane (next to the cranium), the inner Pia mater (next to the brain and spinal cord), and the middle arachnoid mater.
- B. This option is incorrect. The brain and spinal cord are covered by three membranes.
- D. This option is incorrect.The brain and spinal cord are covered by three membranes, collectively known as Meninges: the outer hard membrane (next to the cranium), the inner Pia matter (next to the brain and spinal cord), and the middle arachnoid matter.
- E. This option is incorrect. The brain and spinal cord are covered by three membranes, collectively known as Meninges: the outer hard membrane (next to the cranium), the inner Pia mater (next to the brain and spinal cord), and the middle arachnoid mater.
Q43. Which of the following basic structural level of proteins is indicated by an association of two alpha and two beta chains in the hemoglobin molecule?
- A. Quaternary Structure✓
- B. Primary Structure
- C. Secondary Structure
- D. Tertiary Structure
Explanation: This is the correct answer. The quaternary structure of a protein refers to the arrangement of multiple polypeptide chains (subunits) within a protein complex.In the case of hemoglobin, it consists of four subunits: two alpha chains and two beta chains. These subunits interact to form the final, functional structure of the hemoglobin molecule.
Why the other options are wrong
- B. This is incorrect. Primary structure refers to the linear sequence of amino acids in a polypeptide chain.
- C. This is incorrect. Secondary structure refers to the local folding of the polypeptide chain into structures such as alpha helices and beta sheets.
- D. This is incorrect. Tertiary structure refers to the three-dimensional shape of a single polypeptide chain, including its folding and interactions between different amino acids.
Q44. The menstrual cycle can be divided into:
- A. Single cycle
- B. Two cycles✓
- C. Three cycles
- D. Four cycles
Explanation: The menstrual cycle is governed by hormonal changes. These changes can be altered by using hormonal birth control to prevent pregnancy. Each cycle can be divided into two phases based on events in the ovary (ovarian cycle) or in the uterus (uterine cycle).
Why the other options are wrong
- A. This option suggests that the menstrual cycle consists of only one cycle, which is not accurate. The menstrual cycle is a recurring process that occurs approximately every 28 days in females.
- C. There is no widely recognized division of the menstrual cycle into three distinct cycles. The typical division is into the ovarian and uterine cycles.
- D. There is no common division of the menstrual cycle into four distinct cycles. The two main phases, ovarian and uterine, cover the key events in the menstrual cycle.
Q45. Which plant process is responsible for water loss from leaves?
- A. Guttation
- B. Transpiration✓
- C. Photosynthesis
- D. Respiration
Explanation: Water vapor is lost from leaves through stomata, creating a transpiration pull.
Why the other options are wrong
- A. Guttation is the process where liquid water, containing dissolved minerals and sugars (xylem sap), is exuded from the tips or edges of plant leaves through special pores called hydathodes.
- C. .Photosynthesis is the process by which plants convert light energy into chemical energy using water and carbon dioxide, releasing oxygen as a byproduct. It does not involve the loss of water from the plant to the atmosphere.
- D. Plant respiration is the vital process where plants break down sugars (like glucose) using oxygen to release stored energy (ATP) for growth, repair, and life functions, producing carbon dioxide and water.
Q46. The average diameter of large viruses is approximately equal to
- A. 100 to 160 nm
- B. 100 to 200 nm
- C. 240 nm to 300 nm✓
- D. Always below than 100 nm
Explanation: a. 100 to 160 nm: This range represents a common size for the diameter of large viruses. Many viruses fall within this size range, but it is not the only range that describes the average diameter of large viruses. b. 100 to 200 nm: This range is also a reasonable estimate for the diameter of large viruses. Viruses can vary in size, and this range captures a broader spectrum. c. 240 nm to 300 nm: This is the correct answer. The average diameter of large viruses is indeed approximately in the range of 240 nm to 300 nm. This range encompasses many enveloped viruses, such as herpesviruses and poxviruses. d. Always below than 100 nm: This statement is not accurate. While many smaller viruses fall below 100 nm in diameter, large viruses can certainly have diameters exceeding this value. Correct Answer: c. 240 nm to 300 nm Explanation: The average diameter of large viruses falls within the range of 240 nm to 300 nm. Large viruses often include complex structures, such as those with complex capsids or envelopes, contributing to their size. Summary: The correct answer is c. 240 nm to 300 nm. This range represents the average diameter of large viruses. Understanding the size characteristics of viruses is essential for classification and comprehension of their structure and function.
Why the other options are wrong
- A. This range represents a common size for the diameter of large viruses. Many viruses fall within this size range, but it is not the only range that describes the average diameter of large viruses.
- B. This range is also a reasonable estimate for the diameter of large viruses. Viruses can vary in size, and this range captures a broader spectrum.
- D. This statement is not accurate. While many smaller viruses fall below 100 nm in diameter, large viruses can certainly have diameters exceeding this value.
Q47. Which diagram illustrates the distribution of sodium and potassium ions in a section of a non - myelinated axon which is at resting potential?
- A. Option A✓
- B. Option B
- C. Option C
- D. Option D
- E. Option E
Explanation: K- don't exist so options B and C are incorrect. During resting potential, the relative charge inside the membrane is negative. When the membrane is at rest, K+ ions accumulate inside the cell due to a net movement with the concentration gradient. The negative resting membrane potential is created and maintained by increasing the concentration of cations outside the cell (in the extracellular fluid) relative to inside the cell (in the cytoplasm). So outside the concentration of Na+ ions is greater. So options C, D and E are incorrect. Option A is correct as it shows there is a high concentration of K+ ions inside and a comparatively high concentration of Na+ ions outside.
Why the other options are wrong
- B. This one doesn't represent Resting Potential state.
- C. This one doesn't represent Resting Potential state.
- D. This one doesn't represent Resting Potential state.
- E. This one doesn't represent Resting Potential state.
Q48. _ are more common in human males than females.
- A. X-linked dominant traits
- B. X-linked recessive traits✓
- C. Y-linked dominant traits
- D. Autosomal linked recessive traits
Explanation: Because it is unlikely that females will have two altered copies of this gene, males are affected by X-linked recessive disorders much more frequently than females.
Why the other options are wrong
- A. X-linked dominant trait has equal chances of appearing in both males and females.
- C. Y-linked traits only appear in males because human females do not have the Y chromosome.
- D. Autosomal traits (recessive or dominant) are not influenced by sex.
Q49. Photophosphorylation takes place in the _ of the chloroplasts:
- A. Stroma
- B. Granum✓
- C. Inner membrane
- D. Outer membrane
Explanation: Photophosphorylation takes place in the thylakoid membrane of the chloroplasts. This process, part of the light-dependent reactions of photosynthesis, uses light energy to create a proton gradient across the thylakoid membrane, which then drives the synthesis of ATP from ADP and inorganic phosphate.
Why the other options are wrong
- A. This is not correct. Photophosphorylation takes place in the thylakoid membrane of the chloroplasts. The thylakoid membrane is a membrane system within the chloroplast that contains chlorophyll and other pigments involved in capturing light energy during the light-dependent reactions of photosynthesis. Calvin cycle takes place in stroma.
- C. The inner membrane of a chloroplast is a selective barrier that controls the movement of molecules between the stroma and the cytosol. Not involved in photophosphorylation.
- D. Is responsible for movement of particles across it, not related to photophosphorylation.
Q50. The family tree shows the inheritance of the ability to taste a certain substance. The allele for the ability to taste this substance is dominant to the allele for the inability to taste it. What percentage of children of Pasha and Hina would be ‘non-tasters’?
- A. 25%✓
- B. 50%
- C. 75%
- D. 100%
Explanation: The ability to taste the substance is dominant (T) and the inability to taste is recessive (t). If Pasha and Hina are both heterozygous (Tt), their children can have the following genotypes: TT → tasterTt → taster tT → taster (same as Tt)tt → non-tasterThe genotype ratio is 1 TT : 2 Tt : 1 tt, so the phenotype ratio is 3 tasters : 1 non-taster.Percentage of non-tasters: 25%.Conclusion: 25% of Pasha and Hina’s children are expected to be non-tasters.
Why the other options are wrong
- B. The ability to taste the substance is dominant (T) and the inability to taste is recessive (t). If Pasha and Hina are both heterozygous (Tt), their children can have the following genotypes:TT → tasterTt → tastertT → taster (same as Tt)tt → non-tasterIf one parent is non-taster tt and the other is a taster TT the percentage of non-taster children will be 50%
- C. The ability to taste the substance is dominant (T) and the inability to taste is recessive (t). If Pasha and Hina are both heterozygous (Tt), their children can have the following genotypes:TT → tasterTt → tastertT → taster (same as Tt)tt → non-tasterIf one parent is non-taster tt and the other is a taster TT the percentage of non-taster children will be 50%
- D. The ability to taste the substance is dominant (T) and the inability to taste is recessive (t). If Pasha and Hina are both heterozygous (Tt), their children can have the following genotypes:TT → tasterTt → tastertT → taster (same as Tt)tt → non-tasterIf one parent is non-taster tt and the other is a taster TT the percentage of non-taster children will be 50%
Q51. Which one is NOT an involuntary function:
- A. Breathing
- B. Pumping of blood
- C. Skeletal muscle movement✓
- D. Blinking of eyes
Explanation: Involuntary functions are those that occur without our conscious control.Skeletal muscle movement is not an involuntary function;it is voluntary/intentional.Blinking of eyes, heart-pumping of blood, and breathing are all involuntary.
Why the other options are wrong
- A. According to the given explanation, this is not correct.
- B. According to the given explanation, this is not correct.
- D. According to the given explanation, this is not correct.
Q52. The following statements are about enzymes: 1. They are globular proteins except ribo-enzyme.2. They can be inhibited3. They are formed in the smooth endoplasmic reticulum 4. There are only found attached to Plasma membranes in the cell Which statements are correct for all enzymes?
- A. 1 and 4
- B. 2 and 4
- C. 1 and 2✓
- D. 1,2,3 and 4
Explanation: Enzymes are a type of protein, and they have a three-dimensional, globular shape. This shape is crucial for their function, as it allows them to interact specifically with their substrates. Competitive inhibitors are molecules that closely resemble the substrate of an enzyme. They compete with the substrate for binding to the active site of the enzyme. When a competitive inhibitor binds to the active site, it prevents the substrate from binding and, as a result, inhibits the enzyme's normal catalytic activity.
Why the other options are wrong
- A. The statement “all enzymes are proteins” is not correct.While most enzymes are indeed protein in nature, exceptions exist.RNA molecules with catalytic activity, called ribozymes, also function as enzymes.Example: the ribosome’s peptidyl-transferase activity is carried out by rRNA.Some synthetic DNA molecules (deoxyribozymes) also show catalytic roles.Hence, not every enzyme can be classified as a protein.Therefore, any option containing this statement, like A (1 and 4), is incorrect.
- B. Competitive inhibitors are molecules that closely resemble the substrate of an enzyme. They compete with the substrate for binding to the active site of the enzyme. When a competitive inhibitor binds to the active site, it prevents the substrate from binding and, as a result, inhibits the enzyme's normal catalytic activity. Enzymes are not exclusively found attached to plasma membranes in cells. Enzymes are proteins that act as catalysts to facilitate and accelerate biochemical reactions, and they can be found in various cellular compartments, not just associated with the plasma membrane. The cellular location of enzymes depends on their specific functions and the processes they are involved in.
- D. This statement is false. Enzymes are not exclusively found attached to plasma membranes in cells. Enzymes are proteins that act as catalysts to facilitate and accelerate biochemical reactions, and they can be found in various cellular compartments, not just associated with the plasma membrane. The cellular location of enzymes depends on their specific functions and the processes they are involved in.
Q53. What does the following picture show?
- A. Motor Neuron
- B. Sensory Neuron✓
- C. Interneuron
- D. Nerve
Explanation: The diagram illustrates a sensory neuron. The defining feature is the cell body, which connects to the dendrites via dendron processes. This structure is specific to sensory neurons and is not found in motor neurons, where the cell body directly attaches to dendrites. Interneurons are characterized by processes that are similar in size to the cell body, which is not evident here. Lastly, the term 'nerve' refers to a collection of neurons, whereas the image shows only one neuron.
Why the other options are wrong
- A. This is incorrect. Motor neurons have their cell body attached directly to the dendrites without the presence of dendron processes, which are characteristic of sensory neurons.
- C. This is incorrect. Interneurons typically have shorter processes that are comparable in size to the cell body, unlike what is shown in the image.
- D. This is incorrect. A nerve consists of many neurons bundled together, whereas the image shows a single neuron.
Q54. Glucose and fructose join together through _ to form sucrose.
- A. 1, 4 glycosidic linkage
- B. 1, 6 glycosidic linkage
- C. 1,2 glycosidic linkage✓
- D. 1,3 glycosidic linkage
Explanation: Fructose and glucose combine through condensation process to form sucrose. Glucose and fructose join together through a glycosidic bond to form sucrose. A glycosidic bond is a type of covalent bond that connects the two monosaccharides, glucose and fructose, to create the disaccharide known as sucrose. Specifically, the glycosidic bond forms between the anomeric carbon atom of glucose (C1) and the hydroxyl group of fructose (C2). This linkage results in the formation of a new molecule, sucrose, with the molecular formula C₁₂H₂₂O₁₁. Sucrose is commonly found in various plants, particularly in sugar cane and sugar beets. It serves as a major source of energy in the human diet and is commonly known as table sugar or cane sugar.
Why the other options are wrong
- A. Linkage formed between 1st carbon of one and 4th carbon of the other
- B. Linkage formed between 1st carbon of one and 6th carbon of the other
- D. Linkage formed between 1st carbon of one and 3rd carbon of the other
Q55. Which factor decides what type of variation should be flourished and passed on to the next generations?
- A. Species
- B. Population
- C. Survival
- D. Environment✓
Explanation: The correct answer is Environment. The environment exerts selection pressures that influence the success of certain variations over others. Variations that offer a survival advantage in a given environment are more likely to be passed on to future generations. While Species and Population provide the genetic pool from which variations arise, they do not select which variations are successful. Survival is a consequence of how well organisms are adapted to their environment but is not the deciding factor for variation inheritance.
Why the other options are wrong
- A. A species is a group of organisms capable of interbreeding and producing fertile offspring. While species exhibit variations, they do not decide which variations are favored across generations.
- B. A population is composed of individuals of the same species living in a specific area. While populations exhibit genetic diversity, they do not determine which specific variations will be more successful.
- C. Survival is essential for the continuation of genes, but it is not the deciding factor for which variations will be passed on. It is more an outcome of how well a variation suits the environment.
Q56. A continuously varying trait is encoded by alleles of two or more different genes located at different loci, all influencing the same trait in an additive way is known as _.
- A. Polytraits
- B. Polygenes✓
- C. Multiple alleles
- D. Different genes
- E. Allele frequency
Explanation: Polygenic inheritance is a type of inheritance where a continuously varying trait is influenced by alleles of two or more different genes located at different loci. These alleles are said to be polygenes, and they all contribute to the phenotype of the individual in an additive way. Examples of traits that are controlled by polygenes include height, skin color, and intelligence.
Why the other options are wrong
- A. Poly traits, also known as polygenic traits, refer to traits that are controlled by multiple genes. These genes can be located at different loci and contribute to the trait's variation in an additive manner. Polytraits often result in a wide range of phenotypic variations.
- C. Multiple alleles refer to more than two alleles of a gene in a population. Each individual can have only two alleles (one from each parent), but the population as a whole may have multiple alleles at a specific gene locus. Multiple alleles contribute to genetic diversity and can result in a range of phenotypic variations for a trait.
- D. Different genes simply refer to genes that are distinct and separate from each other. They may or may not be related to the same trait or phenotype. The presence of different genes in an organism's genome contributes to its overall genetic makeup.
- E. Allele frequency refers to the relative proportion or frequency of a specific allele within a population. It represents how common or rare a particular allele is in the population. Allele frequency is an important concept in population genetics and evolutionary studies.
Q57. Which of the following are instant sources of energy in living organisms, like glucose? Their general formula is:
- A. Cx(H2O)x
- B. C6H12O6
- C. Cx(H2O)y✓
- D. Cx(HO)y
- E. Cx(H2O2)y
Explanation: Carbohydrates are the instant sources of energy in living organisms. The general carbohydrate formula is Cx(H2O)y, where x and y are integers. This formula represents that carbohydrates are composed of carbon, hydrogen, and oxygen in a ratio of 1:2:1. Glucose, which has the formula C6H12O6, is an example of carbohydrate and is a primary energy source for the body's cells.
Why the other options are wrong
- A. The formula Cx(H2O)y represents carbohydrates, where x and y can vary depending on the specific carbohydrate molecule. Carbohydrates, such as glucose, are instant energy sources in living organisms.
- B. C6H12O6 is the molecular formula for glucose, which is a type of carbohydrate and an instant source of energy in living organisms.
- D. Cx(HO)y is not a recognized formula for any known molecule or compound.
- E. Cx(H2O2)y is also not a recognized formula for any known molecule or compound.
Q58. The biological catalysts are called:
- A. Proteins
- B. Carbohydrates
- C. Vitamins
- D. Minerals
- E. Enzymes✓
Explanation: Enzymes are specialized proteins that function as biological catalysts, facilitating and accelerating various biochemical reactions by reducing the activation energy necessary. Although enzymes are proteins, not all proteins have catalytic functions, which differentiates enzymes from the broader category of proteins. Carbohydrates and minerals serve different roles in the body, such as energy provision and structural integrity, and are not involved in catalysis. Vitamins can act as coenzymes, enhancing enzyme function, but they do not act as catalysts themselves.
Why the other options are wrong
- A. While many enzymes are proteins, not all proteins function as biological catalysts. Thus, this option is too broad.
- B. Carbohydrates primarily serve as energy sources and structural components, not as catalysts in biological reactions.
- C. Vitamins are organic compounds that often serve as coenzymes but are not catalysts themselves.
- D. Minerals may act as cofactors in enzymatic reactions but are not biological catalysts by themselves.
Q59. It is the non-living component of the cell, it is secreted and maintained by the living portion of the cell and is found only in plants. What is this structure?
- A. Golgi apparatus
- B. Lysosome
- C. Mitochondrion
- D. Cell wall✓
- E. Ribosomes
Explanation: The correct answer is the cell wall, which is a non-living component unique to plant cells among the options provided. It is secreted and maintained by the living parts of the cell, such as the plasma membrane and the Golgi apparatus. The cell wall provides structure, protection, and supports the plant cell against mechanical stress and osmotic pressure. It is primarily composed of cellulose in plants.Other options such as the Golgi apparatus, lysosomes, mitochondria, and ribosomes are all living organelles involved in various cell functions and are found in both plant and animal cells. They do not serve the structural role that the cell wall does.
Why the other options are wrong
- A. The Golgi apparatus is a living organelle involved in modifying, sorting, and packaging proteins and lipids for secretion or use within the cell. It is found in both plant and animal cells.
- B. Lysosomes are membrane-bound organelles that contain enzymes for digesting cellular waste and other substances. They are more commonly found in animal cells and are living components.
- C. Mitochondria are energy-producing organelles found in both plant and animal cells. They are involved in cellular respiration and are living components.
- E. Ribosomes are the site of protein synthesis in cells and are found in both plant and animal cells. They are living components and essential for translating genetic information into proteins.
Q60. Genetic equilibrium is a:
- A. Change of allele and gene frequency in a population
- B. Stability of allele and gene quantity in a population
- C. Change of allele and gene number in a population
- D. Stability of allele and gene frequency in a population✓
Explanation: Genetic equilibrium refers to a condition where the allele and gene frequencies in a population remain constant over time, indicating no evolutionary change occurring. This stability is typically due to factors such as large population size, random mating, no mutation, migration, or selection. Option D is correct as it accurately defines this state of balance. The other options incorrectly describe scenarios where changes in allele frequencies or gene quantities occur, which are indicative of evolutionary processes rather than equilibrium.
Why the other options are wrong
- A. This option describes genetic drift or mutation, not genetic equilibrium, which involves stability.
- B. This option is misleading as it focuses on quantity rather than frequency, which is key to genetic equilibrium.
- C. This option refers to changes in the population's genetic makeup, which is contrary to the concept of genetic equilibrium.
Q61. Mendel’s work was rediscovered in:
- A. 1868
- B. 1882
- C. 1900✓
- D. 1950
Explanation: Will be added soon"
Why the other options are wrong
- A. This is just 3 years after Mendel published his work (1865). At this time, his research was ignored and not recognized.
- B. By this year, Mendel had already passed away (1884) and his work was still unnoticed.
- D. By 1950, genetics was already a well-developed field. In fact, DNA structure was discovered in 1953.
Q62. Which fish selectively feed on larvae of mosquitoes?
- A. Gambusia✓
- B. Rohu
- C. Clarias
- D. Exocoetus
Explanation: Gambusia affinis is regarded as a larvicidal fish as it selectively feeds on mosquito larvae. It forms an effective tool for biological control of mosquitoes.
Why the other options are wrong
- B. he rohu is a large, silver-colored fish of typical cyprinid shape, with a conspicuously arched head. Adults can reach a maximum weight of 45 kg (99 lb) and maximum length of 2 m (6.6 ft), but average around 1⁄2 m (1.6 ft).
- C. Walking catfish is the most common English name for this species. The Thai name Pla duk dam translates to “dull colored wriggling-fish”. Other English language common names include clarias catfish, freshwater catfish, thai hito (Thai), and Thailand catfish.
- D. Exocoetus is a genus of flying fishes. It is a bony fish. The body is covered with cycloid scales. The mouth is wide, and the jaws bear teeth. It is a marine fish. The tail has hypobatic fins as the ventral lobe
Q63. All of the following are reflex actions EXCEPT:
- A. Change in the size of the pupil in response to light
- B. Swallowing of the bolus✓
- C. Sudden jerky withdrawal of hand when pricked
- D. Knees jerk in response to a blow
Explanation: Reflex actions are involuntary and instantaneous responses to stimuli. The change in pupil size, jerky withdrawal of the hand, and knee jerk are all reflex actions because they occur automatically and without conscious thought. However, swallowing of the bolus, while it begins with a reflexive component, is primarily a voluntary action because it requires conscious control, especially after the initial trigger, making it not purely reflexive.
Why the other options are wrong
- A. This is a reflex action known as the pupillary light reflex, where the pupil size adjusts involuntarily to regulate the amount of light entering the eye.
- C. This action is a classic example of a reflex arc, where the body responds instantly and involuntarily to protect itself from harm by withdrawing the hand.
- D. This is known as the knee-jerk reflex, a sudden, involuntary response to a tap on the patellar tendon, demonstrating a reflex action.
Q64. Which kind of therapy was given in 1990 to a four year girl with Adenosine Deaminase (ADA) enzyme deficiency?
- A. Gene therapy✓
- B. Chemotherapy
- C. Immunotherapy
- D. Radiation therapy
Explanation: Gene therapy is a technique of genetic engineering which involves the replacement of a faulty/disease-causing gene by a normal healthy functional gene. The first clinical ex-vivo gene therapy was given in 1990 to a 4-year old girl with adenosine deaminase (ADA) enzyme deficiency. This enzyme is very important for the immune system to function and the deficiency of this enzyme can lead to severe combined immune deficiency (SCID).
Why the other options are wrong
- B. Chemotherapy is a treatment that uses drugs to kill or inhibit the growth of rapidly dividing cells, such as cancer cells. It is not a treatment for ADA deficiency.
- C. Immunotherapy involves using the immune system to treat diseases. While it has been explored as a treatment for various conditions, it is not the primary therapy for adenosine deaminase (ADA) deficiency.
- D. Radiation therapy is a treatment that uses high-energy radiation to target and kill cancer cells. It is not a treatment for ADA deficiency.
Q65. Golden rice is a genetically modified crop plant where the incorporated gene is meant for the biosynthesis of:
- A. Omega-3
- B. Vitamin A✓
- C. Vitamin B
- D. Vitamin C
Explanation: Golden rice is a transgenic variety of rice (Oryza sativa) engineered to produce beta-carotene, a precursor to vitamin A. The grains appear yellow due to the presence of beta-carotene, hence the name 'golden rice.' This genetic modification is intended to combat vitamin A deficiency, which is prevalent in regions relying heavily on rice as a staple food. Options A, C, and D are incorrect because golden rice is not designed to address deficiencies in Omega-3, Vitamin B, or Vitamin C.
Why the other options are wrong
- A. While Omega-3 fatty acids are important for health, golden rice is not genetically engineered to produce them. Its modification is specifically designed to address a deficiency in a vitamin crucial for vision and immune health.
- C. Golden rice is not engineered for Vitamin B production. The focus of its genetic modification is on a vitamin that is essential for eye health and preventing blindness.
- D. Vitamin C is important for various bodily functions, but golden rice is not modified to produce it. The genetic modification targets a different vitamin that helps prevent night blindness and supports immune function.
Q66. Animals cope with the temperature extremes through a homeostatic mechanism called:
- A. Evaporative Cooling
- B. Shivering Thermogenesis
- C. Non-shivering Thermogenesis
- D. Thermoregulation✓
Explanation: The process mentioned in 'A', 'B' and 'C' are partially supportive in temperature maintenance, however thermoregulation is the homeostatic process used in this regard.
Why the other options are wrong
- A. Evaporative cooling is a natural process in which the temperature of a substance or an area decreases as a result of the evaporation of a liquid. This cooling effect occurs when the liquid changes from a liquid state to a gas (vapor). Evaporative cooling is a fundamental principle used in various cooling systems and is commonly experienced in everyday life. Evaporative cooling is effective in dry, low-humidity conditions where the air has a greater capacity to absorb moisture. It is less effective in humid environments because the air is already saturated with moisture and cannot absorb more, limiting the cooling potential.
- B. Shivering thermogenesis is a physiological response in which the body generates heat through involuntary muscle contractions, or shivering. This mechanism is one of the ways the body attempts to increase its internal temperature when it is exposed to cold conditions or when core body temperature drops below a certain set point. Shivering thermogenesis is just one of several mechanisms the body uses to maintain its core temperature within a narrow range, a process known as thermoregulation.
- C. Non-shivering thermogenesis is a metabolic process that generates heat within the body without the involvement of shivering or muscle contractions. It primarily occurs in brown adipose tissue (brown fat) and is an essential mechanism for maintaining body temperature, especially in newborns and small mammals. This form of thermogenesis relies on the activation of brown fat cells and the uncoupling of oxidative phosphorylation. Non-shivering thermogenesis is a vital component of the body's thermoregulatory system, helping to maintain core body temperature in cold conditions. In adult humans, the amount of brown adipose tissue is relatively small compared to white adipose tissue, and its role in thermogenesis is less pronounced compared to newborns and small mammals.
Q67. Blood circulating from the gut to the heart passes through the:
- A. Aorta
- B. Kidneys
- C. Liver✓
- D. Lungs
Explanation: The hepatic portal system carries nutrient-rich blood from the gut to the liver before it enters systemic circulation.
Why the other options are wrong
- A. Aorta carries blood from heart to the whole body.
- B. Kidneys get their blood supply via renal artery.
- D. Lungs get their blood supply from pulmonary artery.
Q68. Vaccine is available for all, EXCEPT:
- A. Hepatitis B
- B. Tuberculosis
- C. Malaria✓
- D. Polio
Explanation: Malaria does not currently have a widely available vaccine, unlike Hepatitis B, Tuberculosis, and Polio, which all have established vaccines used globally. The Hepatitis B vaccine is essential for preventing the Hepatitis B virus, the BCG vaccine protects against tuberculosis, and the polio vaccine prevents poliomyelitis. Ongoing research targets malaria vaccine development, but it is not yet universally implemented.
Why the other options are wrong
- A. The Hepatitis B vaccine effectively protects against the Hepatitis B virus, which is crucial for high-risk groups such as healthcare workers and newborns of infected mothers.
- B. The BCG vaccine is available to protect against tuberculosis, using a weakened form of Mycobacterium bovis to build immunity.
- D. The polio vaccine is available and effectively prevents poliomyelitis, a highly infectious disease that can lead to paralysis and death.
Q69. Lithotripsy is a technique used to breakup stones formed in the :
- A. Kidney
- B. Gall bladder
- C. Ureter
- D. Kidney, Ureter and gall bladder✓
Explanation: Kidney stones, ureteral stones, and gallstones can all be treated using lithotripsy techniques. By breaking up the stones into smaller fragments, lithotripsy helps facilitate their passage through the urinary or biliary system, avoiding the need for invasive surgery.
Why the other options are wrong
- A. This is one of the correct options but not completely correct. Lithotripsy is commonly used to treat kidney stones, which are hard mineral and salt deposits that form in the kidneys.
- B. This is another correct option but also not completely correct. Although less common than kidney stones, gallstones can also form in the gallbladder. Lithotripsy can be used to break up gallstones in certain cases.
- C. This is the third correct option but again not fully correct. The ureters are the tubes that connect the kidneys to the bladder, and stones can sometimes form within them. Lithotripsy can be used to treat ureteral stones by breaking them into smaller pieces, making it easier for the body to pass them naturally.
Q70. Immunity is a capacity to do following things EXCEPT:
- A. Recognition of foreign pathogens
- B. Effective and timely elimination of invaders
- C. Mobilization of immune cells and their products
- D. Blockage of entry of pathogens✓
Explanation: Blockage is not responsibility of immune system rather it is carried out by physical barriers.
Why the other options are wrong
- A. The immune system is adept at identifying foreign substances, a crucial step in immunity.
- B. The immune system is responsible for neutralizing and removing harmful invaders from the body.
- C. This is a key function of the immune system, involving the activation and deployment of cells to attack pathogens.
Q71. Viral disease that is widely spread and caused by enveloped RNA virus is:
- A. HIV
- B. Hepatitis
- C. Pox virus
- D. Influenza✓
Explanation: The correct answer is Influenza, as it is caused by an enveloped RNA virus and is known for its widespread occurrence, particularly during seasonal outbreaks. In contrast, HIV is a retrovirus that primarily affects the immune system and is not associated with respiratory disease. Hepatitis, while it can involve enveloped viruses, primarily causes liver inflammation and is not typically transmitted via respiratory routes. Finally, Pox virus refers to a group of viruses that are DNA-based and do not fit the criteria outlined in the question.
Why the other options are wrong
- A. HIV (Human Immunodeficiency Virus) is a retrovirus that attacks the immune system, leading to AIDS. It is not classified as an enveloped RNA virus that causes a widely spread respiratory disease like influenza.
- B. Hepatitis refers to inflammation of the liver and can be caused by various viruses, including some enveloped viruses. However, it does not predominantly spread through respiratory transmission like influenza.
- C. Pox viruses, such as smallpox, are DNA viruses and not RNA viruses. They do not fit the criteria of being an enveloped RNA virus or a respiratory disease, making them an incorrect choice.
Q72. The diagram shows the four types of human teeth. Which teeth are used for cutting rather than grinding food?
- A. 1 and 2✓
- B. 2 and 3
- C. 3 and 4
- D. 4 and 1
Explanation: Most adults have 32 permanent teeth, including eight incisors, four canines, eight premolars, and 12 molars. Incisors and canines are used to cut and chew. Premolars and molars are used for grinding the food.
Why the other options are wrong
- B. Canines are sharp, pointy teeth used for tearing food, while premolars are located behind the canines and have broad surfaces for crushing and grinding food.
- C. Premolars and molars are both teeth used for chewing and grinding food, but molars are larger, wider, and have more cusps (points) for grinding, while premolars are smaller and act as a transition between the canines and molars.
- D. Incisors and molars are two different types of human teeth with distinct functions: incisors are sharp, front teeth used for cutting food, while molars are large, broad teeth in the back used for grinding food.
Q73. Which of the following bones are present in the palm of the hand:
- A. Carpals
- B. Metacarpals✓
- C. Phalanges
- D. Tarsal
- E. Radius
Explanation: The human forelimbs each consist of 30 bones: The humerus, which forms a ball and socket joint with the scapula, and two long parallel bones, the radius and ulna, at its distal end. The radius and ulna join the wrist with eight small carpal bones, which articulate with five metacarpals of the palm. From the palm extend the fingers containing 14 small bones called phalanges, arranged in 5 rows, one row in each finger. The relevant detail for this question is that the bones of the palm are called metacarpals, hence option B is correct.
Why the other options are wrong
- A. Carpals are the small wrist bones that connect the forearm to the hand. They provide flexibility and movement but are not part of the palm itself.
- C. Phalanges are the bones of the fingers and thumb, not the palm. Each finger has three phalanges (proximal, middle, and distal), except the thumb, which has two.
- D. Tarsal bones are found in the foot, not the hand. They form the ankle and support movement while walking.
- E. The radius is one of the two forearm bones (along with the ulna). It extends from the elbow to the wrist but is not part of the hand or palm.
Q74. Formation of _ will be greater with the faster breakdown of glucose and glycogen to compensate for energy requirements in anaerobic respiration.
- A. Enzymes
- B. Hormones
- C. Lactic acid✓
- D. Fat
Explanation: In anaerobic respiration, when oxygen is scarce, glucose and glycogen are broken down to meet energy needs, resulting in lactic acid as a byproduct. This process does not produce enzymes or hormones as byproducts. Fat metabolism mainly occurs in the presence of oxygen and is not involved in this type of respiration.
Why the other options are wrong
- A. Enzymes facilitate biochemical reactions, but they are not the end products of glucose or glycogen breakdown in anaerobic respiration.
- B. Hormones regulate physiological processes but are not byproducts of anaerobic glucose or glycogen breakdown.
- D. Fat is typically metabolized through aerobic pathways and is not a byproduct of anaerobic respiration.
Q75. Transport of three protons through the ATPase complex is required for the production of one _.
- A. Sugar molecule
- B. NADP molecule
- C. ATP molecule✓
- D. NADPH molecule
Explanation: The ATPase complex, also known as ATP synthase, uses the energy from the flow of protons across the mitochondrial membrane to synthesize ATP from ADP and inorganic phosphate (Pi). This process requires the movement of three protons for the production of one ATP molecule. This is a key step in oxidative phosphorylation during cellular respiration. The other options, such as sugar molecules, NADP, and NADPH, are not directly synthesized through the ATPase complex. Instead, they are involved in other metabolic pathways.
Why the other options are wrong
- A. The ATPase complex is involved in ATP synthesis, not directly in sugar production. Sugar molecules are synthesized in processes like photosynthesis and glycolysis.
- B. NADP is primarily involved in photosynthesis and not directly related to the proton transport by ATPase complex.
- D. NADPH is mainly involved in the Calvin cycle in photosynthesis, not in ATP synthesis through the ATPase complex.
Q76. Which animals support Darwin's view of inheritance of desirable variation?
- A. Giraffe
- B. Galapagos finches✓
- C. Snake
- D. All of these
Explanation: Galapagos is an island where Darwin observed almost 13 types of finchis with distinct traits.
Why the other options are wrong
- A. The giraffe's neck is often used to illustrate the key difference between Lamarck's and Darwin's ideas on inheritance.
- C. Example of snake is used by lamarck not darwin.
- D. This is incorrect . Because Finches are used by Darwin.
Q77. They are inhibitors of key enzymes in the nervous system:
- A. Calcium and Potassium
- B. Substrate and activators
- C. Hexokinase and glucose
- D. Magnesium and manganese
- E. Pesticides DDT and parathione✓
Explanation: The correct answer is E Pesticides DDT and parathione. Pesticides such as DDT (dichlorodiphenyltrichloroethane) and parathion are known to be inhibitors of key enzymes in the nervous system. DDT was commonly used as an insecticide, while parathion is an organophosphate insecticide. Both of these pesticides can affect the activity of enzymes in the nervous system, leading to adverse effects on the functioning of nerve cells.
Why the other options are wrong
- A. Calcium and potassium are essential ions in the body, but they are not inhibitors of key enzymes in the nervous system. Instead, they play crucial roles in various cellular processes, including nerve signaling and muscle contraction. Therefore, Option A is not the correct answer.
- B. Substrate and activators are not inhibitors of key enzymes in the nervous system. Substrates are the molecules that enzymes act upon, and activators are molecules that enhance the activity of enzymes. They do not inhibit the function of enzymes. Therefore, Option B is not the correct answer.
- C. Hexokinase is an enzyme that plays a role in glucose metabolism, particularly in the first step of glucose utilization in cells. Glucose, on the other hand, is a sugar molecule that serves as a fuel source for cellular energy production. Neither hexokinase nor glucose are inhibitors of key enzymes in the nervous system. Therefore, Option C is not the correct answer.
- D. Magnesium and manganese are essential minerals in the body, but they are not typically considered inhibitors of key enzymes in the nervous system. They often act as cofactors or activators for enzymes, assisting in their proper function. Therefore, Option D is not the correct answer.
Q78. Enzymes are generally inactivated rapidly by exposure to UV high and also a, ẞ rays because it alters the:
- A. Quantity of enzyme
- B. pH of enzyme
- C. Shape of enzymes✓
- D. Temperature of enzyme
- E. Nature of enzyme
Explanation: Exposure to UV, high-energy, and ionizing radiation, such as X-rays and gamma rays, can cause damage to enzymes and other biomolecules. The primary mechanism by which these radiations affect enzymes is by altering their molecular structure or shape. Therefore option C is correct.
Why the other options are wrong
- A. It is not altered by UV rays or beta rays.
- B. It is not altered by UV rays or beta rays.
- D. It is not altered by UV rays or beta rays.
- E. It is not altered by UV rays or beta rays.
Q79. Plant like character found in Euglena:
- A. Pyrenoid✓
- B. Cilia
- C. Photoreceptor
- D. Flagellum
- E. Pellicle
Explanation: The correct answer is A Pyrenoid. One of the plant-like characteristics found in Euglena is the presence of a pyrenoid. A pyrenoid is an organelle located within the chloroplast of certain algae and plants.
Why the other options are wrong
- B. Option B is not the correct answer. Cilia are hair-like structures found on the surface of some cells, primarily in animal cells. They are used for various functions, including movement, sensory perception, and fluid propulsion. Euglena does not have cilia. Instead, it has a flagellum, which is a whip-like structure used for movement.
- C. Option C is not the correct answer. Euglena possesses a photoreceptor, which is a light-sensitive structure. This photoreceptor allows Euglena to detect changes in light intensity and helps the organism move towards light during phototaxis. However, photoreceptors are not specific to plant-like characteristics.
- D. Option D is not the correct answer. Euglena has a whip-like flagellum that it uses for movement. The flagellum enables Euglena to propel itself through the water by beating in a whip-like motion. While the presence of a flagellum is characteristic of Euglena, it is not a plant-like characteristic.
- E. Option E is not the correct answer. Euglena possesses a pellicle, which is a flexible outer covering or membrane. The pellicle provides structural support to the cell and helps maintain its shape. While the presence of a pellicle is a unique feature of Euglena, it is not a plant-like characteristic.
Q80. A hormone secreted from the duodenal mucosa that changes the inactive trypsinogen into trypsin is:
- A. Peptone
- B. Ecdysone
- C. Enterokinase✓
- D. Amylase
- E. Protease
Explanation: The correct answer is C Enterokinase. Enterokinase, also known as enteropeptidase, is an enzyme that is produced and secreted by the cells of the duodenal mucosa (lining of the duodenum). It plays a crucial role in the digestion of proteins by converting the inactive pancreatic zymogen called trypsinogen into its active form, trypsin.
Why the other options are wrong
- A. Peptone is not the correct answer. Peptone is a protein derivative obtained by breaking down proteins through enzymatic digestion or acid hydrolysis. It is commonly used as a nutrient source in microbiological culture media, but is not involved in converting trypsinogen into trypsin.
- B. Ecdysone is not the correct answer. Ecdysone is a hormone involved in the moulting process of arthropods, such as insects and crustaceans. It plays a role in regulating the shedding of their exoskeleton during growth and development.
- D. Amylase is not the correct answer. Amylase is an enzyme involved in the breakdown of starch and glycogen into simpler sugars like maltose. It is produced in the salivary glands and pancreas, but is not responsible for converting trypsinogen into trypsin.
- E. Protease is not the correct answer. Protease is a general term for enzymes that break down proteins into smaller peptides or amino acids. While it plays a crucial role in protein digestion, it is not the specific hormone responsible for converting trypsinogen into trypsin.
Q81. Each enzyme has a dimple or groove at a specific side called:
- A. Co-factor
- B. Active site✓
- C. Non active site
- D. Substrate
- E. Prosthetic group
Explanation: Each enzyme has a dimple or groove at a specific side called active site. This is where all the catalytic activity occurs. So option B is correct.
Why the other options are wrong
- A. Option A is not the correct answer. A co-factor is a non-protein molecule or ion that is required for the proper functioning of some enzymes. Co-factors can bind to enzymes and assist in their catalytic activity, but they are not specifically located in a dimple or groove on the enzyme.
- C. Option C is not the correct answer. While enzymes do have regions other than the active site, the term "non-active site" is not commonly used to describe a specific feature or location on the enzyme.
- D. Option D is not the correct answer. The substrate is the specific molecule that binds to the active site of an enzyme and undergoes a chemical reaction. It is not a dimple or groove on the enzyme itself.
- E. Option E is not the correct answer. A prosthetic group is a non-protein molecule that is permanently attached to an enzyme and is necessary for its function. Prosthetic groups are not located in a dimple or groove on the enzyme and are not directly involved in enzyme-substrate interactions.
Q82. In which model do proteins float in membrane like icebergs in sea:
- A. Lock and key model
- B. Induced fit model
- C. Fluid mosaic model✓
- D. Lotka volterra model
- E. All of these
Explanation: As per the fluid mosaic model cell membranes have proteins as icebergs in a sea of lipids (lipid). Hence option C is correct.
Why the other options are wrong
- A. Option A is incorrect because the lock and key model is the model used to explain the mode of action of enzymes.
- B. Option B is incorrect because the induced fit model is another model used to explain the mode of action of enzymes, in which enzymes do not behave as rigid locks but can instead modify their shapes to ensure that they fit well around substrates.
- D. Option D is incorrect because the Lotka–Volterra model is a model that can theoretically predict the outcome of interspecific competition between two species.
- E. This option is incorrect.
Q83. What are the functions of the inter, motor and sensory neurons in a reflex response?
- A. Option A✓
- B. Option B
- C. Option C
- D. Option D
Explanation: To relay nerve impulses from within the CNS, interneurons are used. To conduct the nerve impulses from the CNS to the effector, motor neurons are used. To conduct the nerve impulses from the receptors to the CNS, sensory neurons are used.
Why the other options are wrong
- B. Functions of sensory neurons: Sensory neurons are the nerve cells that are activated by sensory input from the environment - for example, when you touch a hot surface with your fingertips, the sensory neurons will be the ones firing and sending off signals to the rest of the nervous system about the information they have received. Functions of Motor Neurons: Motor neurons of the spinal cord are part of the central nervous system (CNS) and connect to muscles, glands, and organs throughout the body. These neurons transmit impulses from the spinal cord to skeletal and smooth muscles (such as those in your stomach), and so directly control all of our muscle movements. Functions of interneurons: As the name suggests, interneurons are the ones in between - they connect the spinal motor and sensory neurons. As well as transferring signals between sensory and motor neurons, interneurons can also communicate with each other, forming circuits of various complexity.
- C. Functions of sensory neurons: Sensory neurons are the nerve cells that are activated by sensory input from the environment - for example, when you touch a hot surface with your fingertips, the sensory neurons will be the ones firing and sending off signals to the rest of the nervous system about the information they have received. Functions of Motor Neurons: Motor neurons of the spinal cord are part of the central nervous system (CNS) and connect to muscles, glands, and organs throughout the body. These neurons transmit impulses from the spinal cord to skeletal and smooth muscles (such as those in your stomach), and so directly control all of our muscle movements. Functions of interneurons: As the name suggests, interneurons are the ones in between - they connect the spinal motor and sensory neurons. As well as transferring signals between sensory and motor neurons, interneurons can also communicate with each other, forming circuits of various complexity.
- D. This option is incorrect. Functions of sensory neurons: Sensory neurons are the nerve cells that are activated by sensory input from the environment - for example, when you touch a hot surface with your fingertips, the sensory neurons will be the ones firing and sending off signals to the rest of the nervous system about the information they have received. Functions of Motor Neurons: Motor neurons of the spinal cord are part of the central nervous system (CNS) and connect to muscles, glands, and organs throughout the body. These neurons transmit impulses from the spinal cord to skeletal and smooth muscles (such as those in your stomach), and so directly control all of our muscle movements. Functions of interneurons: As the name suggests, interneurons are the ones in between - they connect the spinal motor and sensory neurons. As well as transferring signals between sensory and motor neurons, interneurons can also communicate with each other, forming circuits of various complexity.
Q84. A cross between a black cat and a tan cat produces a tabby pattern (black and tan fur together). What percent of kittens would have tan fur if a tabby cat is crossed with a black cat?
- A. 100%
- B. 50%
- C. 25%
- D. 0%✓
Explanation: The correct answer is 0%. The black cat is homozygous for the black fur gene (BB) and does not carry an allele for tan fur. The tabby cat, being a hybrid, has one black fur allele (B) and one tan fur allele (T). When crossed with a black cat, the potential offspring genotypes are BB (black) and BT (tabby), with no possibility of a TT (tan) genotype. Thus, none of the kittens will have tan fur. The other options are incorrect because they suggest the presence of a tan allele in the black parent, which is not possible given the genetic information provided.
Why the other options are wrong
- A. If all offspring were tan, it would mean both parents carry only the tan gene, which is not the case here. The cross involves a tabby cat (BT) and a black cat (BB), which cannot produce tan-only offspring.
- B. For 50% of the offspring to be tan, the tabby cat would need to pass the tan gene (T) to half of its offspring, but the black cat (BB) has no tan gene to contribute.
- C. For 25% of the offspring to be tan, there must be a recessive tan gene present in both parents, but the black cat (BB) does not carry a tan allele.
Q85. Label the following phenomenon
- A. Exocytosis
- B. Osmosis
- C. Diffusion
- D. Phagocytosis.✓
Explanation: The diagram shows phagocytosis, which is the process by which a cell uses its plasma membrane to engulf a large particle, giving rise to an internal compartment called the phagosome. It is one type of endocytosis.Exocytosis is a form of active transport and bulk transport in which a cell transports molecules out of the cell. Osmosis is the movement of water molecules down the water potential gradient into or out of the cell. Diffusion is the movement of substances down the concentration gradient into or out of the cell.
Why the other options are wrong
- A. The diagram shows phagocytosis, which is the process by which a cell uses its plasma membrane to engulf a large particle, giving rise to an internal compartment called the phagosome. It is one type of endocytosis.Exocytosis is a form of active transport and bulk transport in which a cell transports molecules out of the cell.
- B. The diagram shows phagocytosis, which is the process by which a cell uses its plasma membrane to engulf a large particle, giving rise to an internal compartment called the phagosome. It is one type of endocytosis.Osmosis is the movement of water molecules down the water potential gradient into or out of the cell.
- C. The diagram shows phagocytosis, which is the process by which a cell uses its plasma membrane to engulf a large particle, giving rise to an internal compartment called the phagosome. It is one type of endocytosis. Diffusion is the movement of substances down the concentration gradient into or out of the cell.
Q86. The division of cocci in three planes form Sarcina, which is a cube of _ Cocci?
- A. 02
- B. 04
- C. 08✓
- D. 16
Explanation: Sarcina is a genus of bacteria that divides in three planes, resulting in the formation of packets of cells arranged in a cube-like structure. These packets, known as tetrads, consist of eight cells arranged in a 3-dimensional cubic configuration. Each of the three planes of division produces four daughter cells, resulting in a total of eight cells in the sarcina packet. Therefore, the cube of cells formed by the division of cocci in three planes is composed of eight individual cells.
Why the other options are wrong
- A. This is not the correct number of cocci in Sarcina.
- B. This is not the correct number of cocci in Sarcina.
- D. This is not the correct number of cocci in Sarcina.
Q87. Test cross is made to check the genotype of a trait. Which of the following crosses is a test cross?
- A. Unknown x At
- B. Unknown x tt✓
- C. Unknown x AB
- D. Unknown x TT
Explanation: A test cross is a cross between an individual with an unknown genotype for a particular trait and an individual that is homozygous recessive for that trait. The purpose of the test cross is to determine the genotype of the unknown individual by observing the phenotypic ratios of the offspring. This cross involves a homozygous recessive individual (tt), which is the test cross. The offspring from this cross will reveal the genotype of the unknown individual.
Why the other options are wrong
- A. If At represents a genotype where t is recessive, then At includes a recessive allele but is not completely homozygous recessive (tt).A proper test cross requires a homozygous recessive (tt) individual, so this is also not a true test cross.
- C. This cross involves an individual with an unknown genotype and another individual with genotype AB. Since AB is not necessarily homozygous recessive, this is not a test cross.
- D. Here, the unknown individual is crossed with TT, which is homozygous dominant.A test cross requires a homozygous recessive partner, so this is not a test cross.
Q88. Artificial selection in breeding provides evidence for evolution known as:
- A. Domestication✓
- B. Deme
- C. Gene pool
- D. Desire trait
- E. Genetic death
Explanation: One of the most notable examples of artificial selection is domestication, where humans have selectively bred plants and animals to suit their needs and preferences. Domestication has resulted in the development of various breeds and varieties that differ significantly from their wild ancestors. So option A is the correct answer.
Why the other options are wrong
- B. Option B is not the correct answer. A deme is a local population of organisms with shared characteristics. It is not directly related to the evidence for evolution through artificial selection.
- C. Option C is not the correct answer. The gene pool refers to the total set of genes and alleles present in a population of organisms. While artificial selection can affect the gene pool of a population, it is not the specific term used to describe the evidence for evolution through artificial selection.
- D. Option D is not the correct answer. While artificial selection involves choosing organisms with specific desired traits for breeding, "desired trait" is not the term used to describe the evidence for evolution through artificial selection.
- E. Option E is not the correct answer. "Genetic death" is not a term used in the context of evidence for evolution through artificial selection. It does not accurately describe the process of artificial selection or its role in providing evidence for evolution.
Q89. Endocytosis which involves ingestion of solid material is called:
- A. Solidocytosis
- B. Phagocytosis✓
- C. Exocytosis
- D. Pinocytosis
- E. Autocytosis
Explanation: Phagocytosis involves the ingestion of solid food material into the cell. So option B is the correct option.
Why the other options are wrong
- A. No such term exists.
- C. It is egestion of substances from cell.
- D. It is termed as taking fluid particles into the cells.
- E. No such term exists.
Q90. Select the reagent X from the following choices for this conversion:
- A. Acidified Potassium hydroxide
- B. Acidified Potassium dichromate (VI)✓
- C. Acidified Phosphoric acid
- D. Acidified Oxalic acid
Explanation: The reaction above is oxidation of a secondary alcohol into a ketone. As such, an oxidizing agent must be chosen for reagent X. Among the options, 'Potassium dichromate (VI)' is an oxidizing agent so, the correct option is B. Another answer could be 'potassium manganate (VII)', but it is not mentioned in any of the options. The other options do not oxidize alcohols.
Why the other options are wrong
- A. This is incorrect. Potassium hydroxide (KOH) is a strong base and does not function as an oxidizing agent. It is mainly used in saponification and elimination reactions rather than oxidation of alcohols to ketones.
- C. This is incorrect. Phosphoric acid (H₃PO₄) is not an oxidizing agent. It is primarily used as a catalyst in esterification and dehydration reactions, not in alcohol oxidation.
- D. This is incorrect. Oxalic acid (C₂H₂O₄) is a weak organic acid and does not act as a strong oxidizing agent for secondary alcohols. It would not convert the alcohol to a ketone.
Q91. In anisotropic crystals, which property does not change with the change in direction of the crystalline structure?
- A. Electrical conductance
- B. Molar mass✓
- C. Thermal conductance
- D. Refractive index
Explanation: (B) Molar mass (Correct Answer) – Molar mass is a constant, irrespective of the direction in the crystal
Why the other options are wrong
- A. (A) Electrical conductance – Incorrect. It varies with direction in anisotropic materials.
- C. (C) Thermal conductance – Incorrect. It depends on crystal orientation in anisotropic materials
- D. (D) Refractive index – Incorrect. Anisotropic materials show birefringence, meaning refractive index changes with direction.
Q92. According to which phenomenon, "the properties of elements are the periodic function of their atomic number."
- A. Mendeleev's periodic law
- B. Newland's law of octaves
- C. Dobereiner's triads
- D. Lothar Meyer’s classification
- E. Modern periodic law✓
Explanation: The modern Periodic law can be stated as: “The physical and chemical properties of the elements are periodic functions of their atomic numbers”. The atomic number is equal to the number of electrons or protons in a neutral atom.
Why the other options are wrong
- A. Mendeleev formulated his periodic law based on atomic mass, not atomic number. He observed that the properties of elements are periodic functions of their atomic masses.
- B. Newland's law was an early attempt to classify elements, stating that every eighth element had similar properties, based on increasing atomic mass, not atomic number.
- C. Dobereiner grouped elements into triads based on similar chemical properties and atomic masses, not on atomic numbers.
- D. Lothar Meyer arranged elements by increasing atomic weights, noting periodic trends in properties, but this was not based on atomic numbers.
Q93. The unit of viscosity is:
- A. Joule
- B. N/m2
- C. Dynes/cm
- D. Poise✓
- E. Ergs
Explanation: The cgs unit of viscosity is poise (P) whereas the SI unit of viscosity is newton-second per square meter, which is usually expressed as pascal-second.
Why the other options are wrong
- A. Joule is a unit of energy or work, not viscosity. It measures the amount of work done when a force is applied over a distance.
- B. N/m2, or pascal (Pa), is a unit of pressure, not viscosity. It represents force per unit area.
- C. Dynes per centimeter is a unit of surface tension, not viscosity. It measures force along a line of unit length.
- E. The erg is a unit of energy in the cgs system, not viscosity. It is a small unit of work or energy.
Q94. Ethanol, when reacted with PCI5 , gave A, POCl3, and HCI. A reacts with AgNO2 to form B and AgCl. A and B are respectively:
- A. C2H5Cl and C2H5OC2H5
- B. C2H6 and C2H5OC2H5
- C. C2H5Cl and C2H5NO2✓
- D. C2H6 and C2H5NO2
- E. C2H6 and C2H6NO
Explanation: The sequence of reactions begins with ethanol (C2H5OH) reacting with phosphorus pentachloride (PCl5), resulting in the formation of ethyl chloride (C2H5Cl), phosphorus oxychloride (POCl3), and hydrochloric acid (HCl). The ethyl chloride then reacts with silver nitrate (AgNO2), producing nitroethane (C2H5NO2) and silver chloride (AgCl). The correct products for A and B in the sequence are thus ethyl chloride and nitroethane, respectively. The other options involve incorrect products, such as diethyl ether, ethane, or incorrect formulas, and do not match the reaction steps provided.
Why the other options are wrong
- A. This option is incorrect because C2H5OC2H5 (diethyl ether) is not formed in the given reactions.
- B. This option is incorrect as neither C2H6 (ethane) nor diethyl ether is produced from the reactions described.
- D. C2H6 is not formed in this reaction sequence. The correct product from C2H5Cl and AgNO2 is C2H5NO2.
- E. Neither C2H6 nor C2H6NO are products of the reactions given. This option is incorrect.
Q95. The false statement regarding saline hydrides is:
- A. They conduct electricity in molten state
- B. They are used as reducing agents
- C. They give H2 from H2O
- D. They are covalent in nature✓
Explanation: Saline hydrides (also known as ionic hydrides or pseudohalides) are compounds form between hydrogen and the most active metals, especially with the alkali and alkaline-earth metals of group one and two elements, thus they are ionic, not covalent.
Why the other options are wrong
- A. Being ionic, they dissociate into their constituent hydride and metal ions in molten state and these mobile/free ions conduct electricity.
- B. They are good reducing agents as the hydride ion loses an electron easily and is oxidizef.
- C. They readily decompose in water to liberate hydrogen.MH + H2O —> MOH + H2
Q96. H2SO4 has great affinity for water because:
- A. It decomposes the acid
- B. It hydrolyses the acid
- C. Acid decomposes the water
- D. Acid forms hydrates with water✓
Explanation: Sulphuric acid is kept in air-tight bottles because if kept in the open it absorbs water vapors from the surrounding. It is a dehydrating agent. Sulphuric acid forms hydrate with water because the reaction of water and acid is highly exothermic and a great amount of heat in the form of fumes is liberated in that exothermic reaction of acid and water, acid produces stable hydrates-this shows the acid’s affinity for water.
Why the other options are wrong
- A. Decomposition of sulfuric acid takes place at a temperature (~ 850°C) in the presence of a catalyst such as platinum or certain metal oxides and SO2 is released.
- B. Strong acids also undergo hydrolysis as when dissolving sulfuric acid (H2SO4) in (mixed with) water— the dissolution is accompanied by hydrolysis to produce a hydronium ion (H3O+) and a bisulfate ion. However, hydrolysis doesn’t show that the acid has a higher affinity for water.
- C. Decomposition of water means that a water molecule is broken down to release hydrogen and oxygen gas. No such reaction takes place when sulphuric acid is added to water.
Q97. The question attached below belongs to the topic of phenols:
- A. Resorcinol
- B. Aspirin
- C. Picric acid✓
- D. Mesitol
Explanation: The structure shown above is of Picric acid.
Why the other options are wrong
- A. The shown image shows Picric Acid so this option is not correct
- B. The shown image shows Picric Acid so this option is not correct
- D. The shown image shows Picric Acid so this option is not correct
Q98. 30 grams of 2-propanol were mixed with excess acidified K2Cr2O7 and boiled under reflux for 20 minutes. The organic product was then collected by distillation. The yield of product was 75.0%. What is the mass of product produced?
- A. 1.74g
- B. 21.75g✓
- C. 2.74g
- D. 29 g
Explanation: To calculate the mass of the product produced, you can use the yield percentage. The yield percentage is calculated as follows: Yield (%) = Actual Yield / Theoretical Yield × 100 In this case, the yield is given as 75.0%, and mass of 2-propanol is 30 grams. The molecular formula of 2-propanol (isopropanol) is C3H8O. Molar mass of C3H8O = (3 * 12.01 g/mol) + (8 * 1.01 g/mol) + (1 * 16.00 g/mol) = 60.03 g/mol Theoretical Yield = (Mass of 2-propanol) × (Theoretical Yield / Molar Mass of 2-propanol) Theoretical Yield = (30 g) × (1 mol / 60.03 g) = 0.4999 mol Now, calculate the actual yield using the given yield percentage: Yield (%) = (Actual Yield / Theoretical Yield) × 100 75.0% = (Actual Yield / 0.4999 mol) × 100 Actual Yield = (75.0% / 100) × 0.4999 mol = 0.3749 mol Now, convert the actual yield from moles to grams using the molar mass of the product you expect to obtain. Actual Yield (grams) = 0.3749 mol × 60.03 g/mol = 22.51 g So, the mass of the product produced is approximately 22.51 grams, which is closest to option (b) 21.75g.
Why the other options are wrong
- A. According to given data, this option is incorrect.
- C. According to given data, this option is incorrect.
- D. According to given data, this option is incorrect.
Q99. Cl + e ----> Cl-ΔH = -348kJ/molThe value -348KJ/mol in this case will be:
- A. Ionization energy
- B. Electronegativity
- C. Electron affinity✓
- D. Entropy
- E. Free energy
Explanation: As it can be seen in the equation, electrons are gained by the element chlorine to form a negative ion (anion). The process in which electrons are gained is called electron affinity.
Why the other options are wrong
- A. Ionization energy is the energy required to remove an electron from a gaseous atom. Here, an electron is being added, not removed.
- B. Electronegativity refers to an atom's ability to attract shared electrons in a bond. This process does not involve forming a bond, but rather adding an electron to form an ion.
- D. Entropy measures the disorder or randomness in a system. It does not directly relate to the energy change associated with adding an electron to an atom.
- E. Gibbs free energy measures the maximum reversible work done by a thermodynamic system at constant temperature and pressure. It is not specifically about adding an electron to an atom.
Q100. H2S is an example of _ hydride.
- A. Ionic
- B. Covalent✓
- C. Complex
- D. Metallic
- E. Border-line hydride
Explanation: Covalent hydrides are formed when hydrogen reacts with other similar electronegative elements like Si, C,etc. H2S is a covalent hydride because the two elements used in the formation of this hydride are non-metals.
Why the other options are wrong
- A. Ionic hydrides are formed when hydrogen reacts with highly electropositive elements, typically metals, which is not the case with H2S.
- C. Complex hydrides involve metal salts with hydride anions and do not apply to H2S, which involves no metals.
- D. Metallic hydrides are formed with d- and f-block elements, which is not applicable here as sulfur is a non-metal.
- E. Borderline hydrides exhibit characteristics of both ionic and covalent hydrides, often involving metals like Be and Mg; H2S does not fit this category.
Q101. The formula of “rock salt” is:
- A. NaCl✓
- B. NaHCO3
- C. Na2CO3
- D. CuSO4
Explanation: Halite more commonly known as Rock salt is a mineral formed from sodium chloride. Its chemical formula is NaCl and this also includes other variations of salt such as common salt and table salt.
Why the other options are wrong
- B. This formula represents sodium bicarbonate, which is commonly known as baking soda. This compound is used primarily as a leavening agent in cooking and is not the chemical name for rock salt.
- C. This formula represents sodium carbonate, commonly known as washing soda or soda ash. It is widely used in detergents and for water softening and is not the chemical name for rock salt.
- D. This formula represents copper(II) sulfate, a blue crystalline solid that is used as a fungicide and an agricultural chemical. This compound contains copper and sulfur and is completely unrelated to rock salt.
Q102. Zwitter ion is formed when proton goes from:
- A. Amino to the carboxyl group
- B. Carboxyl to an amino group✓
- C. Carboxyl group only
- D. Amino group only
Explanation: Zwitter ion is a dipolar ion which is formed on the combination of a carboxyl group and an amino group. As a result, it is mostly formed by an amino acid. The carboxyl group in a zwitter ion carries a negative charge while the amine group carries a positive charge. There is an internal transfer of a hydrogen ion from the -COOH group to the -NH2 group to leave an ion with both a negative charge and a positive charge. This is called a zwitter ion. This is the form that amino acids exist even in the solid state.
Why the other options are wrong
- A. This would mean that the amino group (-NH₂) donates a proton, which is incorrect because the amino group accepts a proton in zwitterion formation.
- C. This is incorrect as the conversion of carboxyl to an amino group takes place.
- D. This is incorrect as the conversion of carboxyl to an amino group takes place.
Q103. For the following exothermic reaction, a decrease in temperature will shift the equilibrium towards: 2NO(g) + O2 (g) -> 2NO2 (g)
- A. Left
- B. The Point of Equilibrium
- C. Both Directions
- D. Right✓
Explanation: For an exothermic reaction like 2NO (g) + O2 (g) ⇌ 2NO2 (g), a decrease in temperature will shift the equilibrium towards the right. This shift helps to increase the temp as heat is released in exothermic reactions, as the reaction is exothermic in the forward direction. Therefore this option is correct.
Why the other options are wrong
- A. For an exothermic reaction like 2NO (g) + O2 (g) ⇌ 2NO2 (g), a decrease in temperature will shift the equilibrium towards the right. This shift helps to increase the temp as heat is released in exothermic reactions, as the reaction is exothermic in the forward direction. Therefore this option is correct.
- B. For an exothermic reaction like 2NO (g) + O2 (g) ⇌ 2NO2 (g), a decrease in temperature will shift the equilibrium towards the right. This shift helps to increase the temp as heat is released in exothermic reactions, as the reaction is exothermic in the forward direction. Therefore this option is correct.
- C. For an exothermic reaction like 2NO (g) + O2 (g) ⇌ 2NO2 (g), a decrease in temperature will shift the equilibrium towards the right. This shift helps to increase the temp as heat is released in exothermic reactions, as the reaction is exothermic in the forward direction. Therefore this option is correct.
Q104. What will be the product of the following reaction?
- A. A
- B. B
- C. C
- D. D✓
Explanation: Step 1: Starting compoundWe have p-cresol (4-methylphenol).Step 2: Reaction with CHCl₃/NaOHThis is the Reimer–Tiemann reaction.In this reaction, an aldehyde group –CHO gets introduced at the ortho position to the –OH group.So product A is o-formyl-p-cresol (4-methyl-2-hydroxybenzaldehyde).Step 3: Reaction with HCNAn aldehyde reacts with HCN to give a cyanohydrin.The –CHO group becomes –CH(OH)CN.So compound B is o-(CH(OH)CN)-p-cresol.Step 4: Hydrolysis with H₃O⁺On hydrolysis, –CN group converts to –COOH.So the final product C is o-(CH(OH)COOH)-p-cresol.Step 5: Match with given optionsLooking at the options:(a) has –CH₂COOH (wrong, no hydroxyl group)(b) also has –CH₂COOH (wrong)(c) has –CH(OH)COOH but with two methyls (wrong position)(d) has –CH(OH)COOH correctly at the ortho position to OH, with a para –CH₃ substituent (correct).
Why the other options are wrong
- A. Option A suggests a reaction product that does not involve the correct sequence of reactions or the correct functional group transformations.
- B. Option B presents an incorrect intermediate that might result from a misunderstanding of the nitrile hydrolysis step.
- C. this is not correctThis option shows the correct -CH(OH)COOH group, but the positions of the other groups on the benzene ring are different from the starting material. The reaction does not change the position of the methyl (CH_3) or hydroxyl (OH) groups.
Q105. The enthalpy of certain reactions at 273 K is -20.75 kJ. The enthalpy of the same reaction at 373 K (if heat capacities of reactants and products are the same) will be:
- A. -20.75 kJ✓
- B. -2075 kJ
- C. Zero
- D. -20.75 x 373/273 kJ
Explanation: As it is provided in the given statement that heat capacities of reactants and products are the same, therefore there will be no energy change in the reaction. By Kirchoff's Rule; ∆Cp=∆H2-H1/T2-T1∆Cp(T2-T1)=∆H2-H1As, ∆Cp= 0 , ∆H2=H1 , therefore;H2= -20.75KJ
Why the other options are wrong
- B. Calculations show enthalpy is -20.75 kJ not -2075kJ.
- C. Calculations show enthalpy is -20.75 kJ not zero.
- D. Calculations show enthalpy is -20.75 kJ not -20.75 × 373/273kJ.
Q106. How many atmospheres correspond to 1050 torr?
- A. 1.050
- B. 10.38
- C. 1.380✓
- D. 2.760
Explanation: In ancient times, the Torr was defined as a millimetre of Hg. So, as 1 atm = 760 mm Hg, therefore, 1 atm is also considered to be equal to 760 torrs. Now, we can calculate the atmospheres corresponding to 1050 torr, ∴ 1050 torr = 1050/760 atm = 1.38 atm
Q107. The mass of an electron is:
- A. 1.008 amu
- B. 1.009 amu
- C. 0.000550 amu✓
- D. 0.5500 amu
Explanation: The mass of an electron is approximately 0.000550 amu, which is much smaller compared to the masses of protons and neutrons (approximately 1 amu each). This small mass is due to the electron's relatively lower contribution to the overall mass of an atom. The incorrect options suggest masses closer to those of protons and neutrons, highlighting the importance of distinguishing between the masses of different subatomic particles.
Why the other options are wrong
- A. Incorrect Answer. This is approximately the mass of a proton or neutron, not an electron.
- B. Incorrect Answer. This value is close to that of a proton or neutron, not an electron.
- D. Incorrect Answer. This value is much too large for an electron and closer to the mass of a proton or neutron.
Q108. The rate of E1 reaction depends upon:
- A. Concentration of the nucleophile
- B. Concentration of the substrate as well as the alkyl halide
- C. Concentration of the substrate only✓
- D. None of these
Explanation: The E1 (elimination, unimolecular) reaction proceeds in two steps, with the first step—the formation of a carbocation— being the slow, rate-determining step. Since only the substrate (alkyl halide) is involved in this step, the rate of the reaction depends only on the concentration of the substrate.
Why the other options are wrong
- A. The nucleophile is not directly involved in the rate-determining step of an E1 reaction. Instead, E1 reactions involve the loss of a leaving group, followed by the formation of a double bond.
- B. The E1 (unimolecular elimination) reaction follows first-order kinetics, meaning the rate depends only on the substrate concentration. So, it does not depend on the concentration of alkyl halide.
- D. This option is incorrect as its rate depends on the concentration of substrate.
Q109. In which pair one has all Unpaired d orbitals while other have all paired d orbitals?
- A. Cu and Zn
- B. Cr and Fe
- C. Cr and Cu✓
- D. Mn and Co
Explanation: The correct answer is Cr and Cu. Chromium (Cr) has an electron configuration of [Ar] 3d5 4s1, which results in five unpaired electrons in its d orbitals. On the other hand, Copper (Cu) has an electron configuration of [Ar] 3d10 4s1, meaning all its d electrons are paired. The other options are incorrect because:Cu and Zn: Copper has unpaired electrons, and Zinc (Zn) has all paired electrons (3d10 4s2).Cr and Fe: Both Chromium and Iron have unpaired d electrons; Chromium has five unpaired and Iron has four unpaired.Mn and Co: Both Manganese and Cobalt have unpaired d electrons; Manganese has five unpaired and Cobalt has three unpaired.Thus, Cr and Cu is the only correct pair with one element having all unpaired d orbitals and the other all paired.
Why the other options are wrong
- A. This option is incorrect. Copper (Cu) has a configuration of [Ar] 3d10 4s1, meaning it has one unpaired electron in the 4s orbital, while zinc (Zn) is [Ar] 3d10 4s2 with all paired electrons in its d orbitals.
- B. This option is also incorrect. Chromium (Cr) has a configuration of [Ar] 3d5 4s1, resulting in five unpaired electrons in its d orbitals. Iron (Fe) has a configuration of [Ar] 3d6 4s2, which has four unpaired electrons, making both elements have unpaired d orbitals.
- D. This option is incorrect. Manganese (Mn) has a configuration of [Ar] 3d5 4s2, which means it has five unpaired electrons in its d orbitals. Cobalt (Co) has a configuration of [Ar] 3d7 4s2, leading to three unpaired electrons, making both elements have unpaired d orbitals.
Q110. Identify the type of isomerism:
- A. Chain Isomerism
- B. Position Isomerism✓
- C. Functional Group Isomerism
- D. Metamerism
- E. Optical Isomerism
Explanation: The type of isomerism in which a functional group is placed to different carbons in the organic compound is called position isomerism, which is what can be seen in the above diagram.
Why the other options are wrong
- A. Chain isomerism occurs when compounds with the same molecular formula have different arrangements of the carbon skeleton.Example: n-pentane and iso-pentane
- C. Functional group isomerism is observed when compounds have the same molecular formula but different functional groups.Example: alcohols and ethers with the same carbon number
- D. Metamerism involves isomers that have different alkyl groups on either side of a functional group, typically in compounds like ethers or amines.Example: Diethyl ether and methyl propyl ether
- E. Optical isomerism occurs in compounds that have chiral centers, leading to isomers that rotate plane-polarized light differently.Example: D- and L- forms of lactic acid
Q111. Nitrogen and phosphorus have 3 of their valence electrons unpaired because of:
- A. Auf bau principle
- B. Heisenberg's principle
- C. Hund’s rule✓
- D. Planck’s statement
- E. None of these
Explanation: Hund's rule states that every orbital in a subshell is singly occupied with one electron before any one orbital is doubly occupied, and all electrons in singly occupied orbitals have the same spin.
Why the other options are wrong
- A. The Aufbau principle states that electrons fill the lowest energy levels first before moving to higher energy levels. However, it does not explain why nitrogen and phosphorus specifically have three unpaired valence electrons.
- B. Heisenberg's uncertainty principle states that it is impossible to simultaneously determine the exact position and momentum of an electron. This principle is not directly related to the presence of unpaired valence electrons in nitrogen and phosphorus.
- D. It is unclear what "Planck's statement" refers to. If it is referring to Planck's quantum theory, it does not directly explain the presence of unpaired valence electrons in nitrogen and phosphorus.
- E. As Option C is the correct option, so, this option is incorrect.
Q112. The common name of the following aldehyde is:
- A. α - Methyl - Ɣ - Chloro Propionaldehyde
- B. β - Chloro - Ɣ - Methyl - Propionaldehyde
- C. β - Chloro - α - Methyl Propionaldehyde✓
- D. β - Methyl - α - Chloro Propionaldehyde
Explanation: Aldehydes take their name from their parent alkane chains. The -e is removed from the end and is replaced with -al. The aldehyde functional group is given the #1 numbering location and this number is not included in the name. For the common name of aldehydes start with the common parent chain name and add the suffix -aldehyde. Substituent positions are shown with Greek letters. When the -CHO functional group is attached to a ring the suffix -carbaldehyde is added, and the carbon attached to that group is C1. The alpha carbon is the carbon adjacent to the carbonyl group or the carbon having an oxygen atom linked to it via a double bond. Beta carbons are the carbons adjacent to the alphas excluding the carbon of the carbonyl group. Lastly, we name the side chains in alphabetical order as shown in the correct option where we have the Chloro group named earlier followed by the methyl group and not the order way around, again because the letter 'C' comes before the letter 'M'.
Why the other options are wrong
- A. Aldehydes take their name from their parent alkane chains. The -e is removed from the end and is replaced with -al. The aldehyde functional group is given the #1 numbering location and this number is not included in the name. For the common name of aldehydes start with the common parent chain name and add the suffix -aldehyde. Substituent positions are shown with Greek letters. When the -CHO functional group is attached to a ring the suffix -carbaldehyde is added, and the carbon attached to that group is C1. The alpha carbon is the carbon adjacent to the carbonyl group or the carbon having an oxygen atom linked to it via a double bond. Beta carbons are the carbons adjacent to the alphas excluding the carbon of the carbonyl group. Lastly, we name the side chains in alphabetical order as shown in the correct option where we have the Chloro group named earlier followed by the methyl group and not the order way around, again because the letter 'C' comes before the letter 'M'.
- B. Aldehydes take their name from their parent alkane chains. The -e is removed from the end and is replaced with -al. The aldehyde functional group is given the #1 numbering location and this number is not included in the name. For the common name of aldehydes start with the common parent chain name and add the suffix -aldehyde. Substituent positions are shown with Greek letters. When the -CHO functional group is attached to a ring the suffix -carbaldehyde is added, and the carbon attached to that group is C1. The alpha carbon is the carbon adjacent to the carbonyl group or the carbon having an oxygen atom linked to it via a double bond. Beta carbons are the carbons adjacent to the alphas excluding the carbon of the carbonyl group. Lastly, we name the side chains in alphabetical order as shown in the correct option where we have the Chloro group named earlier followed by the methyl group and not the order way around, again because the letter 'C' comes before the letter 'M'.
- D. Aldehydes take their name from their parent alkane chains. The -e is removed from the end and is replaced with -al. The aldehyde functional group is given the #1 numbering location and this number is not included in the name. For the common name of aldehydes start with the common parent chain name and add the suffix -aldehyde. Substituent positions are shown with Greek letters. When the -CHO functional group is attached to a ring the suffix -carbaldehyde is added, and the carbon attached to that group is C1. The alpha carbon is the carbon adjacent to the carbonyl group or the carbon having an oxygen atom linked to it via a double bond. Beta carbons are the carbons adjacent to the alphas excluding the carbon of the carbonyl group. Lastly, we name the side chains in alphabetical order as shown in the correct option where we have the Chloro group named earlier followed by the methyl group and not the order way around, again because the letter 'C' comes before the letter 'M'.
Q113. NH3 (amine) is an example of:
- A. Negative ligand
- B. Anionic ligand
- C. Neutral ligand✓
- D. Organic ligand
- E. Both Options A and B are correct.
Explanation: NH3 is a neutral ligand as it has no charge and can donate a lone pair of electrons to form a coordinate bond with a metal atom or ion.
Why the other options are wrong
- A. This option is not correct. A negative ligand is a ligand that has a negative charge.
- B. This option is also not correct. An anionic on hand is a ligand that has a negative charge.
- D. This option is also incorrect. An organic ligand is a ligand that contains carbon atoms in its structure.
- E. Option A and B both are correct so we choose this option
Q114. The formula of Plaster of Paris is:
- A. (CaSO4).1/2H2O✓
- B. (CaSO4).5H2O
- C. (CaSO4).7H2O
- D. (CaSO4).9H2O
Explanation: The chemical name of the Plaster of Paris is calcium sulphate hemihydrate because half a molecule of water is attached with calcium sulphate. The chemical formula of plaster of Paris is CaSO4.1/2H2O
Why the other options are wrong
- B. (CaSO4).5H2O is not formula of plaster of Paris.
- C. (CaSO4).7H2O is not formula of plaster of Paris.
- D. (CaSO4).9H2O is not formula of plaster of Paris.
Q115. Ionic, covalent and co-ordinate covalent bonds are simultaneously present in the molecular geometry of:
- A. Ammonia
- B. Ammonium hydroxide✓
- C. Hydrochloric acid
- D. Water
- E. Methane
Explanation: There are 3 covalent , 1 coordinate covalent bond in NH4+ ion, and 1 covalent bond in OH−. There is an ionic bond between NH4+ and OH-.So, this species simultaneously has 3 different types of bonds.
Why the other options are wrong
- A. Ammonia has a nitrogen atom bound with three hydrogen atoms by covalent bonds.
- C. Hydrochloric acid has ionic bonding between Hydrogen (H+) and chlorine(Cl-).
- D. Water has only covalent bonding between 2 hydrogen atoms and an oxygen atom.
- E. Methane also has 4 covalent bonds by which carbon atoms are bonded to 4 respective hydrogen atoms.
Q116. All amino acids contain the functional group:
- A. NH2✓
- B. CO2
- C. S2-
- D. Both A and B
Explanation: All amino acids contain an amino group (-NH2), a carboxyl group (-COOH), a hydrogen atom and a part where radical attaches.-CO2 is different from -COOH. -CO2 can be present in esters.
Why the other options are wrong
- B. CO2- can be present in esters not in amino acids.
- C. S²- is not present in amino acids.
- D. NH2 is present in amino acids but CO2 is not present in amino acids.
Q117. Dehydration of ethanol at 140 oC in the presence of concentrated H2SO4 gives:
- A. Ethene
- B. Ethane
- C. Ethyne
- D. Ether✓
Explanation: Dehydration of alcohol at 140°C gives etherreference # ftb 162
Why the other options are wrong
- A. When the temperature of about 180° C then it will give an alkenes otherwise it will give an ether as an product.
- B. Ethane is not a product of the dehydration of ethanol. Ethane is an alkane, meaning it has only single bonds between carbon atoms. It does not form directly from the dehydration process.
- C. Ethyne, commonly known as acetylene, is also not a product of the dehydration of ethanol. Ethyne is an alkyne with a triple bond between the two carbon atoms. It does not form directly from the dehydration process.
Q118. An ionic compound A+ B- is most likely to be formed when:
- A. The ionization energy of A is high and the electron affinity of B is low.
- B. The ionization energy of A is low and the electron affinity of B is high.✓
- C. The ionization energy of A and the electron affinity of B is high.
- D. The ionization energy of A and the electron affinity of B is low.
Explanation: The correct answer is Option B: The ionization energy of A is low and the electron affinity of B is high. This is because a low ionization energy allows A to easily lose an electron and form a cation, while a high electron affinity allows B to easily gain an electron and form an anion, facilitating the formation of an ionic compound A+ B-.Option A is incorrect because a high ionization energy and low electron affinity would not favor the formation of ions. Option C is incorrect because while a high electron affinity is favorable for B, a high ionization energy is not favorable for A. Option D is incorrect because while a low ionization energy is favorable for A, a low electron affinity is not favorable for B.
Why the other options are wrong
- A. A high ionization energy means A does not easily lose an electron to form a cation, and a low electron affinity means B does not easily gain an electron to form an anion. Therefore, A+ B- is unlikely to form under these conditions.
- C. While a high electron affinity is favorable for B to form an anion, a high ionization energy in A is not favorable for cation formation, making A+ B- formation unlikely.
- D. Low ionization energy in A is favorable for cation formation, but low electron affinity in B is not favorable for anion formation, making the formation of A+ B- unlikely.
Q119. SN2 reactions can be best carried out with:
- A. Primary alkyl halides✓
- B. Secondary alkyl halides
- C. Tertiary alkyl halides
- D. Both primary and tertiary alkyl halides
Explanation: SN2 reactions involve a nucleophilic attack on the electrophilic carbon, leading to the inversion of configuration. The reaction is sensitive to steric hindrance around the electrophilic center. Therefore, primary alkyl halides are most suitable for SN2 reactions as they present the least steric congestion, allowing for efficient backside attack by the nucleophile. In contrast, secondary alkyl halides present moderate steric hindrance, making SN2 reactions possible but less favorable compared to primary halides. Tertiary alkyl halides are too sterically hindered for SN2 reactions and instead undergo SN1 reactions. Thus, primary alkyl halides are the best choice for SN2 reactions.
Why the other options are wrong
- B. While secondary alkyl halides can undergo SN2 reactions, they do so more slowly than primary alkyl halides due to increased steric hindrance.
- C. Tertiary alkyl halides are highly hindered and typically undergo SN1 reactions instead of SN2 reactions.
- D. Only primary alkyl halides favor SN2 reactions due to minimal steric hindrance, while tertiary favor SN1.
Q120. Name the main product formed as a result of the following reactionH3C - (CH2)5 - CH3 ————> Product n-heptaneConditions: 480 - 550 C, 150 - 399 psi V2O5
- A. Benzene
- B. Toluene✓
- C. Xylene
- D. Cyclohexane
Explanation: The above reaction leads to cyclization of n-heptane followed by the aromatization of that cyclic ring, this forms toluene, option B is correct. Benzene is the wrong option because benzene has six carbon while n-heptane has 7 carbon atoms. Cyclohexane is also the wrong option for the same reason. Xylene has 8 carbon atoms while our reactant has 7 carbon atoms.
Q121. Reaction mechanism of alkanes with halogens is known as;
- A. Propagation
- B. Free radical substitution✓
- C. Addition
- D. Elimination
Explanation: Halogenation of alkanes means the substitution of a halogen atom(s) by the removal of one or more hydrogen atoms in the alkane. The mechanism of halogenations occurs in three steps: chain initiation, chain propagation, and chain termination.The order of reactivity of the halogens towards the halogenations reaction of alkanes as follows: F2> Cl2> Br2> I2.The iodination reaction is reversible as follows:CH4+I2⇌CH3−I+HI.
Why the other options are wrong
- A. The 2nd step of halogenation is known as propagation so this option is incorrect.
- C. In halogenation, the addition takes place but the mentioned step is free radical substitution
- D. This is not the correct option as the mention step is free radical substitution.
Q122. The correct statement for 3dₓ², 4dₓ², and 5dₓ² is:
- A. All three orbitals have different shapes and different energy levels
- B. All three orbitals have different shapes but the same principal quantum number
- C. All three orbitals have the same shape but different sizes.✓
- D. All three orbitals have the same shape and same size.
Explanation: (c) All three orbitals have the same shape but different sizes. (Correct Answer) – The shape of d orbitals remains constant, but their size increases with higher energy levels.
Why the other options are wrong
- A. (a) All three orbitals have different shapes and different energy levels. – Incorrect. All d orbitals have the same shape.
- B. (b) All three orbitals have different shapes but the same principal quantum number. – Incorrect. They have the same shape but different quantum numbers.
- D. (d) All three orbitals have the same shape and same size. – Incorrect. The size increases with increasing n value.
Q123. Which type of forces exist between iodine molecules
- A. Dipole-dipole forces
- B. Dipole-induced dipole forces
- C. Instantaneous dipole-induced dipole forces✓
- D. Ion dipole forces
Explanation: (C) Instantaneous dipole-induced dipole forces (Correct Answer) – London dispersion forces (also called Van der Waals forces) are the dominant forces between nonpolar molecules like I₂.
Why the other options are wrong
- A. (A) Dipole-dipole forces – Incorrect. Iodine (I₂) is nonpolar, so it does not have permanent dipole-dipole interactions.
- B. (B) Dipole-induced dipole forces – Incorrect. This occurs when a polar molecule induces a dipole in a nonpolar one, but iodine molecules are both nonpolar.
- D. (D) Ion dipole forces – Incorrect. These occur between ions and polar molecules, which is not the case here.
Q124. Which of the following catalyst is used in the Friedel craft reaction?
- A. ZnCl2
- B. KMnO4
- C. AlCl3✓
- D. V2O5
Explanation: Anhydrous Aluminum Chloride is the catalyst used in the Friedel-craft reaction.
Why the other options are wrong
- A. Zinc chloride (ZnCl2) is not used as a catalyst in the Friedel-Crafts reaction. It is not typically involved in this specific reaction.
- B. Potassium permanganate (KMnO4) is not a catalyst in the Friedel-Crafts reaction. It is an oxidizing agent and is commonly used in various oxidation reactions, but not in the Friedel-Crafts reaction.
- D. Vanadium pentoxide (V2O5) is not used as a catalyst in the Friedel-Crafts reaction. It is mostly used as a catalyst in other chemical processes, but not specifically in the Friedel-Crafts reaction.
Q125. The type of isomerism existing in a compound of molecular formula C2H6O is:
- A. Functional group✓
- B. Position
- C. Chain
- D. Metamerism
Explanation: In a compound with the molecular formula C2H6O, which corresponds to ethanol (CH3CH2OH) as well as dimethyl ether ( CH3-O-CH3), the type of isomerism that exists is functional group isomerism. Following groups of organic compounds are functional group isomers of each other;1- Alcohols and ethers2- Aldehydes and ketones3- Carboxylic acids and esters.
Why the other options are wrong
- B. Position isomerism is due to difference in position of same functional group on carbon chain. In a compound with the molecular formula C2H6O, which corresponds to ethanol (CH3CH2OH) as well as dimethyl ether ( CH3-O-CH3), the type of isomerism that exists is functional group isomerism
- C. Chain isomerism is due to difference in nature of the carbon carbon.In a compound with the molecular formula C2H6O, which corresponds to ethanol (CH3CH2OH) as well as dimethyl ether ( CH3-O-CH3), the type of isomerism that exists is functional group isomerism
- D. Metamerism is due to unequal distribution of carbon atoms on either side of functional group. In a compound with the molecular formula C2H6O, which corresponds to ethanol (CH3CH2OH) as well as dimethyl ether ( CH3-O-CH3), the type of isomerism that exists is functional group isomerism
Q126. Secondary alcohol is the product of reduction of which carbonyl compound?
- A. Option A✓
- B. Option B
- C. Option C
- D. Option D
Explanation: Reduction of ketones gives secondary alcohols. The acidic work-up converts an intermediate metal alkoxide salt into the desired alcohol via a simple acid base reaction.
Why the other options are wrong
- B. A secondary alcohol is the product of the reduction of a ketone and this is not a keto e therefore this is incorrect.
- C. A secondary alcohol is the product of the reduction of a ketone and this is not a keto e therefore this is incorrect.
- D. A secondary alcohol is the product of the reduction of a ketone and this is not a keto e therefore this is incorrect.
Q127. A diabetic person’s exhaled breath contains propanone. A student tries to test the diabetes by asking the person to bubble the reagent with his exhaled breath. Which of the following reagents would give a positive result?
- A. Aqueous Bromine
- B. Fehling’s reagent
- C. Tollen’s reagent
- D. Alkaline aqueous iodine✓
Explanation: Propanone contains the R-CO-CH3 group hence it gives a positive triiodomethane or iodoform test. Iodoform test is used to check the presence of carbonyl compounds with the structure R-CO-CH3 or alcohols with the structure R-CH(OH)-CH3 in a given unknown substance. The reaction of iodine, a base, and a methyl ketone gives a yellow precipitate along with an “antiseptic” smell.
Why the other options are wrong
- A. Bromine water is used to test for unsaturation (C=C double bonds).Propanone is a saturated compound (no C=C), so it does not react.
- B. Fehling’s test is used to detect reducing sugars and aldehydes.Ketones (like propanone) do not react, so this test is not suitable.
- C. Tollen’s test is used to detect aldehydes, not ketones.Propanone (a ketone) does not react, so it won’t give a positive test.
Q128. The enthalpy change accompanying the gain of an electron by a neutral gaseous atom to form a negative ion is called:
- A. Ionization potential
- B. Electronegativity
- C. Electron affinity✓
- D. Lattice energy
- E. Potential energy
Explanation: When an electron is added to a neutral gaseous atom to convert it into a negative ion, the enthalpy change accompanying the process is called Electron affinity enthalpy. Ionization potential, in chemistry, is the amount of energy required to remove an electron from an isolated atom or molecule. Electronegativity is a measure of the tendency of an atom to attract a bonding pair of electrons. Lattice energy is defined as the energy required to separate a mole of an ionic solid into gaseous ions. Potential energy is energy that is stored – or conserved - in an object or substance.
Why the other options are wrong
- A. Option A is wrong as the ionization potential, in chemistry, is the amount of energy required to remove an electron from an isolated atom or molecule.
- B. Option B is wrong as the electronegativity is a measure of the tendency of an atom to attract a shared pair of electrons.
- D. Option D is wrong as the lattice energy is defined as the energy required to separate a mole of an ionic solid into gaseous ions.
- E. Option E is wrong as the potential energy is energy that is stored or conserved in an object or a substance.
Q129. Which of the following statements is NOT true for the first law of thermodynamics?
- A. Total energy of the system and surroundings is conserved
- B. Energy can neither be created nor destroyed
- C. The first law is synonymous with the law of conservation of energy
- D. Total energy of the system is increasing✓
Explanation: The first law of thermodynamics, also known as the law of conservation of energy, asserts that the total energy within an isolated system is constant. Energy may be transformed from one form to another or transferred between the system and its surroundings, but it cannot be created or destroyed. Therefore, the statement in Option D is incorrect as it contradicts this fundamental principle by suggesting that the total energy of the system is increasing.Options A, B, and C correctly reflect the principles of the first law of thermodynamics, emphasizing the conservation of energy and its equivalence to the law of conservation of energy.
Why the other options are wrong
- A. This statement is true. The first law of thermodynamics, also known as the law of conservation of energy, states that the total energy within an isolated system, encompassing both the system and its surroundings, remains constant. Energy can change forms or be transferred, but the total amount remains conserved.
- B. This statement is true and is a fundamental aspect of the first law of thermodynamics. Energy cannot be created or destroyed, only transformed from one form to another, maintaining the overall energy balance within the system.
- C. This statement is true. The first law of thermodynamics is essentially the same as the law of conservation of energy, emphasizing that energy is conserved in any physical or chemical process.
Q130. According to the law of mass action, "The rate of chemical reaction" is proportional to the:
- A. The Amount of product formed
- B. Product of the molar concentration of the reactant✓
- C. The initial concentration of reactant
- D. Catalyst
Explanation: The law of mass action states that reaction rate depends on how frequently reactant molecules collide. This frequency increases with their molar concentrations, so the rate is proportional to their product. Thus, option B correctly describes the law of mass action.
Why the other options are wrong
- A. This option is incorrect because the law of mass action does not directly relate to the total amount of product formed, but rather to the concentrations of the reactants.
- C. This option is incorrect because the law of mass action involves the concentrations of both reactants and products at any point in time, not just the initial concentrations.
- D. This option is incorrect because a catalyst affects the rate of a reaction but does not appear in the expression of the law of mass action, which focuses solely on reactant and product concentrations.
Q131. If the reaction, P + Q → R + S, is described as being of zero-order with respect to P, it means that:
- A. P is a catalyst in this reaction
- B. No P molecules possess sufficient energy to react
- C. The concentration of P does not change during the reaction
- D. The rate of reaction is independent of the concentration of P✓
- E. The rate of reaction is proportional to the concentration of Q
Explanation: If the order of reaction with respect to P is 0 (zero), this means that the concentration of P doesn't affect the rate of reaction. Mathematically, any number raised to the power of zero (x0) is equal to 1. That means that that particular term disappears from the rate equation.
Why the other options are wrong
- A. P is a reactant in this reaction, not a catalyst. A catalyst is a substance that speeds up a reaction without being consumed, which is not the case for P.
- B. This statement is incorrect because the reaction occurs, indicating that P molecules do possess sufficient energy for effective collisions and to form products.
- C. While the rate is independent of P's concentration, the concentration of P actually decreases as it is consumed in the reaction.
- E. This cannot be determined from the information given. The dependence on Q's concentration requires experimental data to establish the reaction order with respect to Q.
Q132. In which of the following nitrogen compounds, does N has the highest oxidation state?
- A. NH2OH
- B. N2H4
- C. HNO3✓
- D. NH3
Explanation: HNO3 has the highest oxidation state of nitrogen atom:+1+x+(-6)=0x=+5In NH3, N2H4, and NH2OH, the oxidation states, when calculated the same way, are 3-, 2+, and 1+ respectively.
Why the other options are wrong
- A. N=-1
- B. The oxidation number of N in N2H4 is -2.The total charge of the molecule is zero since it is neutral. Each hydrogen atom has an oxidation number of +1 so the four H atoms contribute a total charge of +4. Hence, the oxidation number of the two N atoms must be -2 for the total charge to be zero.
- D. X+3(+1)=0X+3=0X=-3Therefore oxidation state of N in NH3 is -3
Q133. Ketones can be made by oxidation of:
- A. Aldehydes
- B. Primary Alcohols
- C. Secondary Alcohols✓
- D. Tertiary Alcohols
Explanation: Option A; aldehydes oxidize into carboxylic acids.Option B; primary alcohols oxidize into aldehydes and then to carboxylic acids.Option C; secondary alcohols oxidize into ketones.Option D; tertiary alcohols are resistant to oxidation.
Why the other options are wrong
- A. Option A; aldehydes oxidize into carboxylic acids.
- B. Option B; primary alcohols oxidize into aldehydes and then to carboxylic acids.
- D. Option D; tertiary alcohols are resistant to oxidation.
Q134. Which type of reaction takes place when a carbonyl compound is treated with a mixture of NaCN and an acid?
- A. Electrophilic addition reaction
- B. Substitution reaction
- C. Nucleophilic addition reaction✓
- D. Displacement reaction
Explanation: The given scenario is an example of a nucleophilic addition reaction, as the reactant, CN- is a nucleophile which adds across the carbonyl bond.Option A describes reactions undergone by alkenes, where an electrophile is added across the carbon-carbon double bond.Option B describes a reaction where one group of atoms is replaced by another group of atoms, but this is not the case here.Option D describes a reaction in which one element is replaced by another element in a compound.
Why the other options are wrong
- A. Carbonyl compounds (aldehydes and ketones) do not undergo electrophilic addition because the carbonyl carbon is electron-deficient, making it susceptible to nucleophiles, not electrophiles.
- B. In a substitution reaction, one atom or group is replaced by another. However, in this case, the cyanide ion (CN⁻) adds to the carbonyl carbon rather than replacing a group.
- D. Displacement reactions typically involve the replacement of one element by another, which does not happen in this reaction.
Q135. A body starts sliding on a rough horizontal surface with a speed of 10 m/s. If the coefficient of friction is 0.2, find the distance traveled by the body before coming to rest. (g = 10m/s)
- A. 15 m
- B. 25 m✓
- C. 35 m
- D. 40 m
- E. 55 m
Explanation: Given that: v = 10 and u = 0.2 and g = 10 Solution = Using F = μN then, = μmg (here N = mg) So from above (ma = μmg); we got a = μg Now a = 0.2×10 = 2 m/s2Now using equation of motion V2=u2+2as 0 = 10×10 +2×2×s In solving it, we got s = 100/4 = 25 m Hence we get the correct answer.
Why the other options are wrong
- A. This is not correct as per explanations and calculations
- C. This is not correct as per explanations and calculations
- D. This is not correct as per explanations and calculations
- E. This is not correct as per explanations and calculations
Q136. Coal and petrol are stores of chemical energy when are burnt, chemical energy is converted into heat energy i.e chemical energy = heat energy + _:
- A. Electrical energy
- B. Losses✓
- C. Gains
- D. Wind energy
- E. Nothing
Explanation: When coal or petrol is burned, the chemical energy stored in the fuel is primarily converted into heat energy. However, not all of this energy conversion is perfectly efficient; some energy is inevitably lost to the surroundings as waste heat, which is why 'Losses' is the correct answer. Electrical energy is not directly produced from combustion without additional equipment. Gains are incorrect because energy is not gained but redistributed with losses. Wind energy is unrelated to burning fuels. 'Nothing' is incorrect because energy transformations usually accompany some degree of energy loss.
Why the other options are wrong
- A. Electrical energy is not a direct result of burning coal or petrol; it requires a generator or similar device to be produced.
- C. The energy conversion process in burning coal or petrol does not lead to a net energy gain but rather a redistribution of energy forms with some losses.
- D. Wind energy is derived from atmospheric conditions and not from burning fuels like coal or petrol.
- E. This option is incorrect because energy transformations typically involve some loss, often as waste heat.
Q137. Full wave bridge rectifier uses:
- A. One diode
- B. Two diodes
- C. Three diodes
- D. Four diodes✓
Explanation: Full wave bridge rectifier uses four diodes. However, centre tap transformer uses two diodes.
Why the other options are wrong
- A. A full wave rectifier cannot be implemented using only one diode. A diode is a semiconductor device that allows current to flow in one direction and blocks it in the opposite direction. For a full wave rectification, which means converting an AC (alternating current) signal into a pulsating DC (direct current) signal, we need to utilize both the positive and negative cycles of the AC signal. A single diode can only rectify either the positive or the negative half-cycle, not both.
- B. A full wave rectifier typically uses two diodes arranged in a bridge configuration called a "bridge rectifier" or "full-wave bridge rectifier." This configuration allows both the positive and negative halves of the AC signal to be rectified, resulting in a pulsating DC output.
- C. A configuration with three diodes cannot produce full wave rectification. While it is possible to design various rectifier circuits with three diodes (such as center-tapped rectifiers), these configurations typically provide half-wave rectification rather than full wave.
Q138. During adiabatic expansion internal energy decreases by 2J, then work done in this process is:
- A. 2J✓
- B. 1J
- C. -1J
- D. -2J
Explanation: The work done during adiabatic expansion can be calculated using the First Law of Thermodynamics, which states that the change in internal energy (ΔU) is equal to the heat added to the system (Q) minus the work done by the system (W). Since this is an adiabatic process, there is no heat added or removed from the system (Q=0). Therefore, ΔU = -2 J (as the internal energy decreases by 2J).Thus, W = -ΔU = -(-2 J) = 2 J. The rest options have incorrect values
Why the other options are wrong
- B. The work done during adiabatic expansion can be calculated using the First Law of Thermodynamics, which states that the change in internal energy (ΔU) is equal to the heat added to the system (Q) minus the work done by the system (W). Since this is an adiabatic process, there is no heat added or removed from the system (Q=0). Therefore, ΔU = -2 J (as the internal energy decreases by 2J).Thus, W = -ΔU = -(-2 J) = 2 J.
- C. The work done during adiabatic expansion can be calculated using the First Law of Thermodynamics, which states that the change in internal energy (ΔU) is equal to the heat added to the system (Q) minus the work done by the system (W). Since this is an adiabatic process, there is no heat added or removed from the system (Q=0). Therefore, ΔU = -2 J (as the internal energy decreases by 2J).Thus, W = -ΔU = -(-2 J) = 2 J.
- D. The work done during adiabatic expansion can be calculated using the First Law of Thermodynamics, which states that the change in internal energy (ΔU) is equal to the heat added to the system (Q) minus the work done by the system (W). Since this is an adiabatic process, there is no heat added or removed from the system (Q=0). Therefore, ΔU = -2 J (as the internal energy decreases by 2J).Thus, W = -ΔU = -(-2 J) = 2 J.
Q139. A mass has constant acceleration, what is true about the force applied on it?
- A. Constantly increasing
- B. Constant but not zero✓
- C. Is directly proportional to square of displacement
- D. Is directly proportional to velocity
Explanation: According to F=ma, acceleration and force are both directly proportional to each other. If acceleration is constant then the force applied on the object will also be constant.
Why the other options are wrong
- A. Acceleration happens because there is force applied to the object, only if the force is constant, we have constant acceleration. So option A is incorrect.
- C. If the displacement of an object is proportional to the square of the time taken then the body is moving with uniformly accelerated motion as it will follow Newton's second equation of motion for a particular initial velocity which can be given bys=ut+1/2at2.
- D. The force acting on a body of constant mass is directly proportional to its acceleration which is in turn the rate of change of velocity so force is directly proportional to the rate of change in velocity.
Q140. If the body is rotating with uniform angular velocity, then its torque is:
- A. Zero✓
- B. 90
- C. 1
- D. -1
Explanation: Torque will be zero because the force on the object is zero, since it is not accelerating. And also if the body is at rest or rotating with uniform angular velocity the angular acceleration will be zero in this case the torque acting on a body will be zero.Torque is given by solution i.e. torque = r.F sin (theta)Here force = maAcceleration is given by change in velocity/timeIf the change in velocity is zero, acceleration is zero, force is zero, thus torque is also zero. Any other value is not remotely possible
Why the other options are wrong
- B. As per the solution, this option is incorrect.
- C. As per the solution, this option is incorrect.
- D. As per the solution, this option is incorrect.
Q141. A battery whose emf is 40 V has an internal resistance of 5 Ohms. If this battery is connected to a 15 Ohms resistor ‘R’, what will be the voltage drop across ‘R’:
- A. 10 V
- B. 30 V✓
- C. 40 V
- D. 50 V
- E. 70 V
Explanation: 40 = I x (15+ 5) 40= I x 20 I = 40/20 I= 2 AVoltage drop across resistor R V= IR V= 2 x 15 V= 30 V (hence B is the correct option)
Why the other options are wrong
- A. According to given data, this option is incorrect as explained below. Total voltage= current x total resistance 40 = I x (15+ 5) 40= I x 20 I = 40/20 I= 2 AVoltage drop across resistor R V= IRV= 2 x 15 V= 30 V (hence B is the correct option)
- C. According to given data, this option is incorrect as explained below. Total voltage= current x total resistance 40 = I x (15+ 5) 40= I x 20 I = 40/20 I= 2 AVoltage drop across resistor R V= IRV= 2 x 15 V= 30 V (hence B is the correct option)
- D. According to given data, this option is incorrect as explained below. Total voltage= current x total resistance 40 = I x (15+ 5) 40= I x 20 I = 40/20 I= 2 AVoltage drop across resistor R V= IRV= 2 x 15 V= 30 V (hence B is the correct option)
- E. According to given data, this option is incorrect as explained below. Total voltage= current x total resistance 40 = I x (15+ 5) 40= I x 20 I = 40/20 I= 2 AVoltage drop across resistor R V= IRV= 2 x 15 V= 30 V (hence B is the correct option)
Q142. Two capacitors C1=3 uF and C2=6 uF are in series across a 90 volts D.C. supply. The total capacitance is given by:
- A. 9 uF
- B. 2 uF✓
- C. 10 uF
- D. 90 uF
- E. 5 uF
Explanation: 1/C1 + 1/C2 = 1/C⅓ + ⅙ = 1/C2 + 1 /6 = 1/C3/6 = 1/C½ =1 /CC = 2 uF
Why the other options are wrong
- A. 1/Ceq=1/C1+1/C2=1/3F+1/6F=1/2FCeq =2F
- C. 1/Ceq=1/C1+1/C2=1/3F+1/6F=1/2FCeq =2F
- D. 1/Ceq=1/C1+1/C2=1/3F+1/6F=1/2FCeq =2F
- E. 1/Ceq=1/C1+1/C2=1/3+1/6=1/2Ceq =2uF
Q143. The process of natural decay of some heavy nuclides is because of the phenomenon:
- A. Emission Spectra
- B. Nuclear fusion
- C. Nuclear fission
- D. Radioactivity✓
Explanation: Radioactivity is the spontaneous emission of radiation in the form of particles or high-energy photons resulting from a nuclear reaction. It is also known as radioactive decay, nuclear decay, nuclear disintegration, or radioactive disintegration. Alpha, beta, and gamma decay are three common radioactivity processes
Why the other options are wrong
- A. Emission Spectra : The emission spectrum of a chemical element or chemical compound is the spectrum of frequencies of electromagnetic radiation emitted due to an electron making a transition from a high energy state to a lower energy state. The photon energy of the emitted photon is equal to the energy difference between the two states.
- B. Nuclear fusion :Nuclear fusion is a reaction in which two or more atomic nuclei are combined to form one or more different atomic nuclei and subatomic particles. The difference in mass between the reactants and products is manifested as either the release or absorption of energy.
- C. Nuclear fission: Nuclear fission is a reaction in which the nucleus of an atom splits into two or more smaller nuclei. The fission process often produces gamma photons, and releases a very large amount of energy even by the energetic standards of radioactive decay.
Q144. Which of the following statement shows that no work is done?
- A. Pushing a car to start it moving
- B. Lifting the weights.
- C. The moon Orbiting the earth.✓
- D. Writing an essay on a page.
Explanation: When the moon revolves around the earth, the displacement is normal to the direction of force on the moon. Therefore no work is done by the moon.Work is the dot product of force and displacement.W=F.dcos theta
Why the other options are wrong
- A. You're applying a force to the car, and the car is moving in the direction of the force. This is work.
- B. You're applying an upward force to the weights, and they are moving upwards. This is work.
- D. You're applying a force to the pen or pencil, and it's moving across the page. This is work.
Q145. The sum of all forms of molecular energies (kinetic and potential) of a substance is termed as:
- A. Elastic energy
- B. Absolute energy
- C. Internal energy✓
- D. Heat energy
Explanation: Elastic energy is a form of potential energy. Absolute energy does not exist. By definition, Internal energy is the sum of total kinetic and potential energy as defined in 1st law of thermodynamics.
Why the other options are wrong
- A. Elastic energy refers to the potential energy stored in an object when it is deformed under stress but then returns to its original shape once the stress is removed. This type of energy is associated with materials that exhibit elastic properties, such as springs or rubber bands. It is not directly related to molecular energies or the sum of kinetic and potential energies in a substance.
- B. There isn't a widely recognised concept of "absolute energy" in physics. Energy measurements typically refer to specific forms of energy or total energy within a system. Therefore, this option doesn't accurately describe the concept referred to in the question.
- D. Heat energy refers specifically to the transfer of thermal energy between two bodies due to a temperature difference. It is a form of energy transfer, not a property of a substance itself. While heat energy can contribute to changes in a substance's internal energy, it does not encompass the total internal energy of the substance, which includes both kinetic and potential molecular energies.
Q146. Full wave bridge rectifier uses:
- A. One diode
- B. Two diodes
- C. Three diodes
- D. Four diodes✓
Explanation: Full wave bridge rectifier uses four diodes. However, centre tap transformer uses two diodes.
Why the other options are wrong
- A. A full wave rectifier cannot be implemented using only one diode. A diode is a semiconductor device that allows current to flow in one direction and blocks it in the opposite direction. For a full wave rectification, which means converting an AC (alternating current) signal into a pulsating DC (direct current) signal, we need to utilize both the positive and negative cycles of the AC signal. A single diode can only rectify either the positive or the negative half-cycle, not both.
- B. A full wave rectifier typically uses two diodes arranged in a bridge configuration called a "bridge rectifier" or "full-wave bridge rectifier." This configuration allows both the positive and negative halves of the AC signal to be rectified, resulting in a pulsating DC output.
- C. A configuration with three diodes cannot produce full wave rectification. While it is possible to design various rectifier circuits with three diodes (such as center-tapped rectifiers), these configurations typically provide half-wave rectification rather than full wave.
Q147. Which of the following losses in a transformer is zero even at full load?
- A. A: Eddy current loss
- B. B: Core loss
- C. C: Copper loss
- D. D: Friction loss✓
Explanation: The correct answer is D: Friction loss. Transformers are static devices and do not have moving parts; therefore, they do not experience friction losses under any circumstances. Option A (Eddy current loss) and Option B (Core loss) are incorrect because they are inherent to the operation of transformers due to magnetic fields and do not disappear at full load. Option C (Copper loss) is incorrect as it is dependent on the electrical current flowing through the windings and varies with load, hence it is not zero at full load.
Why the other options are wrong
- A. Eddy current losses are caused by circulating currents induced in the core of a transformer. These losses are present whenever the transformer is operational and do not become zero at full load.
- B. Core losses consist of both hysteresis and eddy current losses, which occur in the transformer core due to alternating magnetic fields and are not zero at full load.
- C. Copper losses are due to the resistance in the windings of the transformer and increase with load, hence they are not zero at full load.
Q148. Object A has a charge of 15 mC, and object B has a charge of 10 mC. Which statement is true about the electric forces on the objects?
- A. FAB = -3 FBA
- B. FAB = - FBA✓
- C. 3 FAB = - FBA
- D. -3 FAB = 2 FBA
Explanation: Option B is correct option.
Why the other options are wrong
- A. This statement suggests that the force exerted by object A on object B (FAB) is three times the force exerted by object B on object A (FBA) but in the opposite direction. This would imply that the magnitude of the force exerted by object A on object B is three times greater than the magnitude of the force exerted by object B on object A, which is not true based on Coulomb's law. Coulomb's law states that the magnitude of the force between two charges is directly proportional to the product of their charges and inversely proportional to the square of the distance between them. Additionally, the forces act in the direction of the line joining the charges. Therefore, option A is incorrect.
- C. This statement suggests that the magnitude of the force exerted by object A on object B (FAB) is three times the magnitude of the force exerted by object B on object A (FBA), but in the opposite direction. This contradicts Coulomb's law, which states that the magnitude of the forces between two charges is the same. Therefore, option C is incorrect.
- D. This statement suggests a specific numerical relationship between the forces FAB and FBA, which is not consistent with Coulomb's law. Coulomb's law does not dictate a specific numerical relationship between the forces on the charges based solely on their magnitudes. Therefore, option D is incorrect.
Q149. A loop of radius 1 m is placed on an incline of 60 degree with a magnetic field of 100 T. The corresponding flux will be:
- A. 314 Wb
- B. 107 Wb
- C. 157 Wb✓
- D. 435 Wb
Explanation: Magnetic flux formula: flux = BA cosθB = Magnetic Field A = areaThe angle is the angle between a perpendicular vector to the area and the magnetic field Φ = (100) 12 cos (60°) = (100) 3.1410.5 = 157
Why the other options are wrong
- A. Magnetic flux = BA cosθ =100* area of the loop*cos 60 = (100)(3.14)(1) cos 60 = 157 WbHence, option C is the correct option
- B. Magnetic flux = BA cosθ =100* area of the loop*cos 60 = (100)(3.14)(1) cos 60 = 157 WbHence, option C is the correct option
- D. Magnetic flux = BA cosθ =100* area of the loop*cos 60 = (100)(3.14)(1) cos 60 = 157 WbHence, option C is the correct option.
Q150. A vector such as the velocity of a body undergoing uniform translational motion, which can be displaced parallel to itself and applied to any point known as:
- A. Unit vector
- B. Free vector✓
- C. Null vector
- D. Position vector
- E. Resultant vector
Explanation: Option B is the correct answer because a free vector is one whose action is not confined or associated with a unique line in space. For a body in uniform translational motion, the velocity of any point in the body may be taken as a vector and this vector will equally well describe the velocity of all points in the body. Hence, the velocity of such a body may be represented by a free vector.
Why the other options are wrong
- A. A vector whose magnitude is one is called a unit vector.
- C. A directionless vector whose magnitude is zero is called a null vector.
- D. A position vector is defined as a vector that symbolizes either the position or the location of any given point concerning any arbitrary reference point.
- E. A resultant vector is defined as a single vector that produces the same effect as is produced by a number of vectors collectively.
Q151. A special class of waves that does not need a material medium for their propagation are called
- A. Electric waves
- B. Magnetic waves
- C. Electromagnetic waves✓
- D. Sound waves
- E. Earthquake's shock waves
Explanation: Electromagnetic waves do not require a medium for travel since they are not transmitted by the vibration of particles. The waves are generated by the oscillation of electric and magnetic fields which can exist anywhere.Electric waves do not isolatedly exist rather they depend on the magnetic field to form EM waves.A sound wave is a pattern of disturbance caused by the movement of energy traveling through a medium (such as air, water, or any other liquid or solid ).Seismic waves are usually generated by movements of the Earth's tectonic plates but may also be caused by explosions, volcanoes, and landslides. When an earthquake occurs shockwaves of energy, called seismic waves, are released from the earthquake focus.A changing magnetic field will induce a changing electric field and vice-versa—the two are linked. These changing fields form electromagnetic waves. Electromagnetic waves differ from mechanical waves in that they do not require a medium to propagate.
Why the other options are wrong
- A. Electromagnetic waves are the type of waves that do not require a material medium for their propagation, and they include electric and magnetic components.Electromagnetic waves encompass a broad spectrum, including radio waves, microwaves, infrared waves, visible light, ultraviolet waves, X-rays, and gamma rays. These waves are characterized by oscillating electric and magnetic fields perpendicular to each other and to the direction of wave propagation.
- B. rather than "magnetic waves," the more accurate term to describe waves that do not require a material medium is "electromagnetic waves," emphasizing both the electric and magnetic components of the oscillating fields.
- D. Sound waves do require a material medium for their propagation. They are a type of mechanical wave, and their transmission involves the vibration of particles in a material medium, such as air, water, or solids.
- E. All these seismic waves are mechanical waves and require a material medium to propagate. They travel through the Earth, causing it to shake during an earthquake. They cannot propagate through a vacuum.
Q152. Minimum frequency below which no electrons are emitted from the metal surface is called _ frequency.
- A. Minimum
- B. Angular
- C. Maximum
- D. Threshold✓
Explanation: The correct answer is the 'threshold frequency', which is the minimum frequency of electromagnetic radiation necessary to dislodge electrons from the surface of a metal. This concept is fundamental to the photoelectric effect, where no electrons are emitted if the incident light's frequency is below this threshold, regardless of its intensity. The other options, 'minimum', 'angular', and 'maximum', either lack specificity or pertain to different contexts within physics.
Why the other options are wrong
- A. Option A is incorrect because 'minimum frequency' is a vague term and does not specifically refer to the frequency needed to cause photoelectric emission.
- B. Option B is incorrect because 'angular frequency' relates to rotational systems and is not used in the context of photoelectric emission in metals.
- C. Option C is incorrect because 'maximum frequency' would imply an upper limit, which is not relevant to the emission of electrons from a metal surface.
Q153. If during circular motion, tangential velocity of a body becomes double, then centripetal force becomes:
- A. Double
- B. One half
- C. Four times✓
- D. One fourth
Explanation: Fc= mv^2/ rF is directly proportional to the square of the linear velocity. If velocity doubles then Fc will quadruple.
Why the other options are wrong
- A. This is not correct.Fc= mv^2/ rF is directly proportional to the square of the linear velocity. If velocity doubles then Fc will quadruple.
- B. This is not correct.Fc= mv^2/ rF is directly proportional to the square of the linear velocity. If velocity doubles then Fc will quadruple.
- D. This is not correct.Fc= mv^2/ rF is directly proportional to the square of the linear velocity. If velocity doubles then Fc will quadruple.
Q154. A body having translatory motion possesses _ and _. In the same way a body having rotatory motion possesses _ and _.
- A. None of them
- B. Linear velocity... Linear momentum... Angular velocity... Angular momentum✓
- C. Linear momentum... Angular momentum... Linear velocity... Angular velocity
- D. Angular velocity... Angular momentum... Linear momentum... Linear velocity
Explanation: The correct answer is: Linear velocity... Linear momentum... Angular velocity... Angular momentum.In translatory motion, all points of a body move uniformly in a single direction, involving linear properties such as linear velocity and linear momentum. This type of motion does not change the orientation of the object.In contrast, rotatory motion occurs when a body rotates around its own axis, involving angular properties like angular velocity and angular momentum. For example, the Earth's rotation about its axis is a type of rotatory motion.All options except B do not properly align the motion types with their respective properties, which is why they are incorrect.
Why the other options are wrong
- A. This option is incorrect as both translatory and rotatory motions have specific properties associated with them.
- C. Incorrect. The properties are mismatched with the types of motion. Translatory motion should be associated with linear properties, and rotatory with angular properties.
- D. Incorrect. Angular and linear properties are swapped for the types of motion they should be associated with.
Q155. When photons are incident on a metal, electrons are emitted. The process is called:
- A. Photoelectric effect✓
- B. Pair production
- C. X-ray production
- D. Gamma ray production
- E. Radioactive capture
Explanation: Photoelectric effect, a phenomenon in which electrically charged particles are released from or within a material when it absorbs electromagnetic radiation. The effect is often defined as the ejection of electrons from a metal plate when light falls on it.
Why the other options are wrong
- B. Pair production involves a photon interacting with a nucleus or an electron to create an electron-positron pair. This requires a photon energy of at least 1.02 MeV and is not related to the emission of electrons due to photon interaction with a metal surface.
- C. X-ray production typically occurs when high-energy electrons strike a material and generate X-rays. Although X-rays can cause electrons to be emitted from a material, the process of generating X-rays is distinct from the photoelectric effect.
- D. Gamma ray production involves the emission of high-energy photons from nuclear processes. While gamma rays can interact with materials to cause electron emissions, this process is not the same as the photoelectric effect.
- E. Radioactive capture, or radiative capture, is a process where a nucleus captures a particle, often leading to nuclear reactions. It does not describe the emission of electrons from a metal due to incident photons.
Q156. A disc, a hoop, and a sphere of the same mass and radius are rolled down from a frictionless, inclined plane. Which has a greater speed on reaching the ground?
- A. Disc
- B. Loop
- C. Sphere✓
- D. All have the same speed
Explanation: The sphere has most of its mass near the axis of rotation, so it will have the smallest moment of inertia and will reach the ground first.The disc has its mass uniformly distributed, so will have a greater moment of inertia and will arrive second.The hoop has all its mass concentrated away from the center, so will have the greatest moment of inertia. It will arrive last, but will then travel farther away on the horizontal plane than the other shapes, as it will have stored more of the original potential energy in the form of rotational energy.
Why the other options are wrong
- A. The sphere has the greatest speed on reaching the ground.
- B. The sphere has the greatest speed on reaching the ground. The shape of loop is as follows;
- D. The sphere has the greatest speed on reaching the ground.
Q157. Two unequal resistances are connected parallel across a battery. Which of the following statements is true?
- A. Same current will flow through both resistances
- B. Current through smaller resistance is higher✓
- C. Current through larger resistance is higher
- D. Current can be higher in any resistance depending on emf of the cell
Explanation: Option A: The current cannot be the same through both resistances, because the resistances are different. Option B: The current through the smaller resistance is higher. In a parallel circuit, the voltage across each resistor is the same, but the current through each resistor is different. The current is inversely proportional to the resistance, so the current through the smaller resistance will be higher than the current through the larger resistance. Option C: The current cannot be the same through both resistances, because the resistances are different. Option D: The current cannot be higher through the larger resistance, because the current is inversely proportional to the resistance. The current cannot be higher in any resistance depending on the emf of the cell, because the emf of the cell only determines the voltage across the resistors, not the current through the resistors.
Why the other options are wrong
- A. The current cannot be the same through both resistances, because the resistances are different.
- C. The current cannot be the same through both resistances, because the resistances are different.
- D. The current cannot be higher through the larger resistance, because the current is inversely proportional to the resistance. The current cannot be higher in any resistance depending on the emf of the cell, because the emf of the cell only determines the voltage across the resistors, not the current through the resistors.
Q158. The ratio of wavelengths of the last line of the Balmer series and the last line of the Lyman series is:
- A. 0.5
- B. 2
- C. 1
- D. 4✓
Explanation: The correct option is 4. The following is the correct solution:
Why the other options are wrong
- A. This option suggests that the ratio between wavelengths is 0.5; however, the calculations performed give the ratio of 4. Hence, this option is incorrect.
- B. This option suggests that the ratio between wavelengths is 2; however, the calculations performed give the ratio of 4. Hence, this option is incorrect.
- C. This option suggests that the ratio between wavelengths is 1; however, the calculations performed give the ratio of 4. Hence, this option is incorrect.
Q159. In half wave rectification, the output DC voltage is obtained across the load for:
- A. The positive half cycle of input AC✓
- B. The negative half cycle of input AC
- C. The positive and negative half cycles of input AC
- D. Either positive or negative half cycle of input AC
Explanation: In half wave rectification, the diode allows current to pass through during only one half of the AC input cycle, either the positive or the negative half, depending on the diode's orientation. This results in a pulsating DC output across the load for that half cycle only. Option D is correct as it encompasses both possibilities. Options A and B are correct under specific configurations but do not cover both scenarios. Option C is incorrect as it describes full wave rectification, where both half cycles are used.
Why the other options are wrong
- B. Similarly, if the diode is forward-biased for the negative half cycle, it will conduct during this half. The choice depends on the diode's configuration.
- C. This scenario occurs in full wave rectification, where both half cycles are utilized. It's not applicable to half wave rectification.
- D. The half-wave rectification: The diode conducts only during one half cycle of the input AC (the positive half if diode is forward-biased). Current flows through the load only in that half cycle. The other half cycle (negative half) is blocked.
Q160. A particle carrying a charge of 3e, accelerates through a potential difference of 2V. The energy acquired by it is:
- A. 1.6 X 10-19 J
- B. 9.6 X 10-19 J✓
- C. 9.6 X 10-18 J
- D. 1.6 X 10-18 J
Explanation: Energy acquired = 3e x 2V = 6eV = 6 x 1.6 x 10-19 = 9.6 x 10-19
Why the other options are wrong
- A. This option is incorrect as per the calculationsEnergy acquired = 3e x 2V = 6eV = 6 x 1.6 x 10-19 = 9.6 x 10-19
- C. This option is incorrect as per the calculationEnergy acquired = 3e x 2V = 6eV = 6 x 1.6 x 10-19 = 9.6 x 10-19
- D. This option is incorrect as per the calculationsEnergy acquired = 3e x 2V = 6eV = 6 x 1.6 x 10-19 = 9.6 x 10-19
Q161. For the radiotherapy of a patient, it is required to double the absorbed dose in gray. What step must be taken?
- A. Energy must be quadrated
- B. Energy must be halved
- C. Energy must be raised four times
- D. Energy must be doubled✓
Explanation: According to formula D=E/m, if the dose needs to be doubled the energy must be doubled.
Why the other options are wrong
- A. Quadrupling energy would significantly increase penetration, risking damage to healthy tissue.
- B. Halving energy might reduce tissue penetration, impeding effective treatment of the targeted area.
- C. Increasing energy fourfold could excessively penetrate, harming surrounding tissue and compromising patient safety.
Q162. A metallic circular ring is suspended by a string and is kept in a vertical plane. When a magnet is approached towards the ring then it will:
- A. Remain stationary
- B. Get displaced away from the magnet✓
- C. Get displaced towards the magnet
- D. Nothing can be said
Explanation: As the magnet is brought closer, the magnetic flux through the ring changes. By Lenz's law, a current will be induced in the ring that produces its own magnetic field which opposes the change in flux through the the ring. Therefore the induced magnetic field opposes the the field of the magnet. And hence, due to repulsion, the ring moves away from the approaching field.
Why the other options are wrong
- A. Option A is incorrect according to main explanation text.
- C. Option C is incorrect according to main explanation text.
- D. Option D is incorrect according to main explanation text.
Q163. In water pipes _ is used to detect leakages.
- A. Radioisotope✓
- B. Light
- C. Current
- D. Heat
Explanation: Radioisotope tracer technology is widely used to detect leakage of process pipe and heat exchanger system pipe that carries liquid and gas in the oil and gas industry. The same technique is also used to identify leaks in water pipes under the ground.
Why the other options are wrong
- B. b) Light: This option is used in some leak detection systems. Fiber optic sensors or laser-based systems can be used to detect changes in light intensity caused by water leakage. However, this method might not be suitable for all types of pipes and conditions.
- C. c) Current: This option is not commonly used for detecting leakages in water pipes. While changes in electrical conductivity can indicate the presence of water, other methods like pressure changes or acoustic sensing are usually more practical for leak detection.
- D. d) Heat: This option is sometimes used for leak detection. In some cases, thermal imaging or infrared cameras can detect temperature changes caused by water leaks. Water absorbs and conducts heat differently than surrounding materials, allowing for the identification of leaks.
Q164. If the temperature is increased from 200K to 800K, then what would be the change in pressure at constant volume?
- A. Increases by factor 4✓
- B. Decreases by factor 4
- C. Increases by factor 2
- D. Decreases by factor 2
Explanation: PV=NRΔT V=constant ;R=constant; N=constant so P is directly proportional to T as the temperature increases 4 times as it increases from 200K to 800K so the pressure will also increase 4 times.Just be careful that the units (especially temperature) are absolute.
Why the other options are wrong
- B. This option is incorrect as an increase in temperature leads to an increase in pressure, not a decrease.
- C. This option is incorrect. The increase in temperature from 200K to 800K corresponds to a factor of 4, not 2.
- D. This option is incorrect. As an increase in temperature leads to an increase in pressure, not a decrease.
Q165. Which of the following is an instrument for monitoring radiations:
- A. GM tube
- B. Radar
- C. Wilson cloud chamber
- D. Both A and C✓
Explanation: The Geiger-Mueller (GM) detector is a common portable instrument choice for a general laboratory radioactive material survey. GM detectors are capable of detecting alpha, beta, and gamma radiation. However, this instrument is limited by its ineffectiveness in detecting lower energy beta and gamma emitters.Radars send out electromagnetic waves as short pulses which may be reflected by objects in their path, in part reflecting to the radar. When these pulses intercept precipitation, part of the energy is scattered back to the radar.A cloud chamber, also known as a Wilson cloud chamber, is a particle detector used for visualizing the passage of ionizing radiation.
Why the other options are wrong
- A. The Geiger Mueller (GM) detector is a common portable instrument choice for a general laboratory radioactive material survey. GM detectors are capable of detecting alpha, beta, and gamma radiation. However, this instrument is limited by its ineffectiveness in detecting lower energy beta and gamma emitters. Geiger counter is also called a Geiger tube. This instrument is used for detecting and measuring ionizing radiation like alpha particles, beta particles, and gamma rays. A Geiger-Müller counter can count individual particles at rates up to about 10,000 per second and is used widely in medicine and prospecting for radioactive ores.
- B. Radars send out electromagnetic waves as short pulses which may be reflected by objects in their path, in part reflecting back to the radar. When these pulses intercept precipitation, part of the energy is scattered back to the radar. It is an electromagnetic sensor used for detecting, locating, tracking, and recognizing objects of various kinds at considerable distances. It operates by transmitting electromagnetic energy toward objects, commonly referred to as targets, and observing the echoes returned from them.
- C. A cloud chamber, also known as a Wilson cloud chamber, is a particle detector used for visualizing the passage of ionizing radiation.
Q166. When a conductor of a cross-sectional area 5x10-6 m2 carries a current of 6 A, the drift velocity of the conduction electrons is 1.2 x 10-4 ms1-. What is the number density (number per unit volume) of the conduction electrons?
- A. 4x10-28 m-3
- B. 1.6x10-27 m-3
- C. 2.5x10-27 m-3
- D. 6.3x1028 m-3✓
- E. 1.3x1034 m-3
Explanation: The formula for electric current relating the drift velocity is: I = neAV Where; I = Electric current n = Number of charges per unit volume e = Electron charge A = Cross sectional area V = Drift speed Solving for 'n' : n = I/eAV Here I = 6.0 Amp e = 1.6 x 10-19 C A = 5.0 x 10-6 m2 V = 1.2 x 10^-4 m/s Put all these values inabove equation and do the calculations: n = (6.0)/ (1.6 x 10-19) (5.0 x 10-6) (1.2 x 10-4) n = 6.3 × 1028 m-3 is the answer
Why the other options are wrong
- A. This is not correct as per calculationsThe formula for electric current relating the drift velocity is: 1 = nAqv where;I= electric currentn = number of charges per unit volumeq= electron chargeA= cross sectional areav = drift speedn = I/qAvHereI= 6.0 ampq=1.6 x 10-19A= 5.0 x 10-6 m²V= 1.2 x 10-4 m/sPut all these values in the equation and do the calculation:n= 6 / (5 x 10-6) (1.6 x 10-19) (1.2 x 10-4)n= 6.25 x 1028 m-3 (hence D is the correct option)
- B. This is not correct as per calculationThe formula for electric current relating the drift velocity is: 1 = nAqv where;I= electric currentn = number of charges per unit volumeq= electron chargeA= cross sectional areav = drift speedn = I/qAvHereI= 6.0 ampq=1.6 x 10-19A= 5.0 x 10-6 m²V= 1.2 x 10-4 m/sPut all these values in the equation and do the calculation:n= 6 / (5 x 10-6) (1.6 x 10-19) (1.2 x 10-4)n= 6.25 x 1028 m-3 (hence D is the correct option)
- C. This is not correct as per calculationThe formula for electric current relating the drift velocity is: 1 = nAqv where;I= electric currentn = number of charges per unit volumeq= electron chargeA= cross sectional areav = drift speedn = I/qAvHereI= 6.0 ampq=1.6 x 10-19A= 5.0 x 10-6 m²V= 1.2 x 10-4 m/sPut all these values in the equation and do the calculation:n= 6 / (5 x 10-6) (1.6 x 10-19) (1.2 x 10-4)n= 6.25 x 1028 m-3 (hence D is the correct option)
- E. This is not correct as per calculationThe formula for electric current relating the drift velocity is: 1 = nAqv where;I= electric currentn = number of charges per unit volumeq= electron chargeA= cross sectional areav = drift speedn = I/qAvHereI= 6.0 ampq=1.6 x 10-19A= 5.0 x 10-6 m²V= 1.2 x 10-4 m/sPut all these values in the equation and do the calculation:n= 6 / (5 x 10-6) (1.6 x 10-19) (1.2 x 10-4)n= 6.25 x 1028 m-3 (hence D is the correct option)
Q167. According to the first law of thermodynamics, ΔU = Q + W, where ΔU Is the increase in internal energy of the system, Q is the heat transferred to the system and W is the external work done by the system.Which of the following is NOT a correct expression?
- A. At constant temperature: Q = -W
- B. When no work is done: ΔU = Q
- C. In gaseous system: ΔU = Q + P Δ V
- D. When work is done by the system: ΔU = Q - W✓
Explanation: There are two sign conventions:1. ∆U= Q+W: Here, work done BYthe gas/system is taken POSITIVE. 2. ∆U= Q-W: Here, work done ON the gas/system is taken NEGATIVE. The equation provided in the question follows the first convention, according to which D is incorrect.
Why the other options are wrong
- A. ΔU = Δ K.E ΔK.E ∝ ΔT Since T is constant, change in temperature will be zero.Thys, ΔK.E is also zero.As, ΔU = ΔK.E, hence, ΔU is also zero.Hence, ∆U= Q+W 0 = Q + WQ = -W
- B. ΔU = Q +Wwhen W = 0ΔU = Q
- C. There are two sign conventions:1. ∆U= Q+W: Here, work done BYthe gas/system is taken POSITIVE. 2. ∆U= Q-W: Here, work done ON the gas/system is taken NEGATIVE in physics.
Q168. The half-life of C14 is about:
- A. 1637 years
- B. 892 years
- C. 10 years
- D. 100 years
- E. 5730 years✓
Explanation: Carbon-14 has a half-life of 5,730 ± 40 years—i.e. half the amount of the radioisotope present at any given time will undergo spontaneous disintegration during the succeeding 5,730 years.
Why the other options are wrong
- A. This is incorrect. 1637 years is not a recognized half-life for carbon-14 or any common isotope used in dating.
- B. This is incorrect. 892 years is not associated with the half-life of carbon-14.
- C. This is incorrect. 10 years is far too short for the half-life of carbon-14, which is used in dating ancient artifacts.
- D. This is incorrect. 100 years is not the half-life of carbon-14 and is not suitable for radiocarbon dating's time scale.
Q169. A ball is thrown vertically upward with the velocity of 98 m/sec, how high does the ball rise?
- A. 196 m
- B. 2 m
- C. 1/2 m
- D. 490 m✓
- E. 98 m
Explanation: s=u(t) + (at2)/2s= 98(t) - 4.9t20 = 98 - 9.81(t)t= 10 ss= 980 -490 = 490m This is the maximum height .
Why the other options are wrong
- A. This is incorrect. The calculation mistake occurs in the application of the third equation of motion.Using the correct formula: 2aS = vf2 - vi2, where vf = 0, vi = 98 m/s, and a = -9.8 m/s2, the correct height is 490 m.
- B. This option is incorrect. It suggests a drastic underestimation of the ball's maximum height.Re-evaluating with the third equation of motion shows that the correct height is 490 m.
- C. This option is also incorrect and significantly underestimates the height.The correct application of the third equation of motion results in a height of 490 m.
- E. This option is incorrect. It might be misleading as it matches the initial velocity, but does not represent the maximum height.The correct height calculated from the third equation of motion is 490 m.
Q170. What is the relationship between Power, Current and voltage?
- A. P=V/I
- B. P=VI✓
- C. 2P=I+V
- D. All of them
Explanation: Correct option is B.Electrical power is the product of voltage and current. P = V X IP = E t.P = W t.P = V 2 /R.P=I2R
Why the other options are wrong
- A. This option is incorrect representations of the relationship between power, current and voltage.
- C. This option is incorrect representations of the relationship between power, current and voltage.
- D. This option is incorrect representations of the relationship between power, current and voltage.
Q171. If '-' means'+', '+' means '-', '*' means '÷' and '÷' means '*' then which of the following will be the correct equation?
- A. 30 + 5 +14 -10 * 15 = 122
- B. 10 + 5 - 14 + 10 * 15 = 158
- C. 30 - 5 + 14 +10 * 15 = 162
- D. 30 * 5 - 4 + 10 - 30 = 30✓
Explanation: Option A: 30 + 5 +14 -10 * 15 = 122= 30 - 5 - 14 + 10 ÷ 15 (substituting the new symbols)= 30 - 5 - 14 + 0 (10 ÷ 15 = 0)= 11Option B: 10 + 5 - 14 + 10 * 15 = 158= 10 - 5 + 14 ÷ 10 - 15 (substituting the new symbols)= 10 - 5 + 1 - 15 (14 ÷ 10 = 1)= -9Option C: 30 - 5 + 14 +10 * 15 = 162= 30 + 5 - 14 - 10 ÷ 15 (substituting the new symbols)= 30 + 5 - 14 - 0 (10 ÷ 15 = 0)= 21 Option D: 30 * 5 - 4 + 10 - 30 = 30= 30 ÷ 5 + 4 - 10 + 30 (substituting the new symbols)= 6 + 4 - 10 + 30 (30 ÷ 5 = 6)= 30
Why the other options are wrong
- A. 30 + 5 +14 -10 * 15 = 122= 30 - 5 - 14 + 10 ÷ 15 (substituting the new symbols)= 30 - 5 - 14 + 0 (10 ÷ 15 = 0)= 11
- B. 10 + 5 - 14 + 10 * 15 = 158= 10 - 5 + 14 ÷ 10 - 15 (substituting the new= 10 - 5 + 1 - 15 (14 ÷ 10 = 1)= -9
- C. 30 - 5 + 14 +10 * 15 = 162= 30 + 5 - 14 - 10 ÷ 15 (substituting the new symbols)= 30 + 5 - 14 - 0 (10 ÷ 15 = 0)= 21
Q172. Statement: A large number of students are reported to be dropping out of school in villages as their parents want their children to help them in farms.Courses of Action:I. The government should immediately launch a programme to create awareness among the farmers about the value of education.II. The government should offer incentives to those farmers whose children remain in schools.III. Education should be made compulsory for all children up to the age of 14 and their employment banned.
- A. Only I and II follow
- B. Only II and III follow
- C. Only I and III follow
- D. All follow✓
Explanation: Literacy at basic level is the utmost need to prepare good future citizens. So, all children need to be educated. This can be achieved by creating awareness, providing incentives, enforcing education and banning employment of children. Thus, all the three courses follow.
Why the other options are wrong
- A. This is incorrect according to the interpretation.Literacy at basic level is the utmost need to prepare good future citizens. So, all children need to be educated. This can be achieved by creating awareness, providing incentives, enforcing education and banning employment of children. Thus, all the three courses follow.
- B. This is incorrect according to the interpretation.Literacy at basic level is the utmost need to prepare good future citizens. So, all children need to be educated. This can be achieved by creating awareness, providing incentives, enforcing education and banning employment of children. Thus, all the three courses follow.
- C. This is incorrect according to the interpretation.Literacy at basic level is the utmost need to prepare good future citizens. So, all children need to be educated. This can be achieved by creating awareness, providing incentives, enforcing education and banning employment of children. Thus, all the three courses follow.
Q173. I. An interior minister has been found as the owner of assets more than the stated income.II. The prime minister has ordered all the ministers to unveil their assets.
- A. Statement I is the cause and statement II is its effect.
- B. Statement II is the cause and statement I is its effect.✓
- C. Both statements I and II are independent causes.
- D. Both statements I and II are the effects of independent causes.
Explanation: In this scenario, Statement II (the prime minister's order for ministers to unveil their assets) is a direct response to the implications raised by Statement I (the discovery of the interior minister's assets exceeding declared income). Thus, Statement II is the effect of Statement I.Option A is incorrect because it reverses the cause-effect relationship. Option C is incorrect due to the absence of a common cause. Option D is also incorrect as both statements cannot be effects of independent causes; rather, they are part of a sequential cause-effect relationship.
Why the other options are wrong
- A. This option suggests that the discovery of the interior minister's assets leads to the prime minister's order. However, it lacks a direct causal link since the order could exist independently of the discovery.
- C. This option asserts that both statements arise from separate causes. However, it is incorrect as there is no indication of a third cause affecting both events.
- D. This option implies that both events are consequences of different causes. This is incorrect because the second statement is likely a direct response to the first.
Q174. Statements:All film stars are playback singers.All film directors are film stars.Conclusions:I. All film directors are playback singers.II. Some film stars are film directors.Which of the following is true?
- A. Only conclusion II follows
- B. Either I or II follows
- C. Neither I nor II follows
- D. Both I and II follows✓
Explanation: Since both the premises are universal and affirmative, the conclusion must be universal affirmative and should not contain the middle term. So, I follow. II is the converse of the second premise and so it also holds.
Why the other options are wrong
- A. Option A is incorrect because conclusion I does not necessarily follow. The statements only state that all film directors are film stars, but it doesn't guarantee that they are also playback singers.
- B. Option B is incorrect because both conclusions are not valid. Conclusion I is not necessarily true, and conclusion II is already given in the statements.
- C. Option C is correct because neither conclusion I nor II follows with certainty from the given statements.
Q175. Look at this series 7, 10, 8, 11, 9, 12. Which number do you think will be next?
- A. 10✓
- B. 13
- C. 7
- D. 12
Explanation: By examining the given series 7, 10, 8, 11, 9, and 12, we can identify a pattern where numbers alternate between increasing by 3 and decreasing by 2.To illustrate, we start with 7 and add 3 to obtain 10, then subtract 2 to yield 8. Continuing this pattern, we add 3 to 8 to get 11, subtract 2 to arrive at 9, and so forth.Applying this pattern to the series, the next number can be determined by subtracting 2 from 12, we get 10.
Why the other options are wrong
- B. This option is incorrect.By examining the given series 7, 10, 8, 11, 9, and 12, we can identify a pattern where numbers alternate between increasing by 3 and decreasing by 2.To illustrate, we start with 7 and add 3 to obtain 10, then subtract 2 to yield 8. Continuing this pattern, we add 3 to 8 to get 11, subtract 2 to arrive at 9, and so forth.Applying this pattern to the series, the next number can be determined by subtracting 2 from 12, we get 10.
- C. This option is incorrect.By examining the given series 7, 10, 8, 11, 9, and 12, we can identify a pattern where numbers alternate between increasing by 3 and decreasing by 2.To illustrate, we start with 7 and add 3 to obtain 10, then subtract 2 to yield 8. Continuing this pattern, we add 3 to 8 to get 11, subtract 2 to arrive at 9, and so forth.Applying this pattern to the series, the next number can be determined by subtracting 2 from 12, we get 10.
- D. This option is incorrect.By examining the given series 7, 10, 8, 11, 9, and 12, we can identify a pattern where numbers alternate between increasing by 3 and decreasing by 2.To illustrate, we start with 7 and add 3 to obtain 10, then subtract 2 to yield 8. Continuing this pattern, we add 3 to 8 to get 11, subtract 2 to arrive at 9, and so forth.Applying this pattern to the series, the next number can be determined by subtracting 2 from 12, we get 10.
Q176. P. Q, R, S and T are five people in the family, if P is the daughter of Q. Q is the son of R, R is father of S, while T is the daughter of P then which if following is true:
- A. R is the uncle of P
- B. R is the grandfather of P✓
- C. P and R are sisters
- D. Q is daughter of S
- E. That's an incorrect option. P is sister of T.
Explanation: According to given statement, P is daughter of Q who is son of R, so R is grand-father of P.
Why the other options are wrong
- A. That's an incorrect option.R is grand father of P.
- C. That's an incorrect option.R is grand father of P.
- D. That's an incorrect option. Q and S are brothers.
- E. P is mother of T.
Q177. In the following question, correct the equation by interchanging two signs: 9 x 3 + 8 ÷ 4 - 7 = 28
- A. x and -
- B. + and -
- C. ÷ and +
- D. x and ÷✓
Explanation: By interchanging the '×' and '÷' signs, the equation becomes 9 ÷ 3 + 8 × 4 - 7. Following the order of operations, this simplifies to 3 + 32 - 7 = 35 - 7 = 28, which is correct.
Why the other options are wrong
- A. Incorrect. Interchanging 'x' and '-' does not satisfy the equation.Expression becomes: 9 - 3 + 8 ÷ 4 x 7Calculate: 9 - 3 + 2 x 7 = 6 + 14 = 20, which is not equal to 28.
- B. Incorrect. Interchanging '+' and '-' does not satisfy the equation.Expression becomes: 9 x 3 - 8 ÷ 4 + 7Calculate: 27 - 2 + 7 = 32, which is not equal to 28.
- C. Incorrect. Interchanging '÷' and '+' does not satisfy the equation.Expression becomes: 9 x 3 - 8 ÷ 4 + 7Calculate: 27 - 2 + 7 = 32, which is not equal to 28.
Q178. In a code, TABLE = UBCMF, then CHAIR = ?
- A. DIBJS✓
- B. DIBKR
- C. DICJR
- D. DIBJR
Explanation: To solve this coding problem, observe that each letter in the word TABLE is shifted one position forward in the alphabet to form the code UBCMF. Therefore, 'T' becomes 'U', 'A' becomes 'B', 'B' becomes 'C', 'L' becomes 'M', and 'E' becomes 'F'. Applying this same logic to the word CHAIR, 'C' becomes 'D', 'H' becomes 'I', 'A' becomes 'B', 'I' becomes 'J', and 'R' becomes 'S', forming the code DIBJS. Therefore, DIBJS is the correct answer. Other options fail to consistently apply the shift, leading to incorrect results.
Why the other options are wrong
- B. This option incorrectly shifts only some of the letters correctly, resulting in an incorrect code.
- C. This option incorrectly shifts some letters more than others, leading to an incorrect result.
- D. This option incorrectly applies a different pattern to the last letter, resulting in an incorrect code.
Q179. Statements: All dogs are animals. Some animals are cats. Conclusions: I. Some cats are dogs. II. All dogs are cats.
- A. Only II
- B. Only I
- C. Neither✓
- D. Both
Explanation: The correct answer is Neither. Based on the statements, 'All dogs are animals' and 'Some animals are cats,' we cannot definitively conclude that 'Some cats are dogs' or 'All dogs are cats.' Statement I is incorrect because the statement 'Some animals are cats' does not establish a direct relationship between cats and dogs. Statement II is incorrect because the statement 'All dogs are animals' does not imply that all dogs are cats. Therefore, neither conclusion logically follows from the given statements.
Why the other options are wrong
- A. Conclusion II states that 'All dogs are cats,' which is not supported by the given statements.
- B. Conclusion I states that 'Some cats are dogs,' which cannot be deduced from the given statements.
- D. Both conclusions do not logically follow from the given statements.
More Sindh / DUHS Solved Papers
Biology
Sindh Botany 2018
16 solved MCQs
Biology
Sindh Botany 2019
16 solved MCQs
Biology
Sindh Botany 2021
20 solved MCQs
Biology
Sindh Botany 2022
15 solved MCQs
Biology
Sindh Botany 2024 Model Paper
15 solved MCQs
Chemistry
Sindh Chemistry 2018
16 solved MCQs
Chemistry
Sindh Chemistry 2019
17 solved MCQs
Chemistry
Sindh Chemistry 2021
43 solved MCQs
Chemistry
Sindh Chemistry 2022
33 solved MCQs